The concentration of glucose in the new solution will be
30 M mol/liter.
Subtract the solute's mass from the total volume of the solution. Using m as the solute's mass and V as the total volume of the solution, write out the equation C = m/V.
A concentrated solution is referred to as a stock solution since it will be diluted to a lesser concentration before usage. M₁V₁ = M₂V₂ is the dilution equation.
A diluted solution = stock solution.
M₁ is the stock solution's molarity.
M₂ stands for the diluted solution's molarity.
V1 is the volume of the starting solution.
V2 is the volume of the final solution.
M₁ = 90M mol/liter
V₁ = 20mL
V₂ = 40mL
Using the formula,
M₁V₁ = M₂V₂
20mL × 90 M mol/liter = 40mL × M₂
M₂ = 30 M mol/liter
Therefore, the concentration of glucose in the new solution will be
30 M mol/liter.
Learn more about concentration here:
https://brainly.com/question/14469428
#SPJ4
1.50 moles of N2 at 825 mmhg and 303 K are contained in a 34.3 L bottle. What is the pressure of the system if an additional 1.00 mole of gas is added to the bottle and the temperature is reduced to 273 K?
Answer:
1240 mmHg
Explanation:
Since volume is being held constant, we can use the following variation of the Ideal Gas Law to find the new pressure.
[tex]\frac{P_1}{T_1N_1}=\frac{P_2}{T_2N_2}[/tex]
In the equation, "P₁", "T₁", and "N₁" represent the initial pressure, temperature, and moles. "P₂", "T₂", and "N₂" represent the final pressure, temperature, and moles. Your answer should have 3 sig figs to match the sig figs of the given values.
P₁ = 825 mmHg P₂ = ? mmHg
T₁ = 303 K T₂ = 273 K
N₁ = 1.50 moles N₂ = 1.50 + 1.00 = 2.50 moles
[tex]\frac{P_1}{T_1N_1}=\frac{P_2}{T_2N_2}[/tex] <----- Formula
[tex]\frac{825 mmHg}{(303K)(1.50 moles)}=\frac{P_2}{(273 K)(2.50 moles)}[/tex] <----- Insert values
[tex]\frac{825 mmHg}{454.5}=\frac{P_2}{682.5}[/tex] <----- Simplify denominators
[tex]1.815=\frac{P_2}{682.5}[/tex] <----- Simplify left side
[tex]1238.86 mmHg={P_2}[/tex] <----- Multiply both sides by 682.5
[tex]1240 mmHg={P_2}[/tex] <----- Apply sig figs
Answer:1240
Explanation:
What is the daughter nucleus produced when zn63 undergoes electron capture? replace each question mark with the appropriate integer or symbol
The daughter nucleus that is produced is ₂₉⁶³cu.
What is Electron capture?
The process of drawing an electron to the nucleus, where it combines with a proton to create a neutron and a neutrino particle, is known as electron capture.
The daughter nucleus is the nucleus that is made by the parent nucleus. The nucleus that remains after the decay is called the daughter nucleus.
Here is the chemical formula for the reaction that results in the electron capture of the zinc-63 nucleus:
[tex]_A^ZX + e^- = _A^Z_-_1 Y + ye[/tex]
[tex]_3_0^6^3Zn\; + e^- = _2_9^6^3Cu + ye[/tex]
Thus, the daughter nucleus produced when zn63 undergoes electron capture is [tex]_2_9^6^3Cu[/tex].
To learn more about Electron capture, refer to the below link:
https://brainly.com/question/10964824
#SPJ4
If the a of a monoprotic weak acid is 2. 6×10−6, what is the ph of a 0. 33 m solution of this acid?
The pH of the monoprotic weak acid is 2.79.
What are weak acids?The weak acids are the acids that do not fully dissociate into ions in the solution. Strong acids fully dissociate into ions.
The chemical reaction is HA(aq) ⇄ A⁻(aq) + H⁺(aq).
c (monoprotic acid) = 0.33 M.
Ka = 1.2·10⁻⁶
[A⁻] = [H⁺] = x
[HA] = 0.33 M - x
Ka = [A⁻]·[H⁺] / [HA]
2. 6 × 10⁻⁶ = x² / (0.33 M - x)
Solve quadratic equation: [H⁺] = 0.000524 M.
pH = -log[H⁺]
pH = -log(0.000524 M)
pH = 2.79
Thus, the pH of the monoprotic weak acid is 2.79
To learn more about weak acids, refer to the below link:
https://brainly.com/question/13032224
#SPJ4
Potassium permanganate is a strong oxidizer that reacts explosively with easily oxidized materials. What is its formula?
Answer: KMnO4 (subscript 4)
For a typical titration, 0. 010 m naoh is the titrant (in the buret). if the initial buret reading is 2. 45 ml, and the final buret reading is 18. 70 ml, how much naoh was used for the titration?
16.25 ml NaOH was used for the titration.
Titration:"The process of calculating the quantity of a material A by adding measured increments of substance B, the titrant, with which it reacts until exact chemical equivalency is obtained (the equivalence point)" is the definition of titration.
A titration is a method for figuring out the concentration of an unknown solution by using a solution with a known concentration. Until the reaction is finished, the titrant (the known solution) is typically added from a buret to a known volume of the analyte (the unknown solution).
0. 010 m NaOH is the titrant (in the buret).
The initial buret reading is 2. 45 ml
The final buret reading is 18. 70 ml
The volume of NaOH = 18.70ml - 2.45 ml
= 16.25 ml
Therefore, 16.25 ml NaOH was used for the titration.
Learn more about titration here:
https://brainly.com/question/27107265
#SPJ4
What is regular (specular)
reflection?
A. when all light rays come in at different angles of
incidence
B. when the rays of light reflect at different angles
C. when all light rays reflect at the same angle
D. when all light rays are perpendicular
Answer:
specular reflection reflects all light which arrives from a given direction at the same angles where diffus reflection reflects light in a broad range of direction
g. Hot water at 100 °C is added to 300 g of water at 0 °C until the final temperature is 40 °C. Find the mass of the hot water added. The specific heat capacity of water is 4200 Jkg-¹°C¹.
Answer:
000
Explanation:
hi
my
name
is
God
000answer
What process permanently rearranges the basic structure of curly hair into a straight or smoother form?
Chemical hair relaxing is the process that permanently rearranges the basic structure of curly hair into a straight or smoother form.
Chemical relaxers disrupt disulfide bonds by using chemicals and extremely high heat.
The procedure of permanently altering the fundamental structure of excessively curly hair into a straight shape is known as chemical hair relaxing.
Professionally performed, it leaves the hair straight and in good enough condition to be styled into practically any shape.
Sodium hydroxide, which does not require pre-shampooing, and ammonium thioglycolate, which may require pre-shampooing, are the two main categories of hair relaxers.
Processing, neutralizing, and conditioning are the three fundamental phases in all chemical hair relaxing procedures.
Hence, Chemical hair relaxing is the process that permanently rearranges the basic structure of curly hair into a straight or smoother form.
Learn more about chemical hair relaxing here https://brainly.com/question/5142460
#SPJ4
For the reaction ag2s(s) ⇌ 2ag (aq) + s2−(aq). What happens to the equilibrium position if the amount of silver ion is halved?
The equilibrium shifts to the right.
What is Equilibrium law?According to this law, if a process in equilibrium is subjected to change in the factors that affect equilibrium, then the equilibrium shifts in a specific direction which tends to counteract the effect of change imposed.The common ion effect is a result of this lawFactors affecting equilibrium areChange in concentration of reactants or productChange in temperatureChange in pressureAdding an inert gasAccording to this law,
The concentration of the product is decreased and hence, the equilibrium shifts to the right.
Learn more about Equilibrium law:
https://brainly.com/question/19340344
#SPJ4
Which term describes this molecular shape?
Answer:
B.) Trigonal planar
Explanation:
This molecule has 3 bonds and no lone pairs. The angles are all 120° and the bonds are within the same plane. These molecules have the molecular shape of trigonal planar.
3. 2.71x1022 molecules of CO2 to atoms I NEED HELP
2.71 x 10²² molecules of CO2 is equivalent to 2.71 x 10²² atoms.
What is number of molecules?The number of molecules in an element is the combination of atoms in that element.
The number of molecules of an element can be calculated by multiplying the number of moles of that element by Avogadro's number, which is 6.02 × 10²³.
However, the number of molecules in a substance is equivalent to the number of atoms in that substance.
Therefore, 2.71 x 10²² molecules of CO2 is equivalent to 2.71 x 10²² atoms.
Learn more about number of atoms at: https://brainly.com/question/14190064
#SPJ1
The malonic ester synthesis is a method for preparing carboxylic acids from alkyl halides. For each of the carboxylic acid products, draw the structure of the alkyl bromide that would be used in its synthesis.
Haloalkanes are another name for alkyl halides. Alkyl halides are substances in which halogen atoms have taken the place of one or more hydrogen atoms in an alkane (fluorine, chlorine, bromine, or iodine).
What is the structural property of alkyl bromide?Alkyl halides are halogen-substituted alkanes in which a halogen atom, such as fluorine, chlorine, bromine, or iodine, is used in place of one or more hydrogen atoms in an alkane. An alkyl halide has a link between the carbon atom and the halogen atom, which is sp3-hybridized and has a tetrahedral form.Vinyl halides are substances, as opposed to alkyl halides, in which a halogen atom is attached to a sp2-hybridized carbon atom of a carbon-carbon double bond (C=C). In contrast, aryl halides are substances in which a halogen atom is joined to an aromatic ring's sp2-hybridized carbon atom.Alkyl halides are further divided into primary, secondary, and tertiary alkyl halides based on the level of substitution at the carbon atom holding the halogen. The term "- carbon" refers to the carbon that is bound to a halogen atom. The term "-carbon" refers to the carbon atom that is connected to it. Greek alphabets are then used to represent the neighboring carbons (, and so on).To learn more about Alkyl halides click here-
https://brainly.com/question/25175333
#SPJ4
Which are products of nuclear fusion? check all that apply. energy helium gas high temperatures hydrogen gas low pressure
The products created during nuclear fusion are Energy and Helium Gas
Overall, two positrons, two neutrinos (which convert two of the protons into neutrons), and energy are released along with the fusion of four protons into one alpha particle.
What is Nuclear fission ?Nuclear fission is a nuclear reaction in which low energy neutrons are used to smash the nucleus of an atom into smaller nuclei. In this process, a large amount of energy is released. Nuclear fission reactions are employed in nuclear power reactors due to their simplicity and high energy output.
What is Nuclear fusion ?When two or more atoms come together to produce one heavier nucleus, the process is known as nuclear fusion. This process releases a tremendous quantity of energy, far more than the energy
Learn more about Nuclear fusion and fission here:
https://brainly.com/question/13859758
#SPJ4
Calculate the number of atoms in a 5.31 x 10³ g sample of sodium.
number of atoms:
Answer:
no of atoms = 13.9 x 10^25
Explanation:
No. of moles = mass of compound / molar mass of compound
As ; mass of sodium = 5.3 x 10^3 g
Molar mass of sodium = 22.9 g/ mol
putting values
n = 5.3 x 10^3 / 22.9
n = 231.4 mol
Also; no of mol (n) = no of particles / Avagadros number
so no of particles = n x Avagadros no.
put n = 231.4 and Avagadros no = 6.023 x 10^23
no of particles = 231.4 x 6.023 x 10^23
= 13.9 x 10^25
He heat of solution of kcl is 17. 2 kj/mol and the lattice energy of kcl(s) is 701. 2 kj/mol. calculate the total heat of hydration of 1. 00 mol of gas phase k ions and cl– ions
The total heat of hydration of 1. 00 mol of gas phase [tex]K^{+}[/tex] ions and [tex]Cl^{-}[/tex]ions is - 684 kJ/mol.
Calculation ,
Given data ,
Heat of solution = 17. 2 kJ/mol
lattice energy of KCl(s) = 701. 2 kJ/mol.
heat of hydration = ?
The KCl is formed by[tex]K^{+}[/tex] ions and [tex]Cl^{-}[/tex]– ions
Δ[tex]H_{solution}[/tex] = U° + Δ[tex]H_{hydration}[/tex]
Δ[tex]H_{hydration}[/tex] = Δ[tex]H_{solution}[/tex] - U° = 17. 2 kJ/mol - 701. 2 kJ/mol = - 684 kJ/mol
Hence, heat of hydration of 1. 00 mol of gas phase [tex]K^{+}[/tex] ions and [tex]Cl^{-}[/tex] ions is - 684 kJ/mol.
To learn more about hydration
https://brainly.com/question/15724859
#SPJ4
What is the mass (g) of a piece of magnesium wire that produces 41. 8 ml of hydrogen gas collected over water at 21. 0 °c and at a pressure of 752 torr?
The mass (g) of a piece of magnesium wire that produces 41. 8 ml of hydrogen gas collected over water at 21. 0 °c and at a pressure of 752 torr is 0.041 gm.
Calculation,
According to ideal gas equation,
PV = nRT
Where, P is the pressure = 752 torr = 752 mmHg/760 mmHg/atm
P is the pressure in atm = 0.989atm
V is the volume = 41. 8 ml = 0.0418 L
R is the universal gas constant = 0.0821 Latm/mol K
T is the temperature = 21. 0 °C = 21. 0 + 273 = 294 K
n is the number of moles = ?
By putting value of P , V , T , and R in equation (i) we get,
0.989atm × 0.0418 L = n ×0.0821 Latm/mol K ×294 K
n = 0.989atm × 0.0418 L/0.0821 Latm/mol K×294 K = 0.00171 mol
Number of moles (n) = given mass/ molar mass = given mass/24.305
Mass = Number of moles×molar mass = 0.00171 mol×24.305 g/mol
Mass of the magnesium wire = 0.041 gm
learn more about hydrogen gas
https://brainly.com/question/12745309
#SPJ4
Is this equation balanced and in the lowest form? 4NH3 → 2N2 + 6H2
A.
Yes, because there are equal amounts of atoms of each element on both sides.
B.
No, because the coefficients could be reduced to 2,1, and 3.
C.
Yes, because the coefficients are in their lowest whole number ratio.
D.
No, because the coefficients could be reduced to 2, 2, and 4.
Answer:
B.) No, because the coefficients could be reduced to 2,1, and 3.
Explanation:
The equation is not in its lowest molar ratio form. In this case, all of the coefficients can be divided by 2 and still result in whole numbers.
As such, the correct balanced equation is:
2 NH₃ ----> N₂ + 3 H₂
A sparingly soluble metal fluoride with formula mf2, where m is an unknown metal, has a ksp = 6. 65 x 10-6. calculate the concentration of f- in solution
A sparingly soluble metal fluoride with formula MF₂, where m is an unknown metal, has a Ksp = 6.65 x 10⁻⁶. The concentration of F⁻ in solution 2.36 x 10⁻³M
Ksp is called the Molar solubility product and S is the Molar solubility of an ion in a solution.
According to given formula, the dissociation of metal fluoride MF₂ occurs as follows in aqueous solution:
MF₂ ------> M⁺² + 2F⁻
S 2S
Ksp = [S] [2S]²
Ksp = 4S³
Given, Ksp = 6.65 x 10⁻⁶
On substituting,
6.65 x 10⁻⁶ = 4S³
S³ = 1.66 x 10⁻⁶
S = 1.18 x 10⁻³
So, Solubility of F⁻ ion = 2S
Solubility of F⁻ ion = 2(1.18 x 10⁻³)
Solubility of F⁻ ion = 2.36 x 10⁻³
Since Molarity of the ions is equal to the solubility of the ion in aqueous solution.
Hence, the concentration of F⁻ ion is 2.36 x 10⁻³M.
Learn more about Molar solubility here, https://brainly.com/question/16243859
#SPJ4
The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a ________ group
The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a Carboxyl group.
What is the Carboxyl Group ?The carboxyl group is an organic functional group. Carboxyl group contains two functional groups that is carbonyl group (C = O) and hydroxyl group (OH) which attached with single carbon atom. The structural formula for carboxyl group is RCOOH where R is alkyl or aryl group.
Example of Carboxyl group: HCOOH (Methanoic Acid) , CH₃COOH (Ethanoic acid) etc.
Thus from the above conclusion we can say that The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a Carboxyl group.
Learn more about the Carboxyl group here: https://brainly.com/question/15942533
#SPJ4
At 2525 °c, what is the hydroxide ion concentration, [oh−][oh−] , in an aqueous solution with a hydrogen ion concentration of [h ]=1. 5×10−6[h ]=1. 5×10−6 m?
The hydroxide ion concentration [OH-] in an aqueous solution is 6.66 x 10⁻⁹ M
Experimental measurements of the pKw of water at 25ºC yielded a result of 14.0. The same method used to determine the pKa of all other water-soluble compounds that can function as acids in aqueous solution can also be used to determine this value from the examination of thermodynamic or electrochemical data for these aqueous solutions.
Water has a pkw=14
So it can be represented as,
[H+] [OH-] = 1×10^-14
Given [H+] = 1. 5×10^−6
So, [OH-] = (1*10^-14) / ( 1.5*10^-6)
= 6.66 x 10⁻⁹ M
To know more about Aqueous Solution refer:
https://brainly.com/question/19587902
#SPJ4
The reaction of hydrogen bromide(g) with chlorine(g) to form hydrogen chloride(g) and bromine(g) proceeds as follows:
2HBr(g) + Cl2(g) -->2HCl(g) + Br2(g)
When 23.5 g HBr(g) reacts with sufficient Cl2(g), 11.8 kJ is evolved.
Calculate the value of △,H for the chemical equation given.
Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh
The products formed when ester is treated with lithium hydroxide and water is given below.
[tex]CH_{3} CH_{2} CH(CH_{3} )OC=OCH(CH_{3} )_{2} +LiOH +H_{2} O[/tex]→[tex]CH_{3} CH_{2} CH(CH_{3} )OH+LiOC=OCH(CH_{3} )_{2} +H_{2} O[/tex]
The products formed when ester is treated with lithium hydroxide and water is alcohol and salt of acid.
The reaction of ester with water in the presence of base is called hydrolysis of ester in the presence of base. The product of hydrolysis of of ester in the presence of base ( lithium hydroxide ) is alcohol and salt of acid.
The hydrolysis of ester is also takes place in the presence of acid and give the product of alcohol and carboxylic acid. Lithium hydroxide is an inorganic base and it is soluble in water and slightly soluble in ethanol. The Lithium hydroxide is less soluble in water as compare to sodium hydroxide due to the anomalous behavior shown by lithium from rest of the family member.
to learn more about ester please click here.
https://brainly.com/question/10840252
#SPJ4
What volume of H2 gas will be produced if 60 L of ammonia, NH3, is decomposed into H2 and N2, assuming that all conditions are at STP?
a)
30 L
b)
90 L
c)
60 L
d)
120 L
e)
150 L
need answer ASAP!!
Answer:
I think the answer is c I'm not sure but probaly dont put c if your. ot sure try looking up the answers that helps me alot through my word
The volume of H₂ gas produced is approximately 90 L, Option (b) is correct.
To find the volume of H₂ gas produced when 60 L of ammonia (NH₃) is decomposed, we use the balanced chemical equation for the decomposition of ammonia:
2 NH₃(g) → 3 H₂(g) + N₂(g)
According to the equation, 2 moles of ammonia produce 3 moles of hydrogen gas (H₂). At STP (Standard Temperature and Pressure), 1 mole of any gas occupies 22.4 liters.
First, calculate the moles of ammonia present in 60 L:
Moles of NH₃ = Volume / Molar Volume at STP = 60 L / 22.4 L/mol ≈ 2.68 moles
Using the stoichiometric ratio, 3 moles of H₂ are produced from 2 moles of NH₃. So, we can calculate the moles of H₂ produced:
Moles of H₂ = (3/2) * Moles of NH₃ ≈ (3/2) * 2.68 moles ≈ 4.02 moles
Now, find the volume of H₂ gas produced:
Volume of H₂ = Moles of H₂ * Molar Volume at STP = 4.02 moles * 22.4 L/mol ≈ 89.9 L
Rounded to one decimal place, the volume of H₂ gas produced is approximately 90 L, which corresponds to option b).
To learn more about H₂ gas here
https://brainly.com/question/31127081
#SPJ2
A buffer is prepared by adding 300. 0 ml of 2. 0 mnaoh to 500. 0 ml of 2. 0 mch3cooh. what is the ph of this buffer? ka= 1. 8 10-5(ans. 4. 92)
The Henderson-Hasselbalch equation can be used to determine the pH of the buffer from the pKa value. The pH of the buffer will be 4.75.
What is the Henderson-Hasselbalch equation?Henderson-Hasselbalch equation is used to determine the value of pH of the buffer with the help of the acid disassociation constant.
Given,
Acid disassociation constant (ka) = 1. 8 10⁻⁵
Concentration of NaOH = 2.0 M
Concentration of CH₃COOH = 2.0 M
pKa value is calculated as,
pKa = -log Ka
pKa = - log (1. 8 x 10⁻⁵)
Substituting the value of pKa in the Henderson-Hasselbalch equation as
pH = - log (1. 8 x 10⁻⁵) + log [2.0] ÷ [2.0]
pH = - log (1. 8 x 10⁻⁵) + log [1]
= 4.745 + 0
= 4.75
Therefore, 4.75 is the pH of the buffer.
Learn more about the Henderson-Hasselbalch equation here:
https://brainly.com/question/27751586
#SPJ4
When nahco3 completely decomposes, it can follow this balanced chemical equation: 2nahco3 → na2co3 h2co3 determine the theoretical yields of each product using stoichiometry if the mass of the nahco3 sample is 3.80 grams. (show work for both) in an actual decomposition of nahco3, the mass of one of the products was measured to be 2.36 grams. identify which product this could be and justify your reasoning. calculate the percent yield of the product identified in part b. (show your work)
Theoretical yield = 2.397
The product could be sodium carbonate
percent yield = 98.456%
When nahco3 completely decomposes, it can follow this balanced chemical equation:
2nahco3 → na2co3 h2co3
If the mass of the NaHCO3 sample is 3.80 g, we must use stoichiometry to calculate the theoretical yields of each of the products.
mass of NaHCO₃ = 3.80 g
molar mass of NaHCO₃ = 84 g/mol
so the no of moles of NaHCO₃ = 3.80/84 = 0.0452 mol
You see, one mole of sodium carbonate and one mole of hydrogen carbonate are produced from two moles of sodium bicarbonate.
so, the no of moles of sodium carbonate = 0.0452/2 = 0.0226 mol
∴ mass of sodium carbonate ( Na₂CO₃) = no of moles of Na₂CO₃ × molar mass of Na₂CO₃
= 0.0226 × 106 ≈ 2.397 g
no of moles of hydrogen carbonate = 0.0452/2 = 0.0226 mol
mass of the hydrogen carbonate ( H₂CO₃) = no of moles of H₂CO₃ × molar mass of H₂CO₃
= 0.0226 × 62 g = 1.401 g
mass of one of the products was measured to be 2.36 g , from above data, we can say it must be sodium carbonate because value is the nearest of 2.397 g.
percentage yield = experimental yield/theoretical yield × 100
here experimental yield of Na₂CO₃ = 2.36 g
and theoretical yield of Na₂CO₃ = 2.397 g
∴ % yield = 2.36/2.397 × 100 ≈ 98.456%
Therefore the percentage yield of the product is 98.456%
To learn more about percentage yield visit:
https://brainly.com/question/22257659
#SPJ4
THEIR ANSWER IS RIGTH, ALL THREE PARTS
Theoretical yeild is 2.397, sodium bicarbonate is the possible product I chose, and percent yeild is 98.456
What is the oxidation number for n in the compound nh3? (recall that h usually has an oxidation number of 1.)
The oxidation number for n in the compound [tex]NH_{3}[/tex] will be -3.
The charge an atom would have if all of its links to other atoms formed fully ionic could be known as the oxidation state, also known as the oxidation number. It describes how much an atom in a chemical molecule has been oxidized. The oxidation state can theoretically be positive, negative, and zero.
The oxidation number of N in [tex]NH_{3}[/tex] will be calculated as:
Let the oxidation number of H is 1.
[tex]NH_{3}[/tex] = 0
x + 3(1) = 0
x = -3.
Therefore, the oxidation number for N in the compound [tex]NH_{3}[/tex] will be -3.
To know more about oxidation number
https://brainly.com/question/15167411
#SPJ4
What volume will 5.6 moles of sulfur hexafluoride
(SF6) gas occupy if the temperature and pressure of
the gas are 128°℃ and 9.4 atm?
Answer:
19.6 L SF₆
Explanation:
To find the volume, you need to use the Ideal Gas Law:
PV = nRT
In this equation,
-----> P = pressure (atm)
-----> V = volume (L)
-----> n = moles
-----> R = Ideal Gas constant (0.08206 atm*L/mol*K)
-----> T = temperature (K)
After converting the temperature from Celsius to Kelvin, you can plug the given values into the equation and simplify to find "V".
P = 9.4 atm R = 0.08206 atm*L/mol*K
V = ? L T = 128 °C + 273.15 = 401.15 K
n = 5.6 moles
PV = nRT
(9.4 atm)V = (5.6 moles)(0.08206 atm*L/mol*K)(401.15 K)
(9.4 atm)V = 184.3429
V = 19.6 L
If the density of blood is 1. 060 g/ml. What is the mass of 6. 56 pints of blood?
Answer:
3290 gm
Explanation:
6.56 pints * 473.1765 ml/pint * 1.060 g/ml = 3290 gm
If the density of blood is 1. 060 g/ml. 3290 grams is the mass of 6. 56 pints of blood.
In the study of chemistry, physics, and engineering, comprehending and characterising different substances depend greatly on density, a fundamental physical attribute. It is described as the ratio of a material's mass to volume. Being an intense quality, density is solely reliant on the composition of the substance and is not dependent on its quantity.
1 pint=473.176 milliliters.
6.56 pints ×473.176 ml/pint = 3099.57 milliliters
Density of blood = 1.060 g/ml
Volume of blood = 3099.57 ml
Mass = Density × Volume
Mass = 1.060 g/ml × 3099.57 ml ≈ 3290 grams
To know more about density, here:
https://brainly.com/question/29775886
#SPJ7
What mass of silver can be plated onto an object in 33. 5 minutes at 8. 70 a of current? ag (aq) e- → ag(s) 19. 6 g 9. 78 g 0. 326 g 3. 07 g 0. 102 g
Mass of silver can be plated onto an object in 33. 5 minutes at 8. 70 a of current is 19.55 g
Given, I=8.70A, t=33.5min=33.5*60=2010 sec, m of Ag = 19600g M=107.87 g/mol
From faradays law we can write q=I*t= 8.70*2010=17487 C.
moles of Ag =17487/ 19600=0.1812 moles
Ag deposited = 0.1812*107.87 = 19.55 g
SilverHaving the atomic number 47 and the Latin word argentum, which means "bright" or "white," silver is a chemical element. Its symbol is Ag. The highest electrical, thermal, and reflectivity of any metal are displayed by this transition metal, which is soft, white, and lustrous. The metal can be found in the Earth's crust in three different forms: as an alloy with other metals like gold and in minerals like argentite and chlorargyrite. It can also be found in its pure, free elemental form, also known as "native silver." During the refining of copper, gold, lead, and zinc, the majority of silver is created as a byproduct. As a valuable metal, silver has long been treasured.
What mass of silver can be plated onto an object in 33. 5 minutes at 8. 70 a of current? ag (aq) e- → ag(s) 19. 6 g 9. 78 g 0. 326 g 3. 07 g 0. 102 g
Learn more about Silver here:
https://brainly.com/question/14587716
#SPJ4
340. ml of a 0. 150 m solution of nh3(aq) is titrated with 0. 100 m hcl. calculate the ph of the solution after 350. ml of hcl has been added. (ka(nh4 ) = 5. 6 x 10-10)
340. ml of a 0. 150 m solution of nh3(aq) is titrated with 0. 100 m hcl. the ph will be 7 of the solution after 350. ml of hcl has been added. (ka(nh4 ) = 5. 6 x 10-10).
What is ph?The ph. of a solution gives information about the concentration of hydrogen ion in the solution or the solution is acidic or basic in nature if the given value is 7 then the solution is neutral or greater then 7 then basic and less then 7 then acidic.
Here, NH3 is a base while adding HCl to it the reaction gets neutralized and known as neutralizatio reaction and attend the ph. of value 7.
After due to the formation of hydronium ion the ph. would be less then 7.
Therefore, the ph. is 7.
Learn more about ph , here:
https://brainly.com/question/14253666
#SPJ4