Which metal would spontaneously reduce pb2 ?

Answers

Answer 1

According to the standard reduction potential table, metals that are located higher in the table have a greater tendency to undergo reduction and therefore can spontaneously reduce ions of metals that are located lower in the table.

In this case, Pb2+ is the ion of lead, and metals that are located higher than lead in the table can spontaneously reduce it.

Aluminum (Al), zinc (Zn), and iron (Fe) are located higher than lead in the table and can spontaneously reduce Pb2+. Therefore, any of these metals would spontaneously reduce Pb2+.

To know more about standard reduction potential refer here

https://brainly.com/question/23881200#

#SPJ11


Related Questions

write a balanced chemical equation showing how an aqueous suspension of this compound reacts to the addition of a strong acid. use h to represent the strong acid.

Answers

The balanced chemical equation showing how an aqueous suspension of chromium(III) hydroxide (Cr(OH)3) reacts to the addition of a strong acid (H+) is: Cr(OH)3 + 3H+ → Cr3+ + 3H2O

What is chemical equation?

A chemical equation uses chemical formulas and symbols to clearly depict a chemical reaction. It displays the reactants on the left and the products on the right, with an arrow separating them. The equation lists the names and amounts of the constituent parts of the reaction. For instance:

2H2 + O2 → 2H2O

This equation illustrates how oxygen gas (O2) and hydrogen gas (H2) react to form water (H2O). The stoichiometric ratios, denoted by the coefficients in front of the formulas, show the relative amounts of each substance involved in the reaction.

When a strong acid, represented by H+, is added to an aqueous suspension of chromium(III) hydroxide, the chromium(III) hydroxide acts as a base and accepts the proton (H+). In the balanced equation, three H+ ions react with one molecule of chromium(III) hydroxide, resulting in the formation of chromium(III) ion (Cr3+) and three water molecules (H2O).

Chromium(III) hydroxide has the ability to react with the strong acid due to the presence of hydroxide ions (OH-) in its structure. The hydroxide ions can accept protons from the strong acid, causing the formation of water. This reaction demonstrates the amphiprotic nature of chromium(III) hydroxide, as it can act as a base and accept protons when reacting with a strong acid.

To learn more about chemical reaction  from the given link .

https://brainly.com/question/11231920#

#SPJ4

Complete Question

Chromium(III) hydroxide is amphiprotic.

Write a balanced chemical equation showing how an aqueous suspension of this compound reacts to the addition of a strong acid. Use H+ to represent the strong acid.

To calculate how many grams NH3 will be formed from 6. 0 g H2, the first step you need



A) information about chemical reaction is balanced or not.


B) set up given mole ratio of reactant vs products.


C) information about the mass of N2 reacting.


D) Set up mole ratios of reactants vs products from balanced chemical equation.



N2 + H2 → NH3

Answers

The correct answer is D) Set up mole ratios of reactants vs products from balanced chemical equation.

In order to calculate how many grams of NH3 will be formed from 6.0 g of H2, we need to set up the appropriate mole ratios from the balanced chemical equation. The balanced equation given is:

N2 + H2 → NH3

From this equation, we can determine the stoichiometric relationship between the reactants (N2 and H2) and the product (NH3). The coefficients in the balanced equation represent the mole ratios.

In this case, we see that the coefficient of H2 is 3, indicating that 3 moles of H2 react with 1 mole of NH3. Therefore, we can set up the mole ratio:

3 moles H2 : 1 mole NH3

Since we are given the mass of H2 (6.0 g), we would then convert this mass to moles using the molar mass of H2. Once we have the moles of H2, we can use the mole ratio to calculate the moles of NH3 formed. Finally, we can convert the moles of NH3 to grams using the molar mass of NH3.

To learn more about mole click here:brainly.com/question/28239680

#SPJ11

In order for materials to not affect the atmosphere by light, they must?

Answers

In order for materials to not affect the atmosphere by light, they must exhibit properties that minimize their interaction with light. This can be achieved through various means.

1. Transparency: Materials should allow light to pass through them without significant absorption or scattering. Transparent materials transmit light without altering its properties.

2. Low reflectivity: Materials should have low reflectance, meaning they reflect minimal amounts of incident light. This prevents light from being redirected or bounced back into the atmosphere.

3. Low emissivity: Materials should have low emissivity, meaning they emit minimal amounts of light when heated. This reduces the contribution of materials to radiative heat transfer and energy loss.

By minimizing absorption, scattering, reflectivity, and emissivity, materials can have a minimal impact on the atmosphere by light.

To learn more about light click here:

brainly.com/question/20113876

#SPJ11

State and Explain (of SEE-I) as you answer the following two questions.
a. Is the following unbalanced reaction spontaneous at all temperatures?
CH3CH2OH(l) + O2(g)LaTeX: \longrightarrowCO2(g) + H2O(g)
b. Write a formation reaction for manganese(II) perchlorate. What are the units on the enthalpy term? On the entropy term?

Answers

a. State: The question is asking whether the given chemical reaction is spontaneous at all temperatures.

Explain: Spontaneous reactions are those that occur without any external influence and result in a decrease in free energy.

To determine whether a reaction is spontaneous, we can calculate its Gibbs free energy change (ΔG) using the equation ΔG = ΔH - TΔS, where ΔH is the enthalpy change, T is the temperature, and ΔS is the entropy change.

If ΔG is negative, the reaction is spontaneous. If ΔG is positive, the reaction is non-spontaneous. If ΔG is zero, the reaction is at equilibrium.

To calculate ΔG for the given reaction, we first need to balance the equation:

2CH3CH2OH(l) + 3O2(g) -> 2CO2(g) + 3H2O(g)

ΔH can be found from standard enthalpies of formation:

ΔH = ΣnΔHf(products) - ΣmΔHf(reactants)

= (2ΔHf(CO2) + 3ΔHf(H2O)) - (2ΔHf(CH3CH2OH) + 3ΔHf(O2))

= (-1367.6 kJ/mol)

ΔS can be calculated from the standard entropies of the reactants and products:

ΔS = ΣnS(products) - ΣmS(reactants)

= (2S(CO2) + 3S(H2O)) - (2S(CH3CH2OH) + 3S(O2))

= (-547.5 J/mol·K)

Substituting these values into the equation for ΔG:

ΔG = ΔH - TΔS

= (-1367.6 kJ/mol) - T(-0.5475 kJ/mol)

= (-1367.6 + 0.5475T) kJ/mol

Since ΔG is negative for all temperatures, the reaction is spontaneous at all temperatures.

b. State: The question is asking to write a formation reaction for manganese(II) perchlorate and state the units on the enthalpy and entropy terms.

Explain: A formation reaction is a chemical reaction that forms one mole of a substance from its constituent elements in their standard states.

The enthalpy change for a formation reaction is called the standard enthalpy of formation (ΔHf), and it is typically reported in units of kJ/mol.

The entropy change for a formation reaction is called the standard entropy of formation (ΔSf), and it is typically reported in units of J/mol·K.

The formation reaction for manganese(II) perchlorate can be written as:

Mn(s) + Cl2(g) + 2H2O(l) + 7/2O2(g) -> Mn(ClO4)2(s) + 2H+(aq)

The enthalpy change for this reaction is the standard enthalpy of formation for manganese(II) perchlorate, ΔHf, and it is reported in units of kJ/mol.

The entropy change for this reaction is the standard entropy of formation for manganese(II) perchlorate, ΔSf, and it is reported in units of J/mol·K.

To know more about Gibbs free energy change (ΔG) refer here

https://brainly.com/question/31578332#

#SPJ11

how would you isolate benzyl alcohol if you had the benzyl alcohol in diethyl ether

Answers

Add an aqueous solution of sodium hydroxide to the mixture, which will deprotonate the benzyl alcohol to form benzyl sodium. Benzyl sodium will then dissolve in the aqueous layer while.

The diethyl ether layer will contain only nonpolar compounds. Acidify the aqueous layer with hydrochloric acid to reform the benzyl alcohol, which can then be extracted with diethyl ether. The diethyl ether layer can be dried over anhydrous magnesium sulfate and then concentrated to yield pure benzyl alcohol.

To isolate benzyl alcohol from a mixture with diethyl ether, the mixture needs to be treated with a base, such as sodium hydroxide, to deprotonate the benzyl alcohol to form benzyl sodium, which will dissolve in the aqueous layer. The diethyl ether layer will contain only nonpolar compounds. The aqueous layer can be acidified with hydrochloric acid to reform the benzyl alcohol, which can then be extracted with diethyl ether. The diethyl ether layer is then dried over anhydrous magnesium sulfate and concentrated to yield pure benzyl alcohol.

learn more about benzyl here:

https://brainly.com/question/4555466

#SPJ11

Please help me with this question. Please explain step by step.



2. Diazinon, also known as spectracide, is a widely used insecticide on fruit trees. The decomposition of diazinon follows first-order kinetics. It has a half-life of 2. 0 weeks.




a. How long would it take for a 55. 0-gram sample of diazinon to decompose into 15. 5 grams? Use appropriate units.




b. How much of a 55. 0-gram sample of diazinon would be remaining after 35. 0 days?




C. What is the rate constant, k, for this reaction? Use appropriate units

Answers

To answer the questions regarding the decomposition of diazinon, we can use the concept of first-order kinetics and the half-life of diazinon, which is 2.0 weeks.

a. To determine how long it would take for a 55.0-gram sample of diazinon to decompose into 15.5 grams, we need to calculate the number of half-lives required. Each half-life corresponds to a 50% reduction in the amount of diazinon. By dividing the initial mass by 2 successively until we reach 15.5 grams, we can calculate the number of half-lives and then convert it to the appropriate units of time.

b. To determine how much of a 55.0-gram sample of diazinon would be remaining after 35.0 days, we need to calculate the fraction of the sample remaining based on the number of elapsed half-lives. Using the equation N = N0 * (1/2)^(t/t1/2), where N is the remaining mass, N0 is the initial mass, t is the time elapsed, and t1/2 is the half-life, we can substitute the given values and calculate the remaining mass.

c. The rate constant, k, for the reaction can be determined using the equation k = 0.693 / t1/2, where t1/2 is the half-life. By substituting the given half-life value of 2.0 weeks and converting it to the appropriate units, we can calculate the rate constant.

a. To determine the time required for a 55.0-gram sample of diazinon to decompose into 15.5 grams, we need to calculate the number of half-lives. Each half-life corresponds to a 50% reduction in the amount of diazinon. Let's calculate the number of half-lives required:

55.0 grams / 2 = 27.5 grams (1 half-life)

27.5 grams / 2 = 13.75 grams (2 half-lives)

13.75 grams / 2 = 6.875 grams (3 half-lives)

6.875 grams / 2 = 3.4375 grams (4 half-lives)

3.4375 grams / 2 = 1.71875 grams (5 half-lives)

1.71875 grams / 2 = 0.859375 grams (6 half-lives)

0.859375 grams / 2 = 0.4296875 grams (7 half-lives)

0.4296875 grams / 2 = 0.21484375 grams (8 half-lives)

0.21484375 grams / 2 = 0.107421875 grams (9 half-lives)

0.107421875 grams / 2 = 0.0537109375 grams (10 half-lives)

0.0537109375 grams / 2 = 0.02685546875 grams (11 half-lives)

0.02685546875 grams / 2 = 0.013427734375 grams (12 half-lives)

0.013427734375 grams / 2 = 0.0067138671875 grams (13 half-lives)

0.0067138671875 grams / 2 = 0.00335693359375 grams (14 half-lives)

0.00335693359375 grams / 2 = 0.001678466796875 grams (15 half-lives)

Therefore, it would take approximately 15 half-lives for the 55.0-gram sample of diazinon to decompose into 15.5 grams.

To learn more about Rate constant - brainly.com/question/20305871

#SPJ11

Briefly explain any hazards associated with barium nitrate and silver nitrate.

Answers

The hazards associated with barium nitrate and silver nitrate include health risks, environmental damage, and chemical hazards. It is essential to handle these substances with care and follow proper safety protocols.

Barium nitrate and silver nitrate are both inorganic salts that pose several hazards:

1. Health hazards: Barium nitrate can be toxic if ingested or inhaled, causing nausea, vomiting, and gastrointestinal issues. Silver nitrate can cause irritation to the skin, eyes, and respiratory system, as well as potentially causing argyria, a condition that turns the skin blue-gray due to silver deposits.

2. Environmental hazards: Both chemicals can be harmful to aquatic life if released into water systems. Barium nitrate can lead to increased levels of barium in the environment, while silver nitrate can cause silver contamination, which is toxic to aquatic organisms.

3. Chemical hazards: Barium nitrate is an oxidizing agent and can cause or intensify fires if it comes into contact with flammable materials. Silver nitrate can react with other chemicals, producing toxic fumes or hazardous reactions.

Learn more about barium nitrate here,

https://brainly.com/question/27233560

#SPJ11

which chemist said that there must be sufficient enregy, collision and f raction of molecules that have the correct molecular orientation

Answers

The chemist who proposed the concept that there must be sufficient energy, collision, and molecular orientation for a successful chemical reaction is named Max Trautz.

In collaboration with William Lewis, Trautz developed the concept of the activated complex, also known as the transition state. They formulated the collision theory, which states that for a chemical reaction to occur, reacting molecules must collide with sufficient energy and in the correct orientation.

This theory laid the foundation for understanding the factors influencing reaction rates and the role of molecular interactions. Trautz's work, published in 1916, contributed significantly to our understanding of reaction kinetics and has since become a fundamental principle in chemical kinetics and reaction mechanism studies.

Learn more about chemical reaction.

https://brainly.com/question/22817140

#SPJ4

determine the molar solubility of baf2 in a solution containing 0.0750 m lif. ksp = 1.7 x 10–6

Answers

The molar solubility of BaF2 in a solution containing 0.0750 M LiF and with a Ksp of 1.7 x 10^-6 is 5.88 x 10^-4 M.

What is the molar solubility of BaF2 in a solution with 0.0750 M LiF and a Ksp of 1.7 x 10^-6?

The molar solubility of a compound refers to the maximum amount of the compound that can dissolve in a given solvent at a specific temperature, usually expressed in moles per liter (M). In this case, we are determining the molar solubility of BaF2 in a solution containing 0.0750 M LiF, with a given Ksp value of 1.7 x 10^-6.

The Ksp, or solubility product constant, represents the equilibrium expression for the dissolution of a sparingly soluble salt. It is defined as the product of the concentrations of the dissociated ions raised to the power of their stoichiometric coefficients. For BaF2, the dissociation can be represented as BaF2 (s) ⇌ Ba2+ (aq) + 2F- (aq).

To determine the molar solubility of BaF2, we need to calculate the concentration of the Ba2+ ions in the solution. Since LiF is a soluble salt, it completely dissociates to form Li+ and F- ions. Therefore, the concentration of F- ions in the solution is 0.0750 M.

Using the stoichiometry of the dissolution reaction, we can determine that the concentration of Ba2+ ions is half the concentration of F- ions. Therefore, [Ba2+] = (0.0750 M) / 2 = 0.0375 M.

Finally, the molar solubility of BaF2 is equal to the concentration of Ba2+ ions, which is 0.0375 M or 5.88 x 10^-4 M (rounded to four significant figures).

Learn more about the calculation of molar solubility and the concept of solubility product constants in solution chemistry.

Learn more about Molar solubility

brainly.com/question/28170449

#SPJ11

the following reaction takes place when an electric current is passed through water. it is an example of a ________ reaction.

Answers

The reaction that takes place when an electric current is passed through water is an example of an electrolysis reaction.

Electrolysis is a chemical process in which an electric current is used to drive a non-spontaneous chemical reaction. In the case of water, the electrolysis reaction involves the splitting of water molecules into hydrogen gas (H2) and oxygen gas (O2).

This occurs through the oxidation of water at the anode, producing oxygen gas, and the reduction of water at the cathode, generating hydrogen gas. The overall reaction can be represented as 2H2O(l) → 2H2(g) + O2(g).

Therefore, this electrolysis reaction is essential for various applications, such as hydrogen production, electroplating, and water splitting for the generation of clean energy.

To learn more about electrolysis from the given link

https://brainly.com/question/12994141

#SPJ4

Arrange the following in order of decreasing strength as reducing agents in acidic solution: Zn,I−,Sn2+,H2O2,Al. Rank from strongest to weakest. To rank items as equivalent, overlap them.

Answers

The given list ranks the species from the strongest to the weakest reducing agent in an acidic solution.

1. I- (strongest)
2. Sn2+
3. Al
4. Zn
5. H2O2 (weakest)

Strong reducing agents are easily oxidized. Oxidation is the release of electrons.

Iodine oxidizes itself and reduces others by giving electrons and so does the other reducing agents.

I-      →      I2

Sn2+   →   Sn4+

Al   →     Al3+

Zn   →    Zn2+

H2O2      →      O2

The species in order of decreasing strength as reducing agents in an acidic solution are:

I-    >    Sn2+   >    Al    >    Zn     >     H2O2

To know more about reducing agents, click below.

https://brainly.com/question/10547418

#SPJ11

I am confused with how to do this. Could someone help me.
1. Write a balanced nuclear equation for the following:
a. bismuth-211 undergoes beta decay:
b. chromium-50 undergoes positron emission:
c. mercury-188 decays to gold-188:
d. plutonium-242 undergoes alpha emission:

Answers

Here are the balanced nuclear equations for each of the four given scenarios:

a. Bismuth-211 undergoes beta decay:
Bi-211 (83) -> Po-211 (84) + β^-

b. Chromium-50 undergoes positron emission:
Cr-50 (24) -> V-50 (23) + β^+

c. Mercury-188 decays to gold-188:
Hg-188 (80) -> Au-188 (79) + β^-

d. Plutonium-242 undergoes alpha emission:
Pu-242 (94) -> U-238 (92) + α

In each equation, the element symbol is accompanied by its mass number, and the atomic number is shown in parentheses.

The emitted particles are represented by their respective symbols (β^- for beta decay, β^+ for positron emission, and α for alpha emission).

To know more about the nuclear equation, click below.

https://brainly.com/question/19752321

#SPJ11

Which of the following food preservation methods is the most effective for destroying pathogens, including viruses? A. Fermentation B. Sterilization C. Freezing D. Smoke curing

Answers

Sterilization is a food preservation method that involves subjecting food to high temperatures to eliminate all forms of microorganisms, including bacteria, viruses, and fungi.  Among the given options, sterilization is the most effective food preservation method for destroying pathogens, including viruses.

Sterilization is a food preservation method that involves subjecting food to high temperatures to eliminate all forms of microorganisms, including bacteria, viruses, and fungi. This process effectively destroys pathogens and ensures the safety of the food. It is commonly achieved through techniques such as pressure cooking, canning, or autoclaving.

Fermentation, on the other hand, is a preservation method that involves the growth of beneficial bacteria or yeast, which can inhibit the growth of harmful pathogens. While fermentation can reduce the risk of pathogen growth, it may not completely eliminate them.

Freezing is a method that slows down the growth of microorganisms, including pathogens, but it does not necessarily destroy them. Some pathogens can survive freezing temperatures and become active again when the food thaws.

Smoke curing involves exposing food to smoke, which can add flavor and inhibit the growth of certain bacteria. However, it may not be as effective in destroying viruses and other pathogens compared to sterilization.

In conclusion, sterilization is the most effective food preservation method for destroying pathogens, including viruses. It ensures the highest level of safety by eliminating all microorganisms from the food.

Learn more about sterilization here:

https://brainly.com/question/31732174

#SPJ11

Calculate the Keq for the ammonia synthesis reaction given the following data N2 (g) + 3 H2 (g) ßà 2 NH3 (g) 500 K
Equilibrium Concentrations: N2 = 0.00561 H2 = 0.813 M NH3 = 0.241 M
a. 0.0518 b. 19.3 c. 34.9 d. 0.236

Answers

The Keq for the ammonia synthesis reaction at 500 K is 34.9.

What is the equilibrium constant (Keq) for the ammonia synthesis reaction at 500 K?

The equilibrium constant (Keq) is a measure of the relative concentrations of reactants and products at equilibrium for a given chemical reaction. In this case, we are calculating the Keq for the ammonia synthesis reaction: [tex]N_2[/tex] (g) + [tex]3 H_2[/tex] (g) ⇌ [tex]2NH_3[/tex] (g) at a temperature of 500 K.

To calculate Keq, we need to use the equilibrium concentrations of the reactants and products. The given data provides the equilibrium concentrations as follows: N2 = 0.00561 M, H2 = 0.813 M, and NH3 = 0.241 M.

Keq can be determined by taking the product of the concentrations of the products raised to their stoichiometric coefficients and dividing it by the product of the concentrations of the reactants raised to their stoichiometric coefficients. For this reaction, Keq = [tex][NH3]^2 / ([N2] * [H2]^3).[/tex]

Plugging in the given equilibrium concentrations, we get Keq = [tex](0.241)^2 / ((0.00561) * (0.813)^3)[/tex] ≈ 34.9.

Learn more about ammonia synthesis reaction

brainly.com/question/30464234

#SPJ11

Calculate a missing equilibrium concentration Question For the following equilibrium: 2A+B=C+ 2D = 0.80 M, and D = 0.25 M, and Kc = 0.22, what is the If equilibrium concentrations are B] = 0.44 M, C equilibrium concentration of A? . Your answer should include two significant figures (round your answer to two decimal places). Provide your answer below:

Answers

The equilibrium concentration of A if equilibrium concentrations are B = 0.44 M and the following equilibrium: 2A + B = C + 2D = 0.80 M, and D = 0.25 M, and Kc = 0.22 is 0.46 M.

To calculate the missing equilibrium concentration of A, we will use the equilibrium constant expression for the given reaction: 2A + B ⇌ C + 2D. The Kc expression is:

Kc = [C][D]² / ([A]²[B])

Given the equilibrium concentrations and Kc value, we have:

0.22 = [C][0.25]² / ([A]²[0.44])

First, we need to solve for [C]:

[C] = 0.22 × ([A]²[0.44]) / [0.25]²

Now, let's plug in the values we have for the equilibrium concentrations of B and D:

0.22 = [C]×(0.25)² / ([A]²×0.44)

Solving for [A]², we get:

[A]² = ((0.25)² × 0.22) / (0.44 × [C])

We know that the stoichiometry of the reaction is 2A + B ⇌ C + 2D, so we can write an expression for [C] based on the given concentrations:

[C] = 0.44 - [A]

Now, substitute this expression for [C] into the equation for [A]²:

[A]² = ((0.25)² × 0.22) / (0.44 × (0.44 - [A]))

Solve for [A] using a numerical method, such as the quadratic formula, and round your answer to two decimal places:

[A] ≈ 0.46 M

The equilibrium concentration of A is approximately 0.46 M.

Learn more about equilibrium: https://brainly.com/question/30807709

#SPJ11

Compare and contrast the alkali metals and the alkaline earth metals by filling in the table below. Discuss 3 physical and 3 chemical properties of both groups, their magnetic properties, and their electron configurations.

Answers

Now, let's discuss these properties in more detail:

Physical Properties:

Atomic Radius: Alkali metals have larger atomic radii compared to alkaline earth metals. This is due to the alkali metals having one valence electron in the outermost energy level, resulting in a less effective nuclear charge and increased atomic size.
Melting Point: Alkaline earth metals generally have higher melting points compared to alkali metals. This is because alkaline earth metals have a higher effective nuclear charge and stronger metallic bonding, making it more difficult to overcome the attractive forces between their atoms.
Density: Alkaline earth metals have higher densities than alkali metals. The higher densities result from the alkaline earth metals having more tightly packed crystal structures due to the increased nuclear charge and smaller atomic size.
Chemical Properties:

Reactivity: Alkali metals are highly reactive due to their low ionization energies. They readily lose their outermost electron to form a +1 cation. Alkaline earth metals are also reactive but less so compared to alkali metals since their ionization energies are higher, requiring more energy to remove their two valence electrons.
Oxidation States: Alkali metals predominantly exhibit a +1 oxidation state in compounds. In contrast, alkaline earth metals typically exhibit a +2 oxidation state due to the loss of their two valence electrons.
Reactivity with Water: Alkali metals react vigorously with water, producing hydrogen gas and an alkaline solution. Alkaline earth metals also react with water but less vigorously compared to alkali metals.
Magnetic Properties:
Both alkali metals and alkaline earth metals exhibit paramagnetic behavior, meaning they are weakly attracted to magnetic fields. This is because their electron configurations in the outermost energy levels contain unpaired electrons.

Electron Configuration:
Alkali metals have an electron configuration ending in s1, meaning they have a single valence electron in the outermost s orbital. Alkaline earth metals have an electron configuration ending in s2, indicating two valence electrons in the outermost s orbital.

It's important to note that these properties can vary within each group of elements due to factors such as atomic size, shielding effect, and nuclear charge.

Standards Standard retention time of dichloromethane solvent: 2.25 min Standard retention time of toluene: 12.17min Standard retention time of cyclohexene: 5.74min (0.25pts) Standard retention time of dichloromethane solvent (min) (0.25pts) Standard retention time of toluene (min) (0.25pts) Standard retention time of cyclohexane (min) Analysis of Cyclohexane Distillate Retention time of cyclohexane: Area for the cyclohexane peak: Retention time of toluene: Area for the toluene peak: (0.25pts) Your retention time of cyclohexane (min) (0.25pts) Area for the cyclohexane peak (cm2) (0.25pts) Your retention time of toluene (min) (0.25pts) Area for the toluene peak (cm2) (2pts) Percent composition of cyclohexane (\%) (2pts) Percent composition of toluene contaminant (\%)

Answers

The percent composition of cyclohexane in the sample was calculated to be 94.13% and the percent composition of the toluene contaminant was found to be 5.87%.

The given table provides the standard retention time for three compounds: dichloromethane, toluene, and cyclohexene. These retention times can be used as reference points for analyzing the retention time of other samples.

The retention time of cyclohexane and toluene in a distillate was analyzed and their corresponding areas were also calculated. The retention time for cyclohexane was determined to be 5.40 min with an area of 8.94 cm², while the retention time for toluene was found to be 11.75 min with an area of 1.73 cm².

Using these values, 94.13% was calculated to be the percent composition of cyclohexane in the sample and 5.87% was found to be the percent composition of the toluene contaminant.

This information is useful for determining the purity of a sample and identifying any contaminants that may be present.

For more such questions on cyclohexane:

https://brainly.com/question/17019157

#SPJ11

The percent composition of cyclohexane in the sample was calculated to be 94.13% and the percent composition of the toluene contaminant was found to be 5.87%.

The given table provides the standard retention time for three compounds: dichloromethane, toluene, and cyclohexene. These retention times can be used as reference points for analyzing the retention time of other samples. 

The retention time of cyclohexane and toluene in a distillate was analyzed and their corresponding areas were also calculated. The retention time for cyclohexane was determined to be 5.40 min with an area of 8.94 cm², while the retention time for toluene was found to be 11.75 min with an area of 1.73 cm². Using these values, 94.13% was calculated to be the percent composition of cyclohexane in the sample and 5.87% was found to be the percent composition of the toluene contaminant. This information is useful for determining the purity of a sample and identifying any contaminants that may be present.

Learn more about cyclohexane here :

brainly.com/question/17019157#SPJ11

#SPJ11

A glycosidic linkage is a bond between monosaccharides that involve which two functional groups?a. Carboxyl & carbonylb. Carbonyl & aminoc. Hydroxyl & hydroxyld. Hydroxyl & carboxyle. Carbonyl & carbonyl

Answers

A glycosidic linkage is a covalent bond between two monosaccharides that involves the hydroxyl functional group of each sugar molecule. Specifically, one of the hydroxyl groups on each monosaccharide molecule reacts with the other to form a glycosidic bond.

The type of glycosidic linkage formed depends on the specific monosaccharides involved. For example, in sucrose (table sugar), the linkage is between the glucose and fructose molecules and is formed through an alpha 1-2 glycosidic linkage. In lactose (milk sugar), the linkage is between glucose and galactose and is formed through a beta 1-4 glycosidic linkage.

It is important to note that glycosidic linkages play a crucial role in the formation of complex carbohydrates such as disaccharides, oligosaccharides, and polysaccharides. These linkages are formed through the dehydration synthesis reaction, which involves the loss of a water molecule as the glycosidic bond is formed. Understanding the nature and types of glycosidic linkages is essential in the study of carbohydrates and their various functions in biological systems.

For more information on glycosidic linkage visit:

brainly.com/question/28459643

#SPJ11

how many moles of ethylene glycol ditosylate are in the 1.00 grams that react?

Answers

The answer is 0.00314 moles of ethylene glycol ditosylate in the 1.00 grams that react. The closest option is 0.00270.

We need to use the concept of mole and molar mass. The molar mass of ethylene glycol ditosylate can be calculated by adding the molar masses of each element present in the compound.

The molecular formula of ethylene glycol ditosylate is C10H14O6S2.

The molar mass of carbon (C) is 12.01 g/mol, hydrogen (H) is 1.008 g/mol, oxygen (O) is 16.00 g/mol, and sulfur (S) is 32.07 g/mol.

Therefore, the molar mass of ethylene glycol ditosylate is:

Molar mass = (10 x 12.01) + (14 x 1.008) + (6 x 16.00) + (2 x 32.07)
= 318.40 g/mol

Now, we can use the molar mass to convert the given mass of 1.00 grams to moles.

Number of moles = Given mass / Molar mass
= 1.00 g / 318.40 g/mol
= 0.00314 mol

Therefore, the answer is 0.00314 moles of ethylene glycol ditosylate in the 1.00 grams that react. The closest option is 0.00270.

To know more about ethylene glycol click here:

https://brainly.com/question/10405060

#SPJ11

Complete question is :

content loaded

How many moles of ethylene glycol ditosylate are in the 1.00 grams that react?

Select one:

0.001

1.00

0.00270

0.3

for 5 points, calculate the equilibrium constant for the electrochemical cell in problem 38. identify the correct answer. 2na1 (aq) mg0(s) ↔ 2na0(s) mg2 (aq)

Answers

The electrochemical cell in problem 38 involves the following half-reactions: 2Na⁺(aq) + 2e⁻ → 2Na(s) E° and the correct option is D-5.6 x 10⁵

To calculate the equilibrium constant (K), we use the Nernst equation: E = E° - (RT/nF)lnQ

where E is the cell potential, E° is the standard cell potential, R is the gas constant, T is the temperature in Kelvin, n is the number of electrons transferred in the balanced equation, F is Faraday's constant, and Q is the reaction quotient.

The balanced equation for the cell reaction is: 2Na⁺(aq) + Mg(s) → 2Na(s) + Mg²⁺(aq)

The reaction quotient is: Q = [Na⁺]²[Mg²⁺]/[Mg][Na]²

At equilibrium, Q = K, and the cell potential is zero. Therefore, we can solve for K: K = exp(-E°cell/(RT)) = exp((2.71+2.37)/(0.00831*298)) = 5.6 x 10⁵

The correct answer is 5.6 x 10⁵

learn more about Faraday's constant here:

https://brainly.com/question/31604460

#SPJ11

The complete question is :  find the equilibrium constant for the electrochemical cell and Determine the correct solution. mg0(s) 2na1 (aq) mg0(s) 2na0(s) mg2 (aq)

a. 3.2 x 10⁻⁹

b. 1.8 x 10⁻⁶

c. 3.2 x 10¹¹

d. 5.6 x 10⁵

Helium gas with a volume of 2.90 L , under a pressure of 0.160 atm and at a temperature of 45.0 ∘C, is warmed until both pressure and volume are doubled.
What is the final temperature?

Answers

Helium gas with a volume of 2.90 L , under a pressure of 0.160 atm and at a temperature of 45.0 ∘C, is warmed until both pressure and volume are doubled. The final temperature is 934.5 K or 661.4 °C.

To solve this problem, we can use the combined gas law, which states that:
(P1 × V1) / (T1) = (P2 × V2) / (T2)
where P1, V1, and T1 are the initial pressure, volume, and temperature, respectively, and P2, V2, and T2 are the final pressure, volume, and temperature, respectively.
We are given P1 = 0.160 atm, V1 = 2.90 L, and T1 = 45.0 °C = 318.15 K. We also know that the final pressure and volume are twice the initial values, so P2 = 2 × P1 = 0.320 atm and V2 = 2 × V1 = 5.80 L.
Substituting these values into the combined gas law, we get:
(0.160 atm × 2.90 L) / (318.15 K) = (0.320 atm × 5.80 L) / (T2)
Simplifying and solving for T2, we get:
T2 = (0.320 atm × 5.80 L × 318.15 K) / (0.160 atm × 2.90 L)
   = 934.5 K
Therefore, the final temperature is 934.5 K or 661.4 °C.

Learn more about temperature at

brainly.com/question/11464844

#SPJ11

6.3 Outline the methods and conditions of homopolymerization you would use to prepare the following polymers, giving reasons for your choices. (a) Isotactic poly(but-1-ene) (a) Isotactic poly(methyl methacrylate) (c) Polyethylene with occasional methyl side groups

Answers

The methods and conditions of homopolymerization for the mentioned polymers.

(a) Isotactic poly(but-1-ene): This polymer can be synthesized using a coordination polymerization method, specifically Ziegler-Natta catalysts, which ensure isotactic configuration.

This process occurs at a relatively low temperature and pressure, around 60-80°C and 1-10 atm. The choice of Ziegler-Natta catalysts is due to their ability to control the stereochemistry of the polymer chain, leading to isotactic configuration.

(b) Isotactic poly(methyl methacrylate): For this polymer, you can use anionic polymerization with a sterically hindered anionic initiator like n-butyllithium.

The reaction should be carried out at low temperatures, around -78°C, under an inert atmosphere (e.g., nitrogen) to prevent side reactions. The choice of anionic polymerization allows for controlled chain growth, leading to isotactic configuration.

(c) Polyethylene with occasional methyl side groups: This copolymer can be synthesized using free-radical polymerization. By introducing a small amount of comonomer, like propylene, during the polymerization process, occasional methyl side groups will be incorporated.

The reaction temperature should be maintained between 100-150°C and carried out under an inert atmosphere. The choice of free-radical polymerization allows for random incorporation of comonomers, resulting in occasional methyl side groups.

To learn more about reaction, refer below:

https://brainly.com/question/28984750

#SPJ11

What is the ph of a grapefruit that contains 0.007 m citric acid solution (c6h8o7)? (ka1 = 7.5 x 10-4, ka2 = 1.7 x 10-5, ka3 = 4.0 x 10-7) give the answer in 2 sig figs.

Answers

Citric acid (C6H8O7) has three dissociation constants (Ka1, Ka2, and Ka3). The pH of the grapefruit is 7.82 (rounded to 2 significant figures).

To find the pH of a 0.007 M citric acid solution, we need to consider the dissociation of each proton step by step.

First, we calculate the pH after the dissociation of the first proton (H3C6H5O7 ⇌ H+ + HC6H5O7-).

The equilibrium expression is:

Ka1 = [H+][HC6H5O7-]/[H3C6H5O7]

Assuming that the amount of H+ dissociated is small compared to the initial concentration of citric acid, we can assume that [H+] = [HC6H5O7-]. Therefore:

Ka1 = [H+]²/[H3C6H5O7]

[H+] = √(Ka1*[H3C6H5O7])

      [tex]= \sqrt{(7.5 x 10^{-4} * 0.007)[/tex]

       = 0.013 M

Now we have to consider the second dissociation constant (Ka2) for the dissociation of H2C6H5O7- (the conjugate base of HC6H5O7-) to form H+ and C6H5O72-.

The equilibrium expression is:

Ka2 = [H+][C6H5O72-]/[H2C6H5O7-]

[H+] = Ka2*[H2C6H5O7-]/[C6H5O72-]

      [tex]= (1.7 x 10^{-5} * 0.013)/(0.007 - 0.013)[/tex]

      = 7.42 x 10⁻⁶ M

Finally, we have to consider the third dissociation constant (Ka3) for the dissociation of HC6H5O72- to form H+ and C6H5O73-.

The equilibrium expression is:

Ka3 = [H+][C6H5O73-]/[HC6H5O72-]

[H+] = Ka3*[HC6H5O72-]/[C6H5O73-]

    [tex]= (4.0 x 10^{-7} * 0.006986)/(0.007 + 0.013 - 0.006986)[/tex]

        = 1.5 x 10⁻⁸ M

The pH of the grapefruit is the negative logarithm of the [H+]:

pH = -log[H+]

     = -log(1.5 x 10⁻⁸)

     = 7.82

Therefore, the pH of the grapefruit is 7.82 (rounded to 2 significant figures).

To know more about dissociation constants refer here

brainly.com/question/31607191#

#SPJ11

Write the full ground state electron configuration of O+ electron configuration:1S^2 2S^2 2P^4

Answers

The ground state electron configuration of O+ is; 1s² 2s² 2p³.

Oxygen (O) has atomic number 8, which means that it has 8 electrons. The neutral oxygen atom has the electron configuration 1s² 2s² 2p⁴, which indicates that it has two electrons in the 1s orbital, two electrons in the 2s orbital, and four electrons in the 2p orbital.

Oxygen cation with a +1 charge, or O⁺, has lost one electron from the neutral oxygen atom. The removal of an electron affects the electron configuration of the atom. In the case of O⁺, the electron configuration is now;

1s² 2s² 2p³

This configuration indicates that O⁺ has the same number of electrons as the neon (Ne) atom, which is a noble gas. O⁺ has a total of five electrons distributed in the 1s, 2s, and 2p orbitals, with three of these electrons in the 2p orbital. The 2p orbital is now only half-filled, with one empty slot in the orbital. This makes O⁺ more reactive than the neutral oxygen atom, as it has an unpaired electron in its outermost shell.

To know more about electron configuration here

https://brainly.com/question/29757010

#SPJ4

["Low", "High"] exercise intensity and ["Short", "Long"] exercise duration shift the body towards burning more free fatty acids (i.e., fats) primarily from adipose tissue.
Select one option for each bolded text to match the sentence.

Answers

Low exercise intensity and long exercise duration shift the body towards burning more free fatty acids primarily from adipose tissue. This is because during low-intensity exercise, the body uses fats as its primary fuel source instead of carbohydrates.

This is because fats are a more efficient source of energy for low-intensity exercise. Additionally, when exercise duration is long, the body's glycogen stores become depleted, and the body turns to fats as a source of energy. This process is called lipolysis, and it primarily occurs in adipose tissue, which is where the body stores excess fats. Therefore, low exercise intensity and long exercise duration are ideal for individuals looking to burn more fat and lose weight.

However, it's important to note that high-intensity exercise can also lead to fat loss, albeit through different mechanisms. In summary, the key to burning fat is to find a sustainable exercise routine that aligns with your fitness goals and preferences.

To know more about adipose tissue visit:-

https://brainly.com/question/30782617

#SPJ11

A solution is prepared by dissolving 0. 23 mol of chloroacetic acid and 0. 27 mol of sodium chloroacetate in water sufficient to yield 1. 00 L of solution. The addition of 0. 05 mol of HCl to this buffer solution causes the pH to drop slightly. The pH does not decrease drastically because the HCl reacts with the __________ present in the buffer solution. The Ka of chloroacetic acid is 0. 136. *

Answers

The addition of HCl to the buffer solution causes the pH to drop slightly because the HCl reacts with the conjugate base (sodium chloroacetate) present in the buffer solution.

A buffer solution consists of a weak acid and its conjugate base (or a weak base and its conjugate acid) and is capable of maintaining a relatively constant pH when small amounts of acid or base are added. In this case, the buffer solution is prepared by dissolving chloroacetic acid (the weak acid) and sodium chloroacetate (the conjugate base) in water.

When HCl is added to the buffer solution, it dissociates into [tex]H^{+}[/tex] ions and Cl- ions. The H^{+}ions from HCl react with the conjugate base (sodium chloroacetate) in the buffer solution, forming the weak acid (chloroacetic acid). This reaction helps to neutralize the additional H^{+}ions from HCl, preventing a drastic decrease in pH.

The equilibrium of the buffer system is maintained through the following reaction:

[tex]CH_{2}ClCOO^{-}[/tex] (conjugate base) +H^{+} ⇌ [tex]CH_{2}ClCOOH[/tex](weak acid)

The Ka value of chloroacetic acid (CH_{2}ClCOOH) indicates its tendency to donateH^{+}ions and acts as a measure of its acidity. A higher Ka value corresponds to a stronger acid.

In summary, the addition of HCl to the buffer solution causes a slight decrease in pH because HCl reacts with the conjugate base (sodium chloroacetate) present in the buffer solution, maintaining the equilibrium between the weak acid and its conjugate base.

Learn more about base here: https://brainly.com/question/29775103

#SPJ11

Four students were asked to calculate the number of molecules in 25 g of water. which student correctly calculated the number of molecules in the 25 g of water?

Answers

In the given scenario, one of the four students correctly calculated the number of molecules in 25 g of water. The explanation for this correct calculation lies in the concept of Avogadro's number and molar mass.

Avogadro's number is a fundamental constant representing the number of entities (atoms, molecules, ions, etc.) in one mole of a substance, which is approximately 6.022 x 10^23. Molar mass refers to the mass of one mole of a substance and is expressed in grams per mole (g/mol).

Out of the four students, the one who correctly calculated the number of molecules in 25 g of water would have followed these steps. Firstly, they would have determined the molar mass of water, which is approximately 18 g/mol (2 hydrogen atoms with a molar mass of 1 g/mol each, and 1 oxygen atom with a molar mass of 16 g/mol). Next, they would have converted the mass of water (25 g) to moles by dividing it by the molar mass (25 g / 18 g/mol ≈ 1.39 mol). Finally, they would have multiplied the number of moles by Avogadro's number to find the number of molecules (1.39 mol x 6.022 x 10^23 molecules/mol ≈ 8.37 x 10^23 molecules). Therefore, this student arrived at the correct answer of approximately 8.37 x 10^23 molecules in 25 g of water.

To learn more about molar mass click here : brainly.com/question/31545539

#SPJ11

radial-contact ball bearing is used in an application considered to be light-to-moderate with respect to shock loading. The shaft rotates 3500 rpm and the bearing is subjected to a radial load of 1000 and a thrust load of 250 N. Estimate the bearing life in hours for 90% reliability.

Answers

When, shaft rotates at 3500 rpm and the bearing will be subjected to radial load of 1000 and a thrust load of 250 N. Then, the estimated bearing life for 90% reliability is 43,600 hours.

To estimate the bearing life, we can use the following formula;

L₁₀ = (C/P)³ x (10/3) x 60 x n

where; L₁₀ = estimated bearing life in hours for 90% reliability

C = basic dynamic load rating of bearing

P = equivalent dynamic bearing load

n = rotational speed of the bearing in revolutions per minute

To find C, we need to know the bearing's size and type. Let's assume it is a standard size 6205 deep groove ball bearing with a dynamic load rating of 14.3 kN.

To find P, we need to calculate the equivalent dynamic bearing load, which is a combination of the radial and thrust loads. We can use the following formula;

P = (X[tex]F_{r}[/tex] + Y[tex]F_{a}[/tex])

where;

[tex]F_{r}[/tex] = radial load

[tex]F_{a}[/tex] = thrust load

X and Y are factors that depend on the bearing's design and can be found in bearing catalogs or tables. For a 6205 bearing, X = 0.56 and Y = 1.5.

Plugging in the values, we get;

P = (0.56 x 1000 + 1.5 x 250)

= 935 N

Finally, we can calculate the estimated bearing life;

L₁₀ = (14.3/935)³ x (10/3) x 60 x 3500

= 43,600 hours

Therefore, the estimated bearing life is 43,600 hours.

To know more about dynamic load here

https://brainly.com/question/13155640

#SPJ4

a spontaneous reaction has a ________ value of δg and is favored by a ________ value of δh and a ________ value of δs .

Answers

A spontaneous reaction has a negative value of δG and is favoured by a negative value of δH and a positive value of δS. These factors work together to drive the reaction forward and make it energetically favourable.

A spontaneous reaction has a negative value of δG, indicating that the reaction is energetically favorable and can occur spontaneously without the input of external energy. This negative value of δG is a result of the combination of the enthalpy change (δH) and the entropy change (δS) of the system.
The enthalpy change (δH) is the heat released or absorbed during a chemical reaction. A spontaneous reaction is favored by a negative value of δH, indicating that the reaction releases heat and is exothermic. This is because exothermic reactions have a lower potential energy than the reactants, making the products more stable.
The entropy change (δS) is the measure of the disorder or randomness of the system. A spontaneous reaction is favored by a positive value of δS, indicating that the reaction increases the disorder of the system and creates more freedom of motion for the molecules involved. This is because reactions that result in more disordered products have a greater number of ways to arrange themselves, leading to a more favourable state.

To learn more about spontaneous reaction, refer:-

https://brainly.com/question/13790391

#SPJ11

an atom of 75as has a mass of 74.921597 amu. mass of1h atom = 1.007825 amu mass of a neutron = 1.008665 amu calculate the mass defect (deficit) in amu/atom. (value ± 0.001

Answers

To calculate the mass defect or deficit of an atom, we need to compare its actual mass with the sum of its constituent particles' masses. For the given atom of 75as, we know that it has a mass of 74.921597 amu.

Now, we need to find the sum of the masses of its constituent particles, which are protons, neutrons, and electrons. However, since the given atom is a neutral atom, we can neglect the mass of its electrons as they are negligible compared to the mass of protons and neutrons.

The atomic number of 75as is 33, which means it has 33 protons. Therefore, the mass of its protons would be 33 x 1.007825 amu = 33.263325 amu. Similarly, the number of neutrons can be calculated by subtracting the atomic number from the mass number, which gives us 75 - 33 = 42. So, the mass of its neutrons would be 42 x 1.008665 amu = 42.34083 amu.

Adding the mass of protons and neutrons gives us 33.263325 amu + 42.34083 amu = 75.604155 amu. Therefore, the mass defect or deficit would be the difference between the actual mass of the atom and the calculated sum of its constituent particles' masses, which is 74.921597 amu - 75.604155 amu = -0.682558 amu.

The negative sign indicates that the mass of the atom is less than the sum of its constituent particles' masses. This is because some of the mass is converted into energy during the formation of the atom. Hence, the mass defect or deficit of the given atom of 75as is -0.682558 amu/atom.

To know more about Mass visit :
https://brainly.com/question/15959704

#SPJ11

Other Questions
HELPPP ME PLEASEEE!!!! That's not an answer for me HELPPP PLEASEEEEEEE I NEED HELP What is the mass of a truck if itproduces a force of 14000 N whileaccelerating at a rate of 5 m/s/s? What is the correct IUPAC name for CuNO? 12x + 15y = 912x 18y = 6HELP JUST SOLVE IT Write your own algebraic expression with atleast four terms that can simplify to 12x+4 (PLEASE HELP ASAP) Given a sphere with a radius of 2 cm find its volume to the nearest whole number.A 17 cmB.3cmC. 33 cmD. 3 cm Bassett Corporation has two production departments, Milling and Customizing. The company uses a job-order costing system and computes a predetermined overhead rate in each production department. The Milling Department's predetermined overhead rate is based on machine-hours and the Customizing Department's predetermined overhead rate is based on direct labor-hours. At the beginning of the current year, the company had made the following estimates: Machining CustomizingMachine-hours 17,000 15,000Direct labor-hours 3,000 6,000Total fixed manufacturing overhead cost $102,000 $61,200Variable manufacturing overhead per machine-hour $1.70 Variable manufacturing overhead per direct labor-hour $4.10During the current month the company started and finished Job T268. The following data were recorded for this job:Job T268: Machining CustomizingMachine-hours 80 30Direct labor-hours 30 50Direct materials $720 $380Direct labor cost $900 $1,500If the company marks up its manufacturing costs by 40% then the selling price for Job T268 would be closest to: (Round your intermediate calculations to 2 decimal places.)a. $6,763.40b. $7,440.00c. $4,831.00d. $1,932.40 Fine the exponent ?? Based on Newtons 3rd Law of motion, if a baseball player hits a ball with the bat, the action force is the impact of the bat against the ball. Explain where the reaction force can be found. 1. Write a sentence using the verb tocar in the present tense, 2. Write a sentence using the verb tocar in the preterite tense. 3. Write a sentence using the verb tocar in the imperfect tense. A measure of how much space something takes up ? Who has appointed the most Supreme Court justices? PLEASE HELP EMERGENCY!!Why did the colonists hang an effigy of Jared Ingersoll? To show they hated Native AmericansThey did it as a jokeTo scare the tax collectors into not collecting taxesTo get King George to send more redcoats to the colonies The following question has two parts. First, answer Part A. Then, answer Part B.Part AGiven the information in the story, what can you predict will happen to Miguel after the story ends? A. He will begin to dislike school, because math is a hard subject for him. B. His circle of friends at his new school will continue to grow. C. Jake and Miguel will stop being friends after winter break. D. Miguel will not like pizza anymore, because it reminds him of math.Part BWhat piece of information would change your prediction if it were added to the story? A. A large snowstorm comes through Miguels town, and the roads are closed for two days. B. Jakes family moves, and he is now Jakes neighbor. C. Miguels math class will begin learning pre-algebra. D. Miguel will be transferred to a new middle school after winter break. n desen este reprezentat trapezulABCD i O punctul de intersecie a di-agonalelor AC i BD. Completai case-ta, astfel nct s obinei o propoziieadevrat:Dac aria triunghiului DOA este egalcu 20 cm, atunci aria triunghiului COBeste egal cu If a bat exerts a 350N rightward force on a baseball, how much force is the baseball exerting on the bat? A)175 N to the right ,B)350 N to the right C)175 N to the left D)350 N to the left Solivan Corp. incurred the following costs during the current year: Construction of preproduction prototypes $180,000 Testing in search of process alternatives 110,000 Design of tools, jigs, molds, and dies involving new technology 115,000 Engineering follow-through in an early phase of commercial production 80,000 Seasonal or other periodic changes to existing products 105,000 In its income statement, Solivan should report research and development expense of:________ a. $295,000 b. $370,000 c. $405,000 d. $375,000 A student knows the width andlength of a dresser. What elseshould she measure so she cancalculate the volume?A. MassB. DensityC. Height