the charged particles inside and outside the cell are called

Answers

Answer 1

The charged particles inside and outside the cell are called ions.

An ion is defined as an atom or molecule that has a net electrical charge as a result of losing or gaining one or more electrons. Ions are often called electrolytes, and they are present in a wide range of chemical and biological systems. Positively charged ions are called cations, while negatively charged ions are called anions.

Ions are important in many chemical processes. They are involved in the formation of ionic compounds, such as salt, and they play a role in chemical reactions. Ions are also important in biological processes, such as the transmission of nerve impulses and the transport of nutrients and waste products in cells.

Chloride ions, hydrogen ions, and sodium ions are examples of ions that are commonly found in the human body.

Thus, the correct answer is ions.

To learn more about ions :

https://brainly.com/question/13692734

#SPJ11


Related Questions


The energy added as heat to a block of lead is 6.78 x 103 J at a
temperature of 100°C. Determine the change in entropy. a. 17 J/K b.
68J/K c. 10J/K d. 18J/K

Answers

The change in entropy is approximately 17 J/K. Therefore, option a) 17 J/K is the correct answer.

To determine the change in entropy, we need to use the equation:

ΔS = Q/T

where ΔS is the change in entropy, Q is the heat energy added, and T is the temperature in Kelvin.

In this case, we have the following information:

Heat energy (Q) = 6.78 x 10³ J

Temperature (T) = 100°C = 100 + 273.15 K (converting to Kelvin)

Plugging these values into the equation, we can calculate the change in entropy (ΔS):

ΔS = (6.78 x 10³ J) / (100 + 273.15 K)

Calculating this value:

ΔS ≈ 17 J/K

Therefore, the change in entropy is approximately 17 J/K. Therefore, option a) 17 J/K is the correct answer.

Learn more about Heat energy from the link given below.

https://brainly.com/question/20038450

#SPJ4

Explain the difference between the compressibility of a
substance and compressibility of a flow.

Answers

The mass transfer coefficient (Kₐ) is defined as the proportionality constant relating the flux of molecules to the concentration gradient in molecular diffusion.

The mass transfer coefficient can be defined from the concept of molecular diffusion, which refers to the movement of molecules from an area of high concentration to an area of low concentration.

Step 1: Fick's First Law of Diffusion

Fick's first law states that the rate of diffusion (J) is proportional to the concentration gradient (∇C) and the diffusion coefficient (D). Mathematically, it is expressed as J = -D∇C.

Step 2: Flux and Concentration Gradient

The flux (J) represents the amount of mass transferred per unit area per unit time. The concentration gradient (∇C) is the change in concentration over a certain distance.

Step 3: Introduction of a Proportionality Constant

To relate the flux to the driving force, we introduce a proportionality constant called the mass transfer coefficient (Kₐ). The equation becomes J = -Kₐ∇C.

Step 4: Definition of the Mass Transfer Coefficient

The mass transfer coefficient (Kₐ) is a measure of the efficiency of mass transfer between two phases. It accounts for factors such as the nature of the system, fluid properties, and the interface between the phases.

Step 5: Relationship to Molecular Diffusion

The mass transfer coefficient (Kₐ) quantifies the rate at which molecules diffuse across an interface. It combines the effects of molecular diffusion, fluid dynamics, and interfacial phenomena.

In summary, the mass transfer coefficient is defined from the concept of molecular diffusion by relating the flux of molecules to the concentration gradient through the introduction of a proportionality constant. This coefficient represents the efficiency of mass transfer and incorporates various factors affecting the diffusion process.

Learn more about mass transfer coefficient  from the given link: https://brainly.com/question/32021907

#SPJ11

as you move down the periodic table atoms get bigger

Answers

As you move down the periodic table, atoms generally get bigger.

This trend is due to the increase in the number of electron shells or energy levels as you move down a group or a column. Each successive row in the periodic table adds an additional electron shell, which increases the distance between the nucleus and the outermost electrons.

This increase in atomic size is a result of the shielding effect, where inner electron shells partially shield the outermost electrons from the attractive force of the nucleus.

Consequently, the increased number of electron shells and the resulting larger atomic size contribute to the trend of atoms getting bigger as you move down the periodic table.

To know more about periodic table refer to-

https://brainly.com/question/31672126

#SPJ11

what prevents a brown dwarf from undergoing nuclear fusion?

Answers

The lack of sufficient mass prevents a brown dwarf from undergoing nuclear fusion.

Brown dwarfs are sub-stellar objects that fall between the mass of a planet and a star. While they share some characteristics with stars, such as being composed primarily of hydrogen and helium, their mass is not sufficient to sustain stable nuclear fusion like in main-sequence stars.

Nuclear fusion occurs in stars when the pressure and temperature at the core are high enough to initiate and sustain the fusion of hydrogen nuclei into helium. This process releases a tremendous amount of energy and is the source of a star's luminosity.

However, in brown dwarfs, the mass is below the threshold required to reach the necessary core temperature and pressure for hydrogen fusion to occur. As a result, brown dwarfs are unable to sustain stable nuclear fusion. They primarily radiate away their residual heat over time, gradually cooling and dimming as they age.

While brown dwarfs exhibit some similarities to stars, their insufficient mass prevents them from achieving the conditions required for sustained nuclear fusion, distinguishing them from true stars.

learn more about nuclear fusion. here:

https://brainly.com/question/12701636

#SPJ11

Consider the chemical equation.

2NBr3 + 3NaOH Right arrow. N2 + 3NaBr + 3HOBr

If there are 40 mol of NBr3 and 48 mol of NaOH, what is the excess reactant?
N2
NBr3
NaOH
HOBr

Answers

The excess reactant in the given chemical equation is NaOH. This can be determined by comparing the stoichiometric ratios of NBr3 and NaOH in the balanced equation. The equation shows that 2 moles of NBr3 react with 3 moles of NaOH. Therefore, for every 3 moles of NaOH, we need 2 moles of NBr3. In this case, there are 48 moles of NaOH, which is more than the required amount. Thus, NaOH is the excess reactant.

To determine the excess reactant, we compare the stoichiometric ratios of the reactants in the balanced equation. The coefficient of NBr3 is 2, indicating that 2 moles of NBr3 react with 3 moles of NaOH. We can set up a ratio to calculate the required amount of NBr3 for 48 moles of NaOH:

(2 moles NBr3) / (3 moles NaOH) = (x moles NBr3) / (48 moles NaOH)

Solving for x, we find:

x = (2/3) * 48 = 32 moles NBr3

Since we have 40 moles of NBr3, which is more than the required amount of 32 moles, NBr3 is not the excess reactant. Therefore, the remaining reactant, NaOH, must be the excess reactant. It means there is an excess of 48 - 32 = 16 moles of NaOH, which will not be fully consumed in the reaction.

for such more questions on equation

https://brainly.com/question/11904811

#SPJ8

What is the oxidizing agent in the following reaction? CO2 + NH2OH--> CO + N2

Answers

The oxidizing agent in the reaction CO₂ + NH₂OH → CO + N₂ is NH₂OH.

In a chemical reaction, the oxidizing agent is the species that causes another species to undergo oxidation, which involves the loss of electrons or an increase in oxidation state. In this reaction, CO₂ is reduced to CO, indicating that an oxidation process is occurring.

NH₂OH, known as hydroxylamine, acts as the oxidizing agent in this reaction. It undergoes reduction itself, accepting electrons to form N₂. By accepting electrons from CO₂, NH₂OH facilitates the reduction of CO₂ to CO. The nitrogen atoms in NH₂OH transition from a lower oxidation state in NH₂OH to a higher oxidation state in N₂, indicating its role as an oxidizing agent.

learn more about oxidizing agent here:

https://brainly.com/question/10547418

#SPJ4

We also derived the August equation for the saturation vapour pressure of water (in kPa)
sat R T 298
P =3.17e−Lvap(1− 1 ), (3)
where Lvap = 40.8 kJ/mol and R = 8.314J/mol/K. The air in this room has a relative humidity of about 30% and a temperature of 22◦C. What is vapour pressure of the water in the room?

Answers

The vapor pressure of water in the room can be calculated using the August equation and the given values for temperature and relative humidity.

The August equation provides a way to calculate the saturation vapor pressure of water at a given temperature. In this equation, the vapor pressure (P) is determined using the temperature (T), the latent heat of vaporization (Lvap), and the gas constant (R).

Given a relative humidity of 30% and a temperature of 22°C, we can use the August equation to find the vapor pressure of water in the room. First, we convert the temperature to Kelvin by adding 273.15 (22°C + 273.15 = 295.15 K).

Next, we substitute the values into the equation and solve for P. Using Lvap = 40.8 kJ/mol and R = 8.314 J/mol/K, we can plug in the values to calculate the vapor pressure.

The result will give us the vapor pressure of water in the room, indicating the partial pressure of water vapor in the air at the given temperature and relative humidity.

learn more about temperature here:

https://brainly.com/question/17088012

#SPJ11

which of the following best describes the term cleavage?

Answers

The term cleavage refers to the splitting of minerals along natural planes of weakness.

Cleavage is a property of minerals that is caused by the way the atoms are arranged in the crystal structure.

There are three main types of cleavage:

Perfect cleavage: This is the most common type of cleavage. It occurs when the mineral can be split into smooth, flat sheets. Examples of minerals with perfect cleavage include mica, calcite, and halite.Good cleavage: This type of cleavage is not as smooth as perfect cleavage, but it is still relatively easy to split the mineral into sheets. Examples of minerals with good cleavage include amphibole and pyroxene.Poor cleavage: This type of cleavage is difficult to see. It may only be visible when the mineral is under stress. Examples of minerals with poor cleavage include quartz and garnet.

Cleavage is a useful property for identifying minerals. It can also be used to determine the crystal structure of a mineral.

Here are some of the factors that can affect the cleavage of a mineral:

The type of bonding in the mineral: Minerals with ionic bonding tend to have good cleavage, while minerals with covalent bonding tend to have poor cleavage.The size of the mineral grains: Minerals with large grains tend to have better cleavage than minerals with small grains.The presence of impurities: Impurities can disrupt the crystal structure of a mineral and weaken the cleavage.

Thus, cleavage refers to the tendency of certain minerals to break along specific planes of weakness, producing smooth, flat surfaces.

To learn more about minerals :

https://brainly.com/question/15844293

#SPJ11

Ratio of the actual amount of water vapor present to the amount that could be present if the air at that temperature were saturated.
A. All of the choices given are correct
B. Relative Humidity
C. Absolute Humidity
D. Vapor Pressure

Answers

B. Relative humidity is the ratio of the actual amount of water vapor present to the amount that could be present if the air were saturated at that temperature. It represents the percentage of moisture in the air relative to its maximum capacity at that temperature.

The relative humidity is the ratio of the actual amount of water vapor present in the air to the amount that could be present if the air were saturated at that temperature. It is expressed as a percentage and indicates how close the air is to being saturated with water vapor. Relative humidity of 100% means the air is saturated, while lower relative humidity values indicate that the air is holding less moisture compared to its saturation capacity at that temperature. Absolute humidity refers to the actual amount of water vapor present in the air, usually measured in grams of water vapor per cubic meter of air. Vapor pressure is the partial pressure exerted by water vapor in a mixture of gases, which is related to but not the same as relative humidity. Therefore, the correct answer is B. Relative Humidity.

learn more about Relative humidity here:

https://brainly.com/question/31785862

#SPJ11

1- Which of the reactions are spontaneous (favorable)?

AgCl(s)⟶Ag+(aq)+Cl−(aq) ΔG=55.6 kJ/mol

CH4(g)+2O2(g)⟶CO2(g)+2H2O(l) ΔG=−820 kJ/mol

2H2O(g)⟶2H2(g)+O2(g) ΔG=457 kJ/mol

C(s)+H2O(l)⟶CO(g)+H2(g) ΔG=90.8 kJ/mol

2Mg(s)+O2(g)⟶2MgO(s) ΔG=−1137 kJ/mol

NH3(g)+HCl(g)⟶NH4Cl(s) ΔG=−91.1 kJ/mol

2- Which of the reactions are spontaneous (favorable)?

glutamate+NAD++H2O⟶NH+4+α-ketoglutarate+NADH+H+ΔG=3.7 kcal/mol

L-malate+NAD+⟶oxaloacetate+NADH+H+ΔG=29.7 kJ/mol

C6H13O9P+ATP⟶C6H14O12P2+ADPΔG=−14.2 kJ/mol

C4H4O5⟶C4H2O4+H2OΔG=3.1 kJ/mol

DHAP−⇀↽−glyceraldehyde-3-phosphateΔG=3.8 kJ/mo

C2H4+H2Rh(I)−−−→C2H6ΔG=−150.97 kJ/mol

Answers

The spontaneous reactions are (1). option e, option f  ; (2). option a, option b, option c, option f .

Spontaneous reactions are the ones which occur without any external influence and the reactions that have a negative ΔG are spontaneous.

Here are some of the factors that can affect the spontaneity of a reaction:

Temperature: The spontaneity of a reaction can change with temperature. For example, the melting of ice is a spontaneous reaction at room temperature, but it is a non-spontaneous reaction at below freezing temperatures.Concentration: The concentration of the reactants can also affect the spontaneity of a reaction. For example, the reaction between hydrogen and oxygen to form water is spontaneous at all concentrations, but the rate of the reaction increases as the concentration of the reactants increases.Pressure: The pressure can also affect the spontaneity of a reaction. For example, the reaction between nitrogen and hydrogen to form ammonia is spontaneous at high pressures, but it is a non-spontaneous reaction at low pressures.

Spontaneous (favorable) reactions are as follows :

2Mg(s)+O2(g)⟶2MgO(s) ΔG=−1137 kJ/mol (Negative ΔG)

NH3(g)+HCl(g)⟶NH4Cl(s) ΔG=−91.1 kJ/mol (Negative ΔG)

C6H13O9P+ATP⟶C6H14O12P2+ADPΔG=−14.2 kJ/mol (Negative ΔG)

C2H4+H2Rh(I)−−−→C2H6ΔG=−150.97 kJ/mol (Negative ΔG)

Glutamate+NAD++H2O⟶NH+4+α-ketoglutarate+NADH+H+ΔG=3.7 kcal/mol (Negative ΔG)

L-malate+NAD+⟶oxaloacetate+NADH+H+ΔG=29.7 kJ/mol (Negative ΔG)

Thus, the spontaneous reactions are given above.

To learn more about spontaneous reactions :

https://brainly.com/question/14061406

#SPJ11

complete the electron pushing mechanism for the following decarboxylation reaction

Answers

The overall reaction for the decarboxylation reaction is R-COOH + heat -> R-CHO + CO2

In the first step, the carbonyl oxygen of the ketone acts as a nucleophile and attacks the protonated carboxylic acid. This results in the formation of a tetrahedral intermediate. The tetrahedral intermediate collapses, releasing carbon dioxide and forming an enol.

In the second step, the enol tautomerizes to the keto form. This is a process in which the double bond in the enol shifts to a different carbon atom. The keto form is the more stable form of the molecule, so the enol will eventually convert to the keto form.

The overall reaction is a decarboxylation reaction. This type of reaction involves the removal of carbon dioxide from a molecule. Decarboxylation reactions are often used in organic synthesis to prepare new compounds.

Thus, the given reaction and its mechanism is given above.

To learn more about keto-enol :

https://brainly.com/question/31324483

#SPJ11

A steel container of mass 140 g contains 22.0 g of ammonia, NH3, which has a molar mass of 17.0 g/mol. The container and gas are in equilibrium at 18.0°C. How much heat (in J) has to be removed to reach a temperature of −20.0°C? Ignore the change in volume of the steel. (The specific heat of steel is 452 J/(kg · °C). Enter the magnitude.)

Answers

A steel container of mass 140 g contains 22.0 g of ammonia, [tex]NH_3[/tex], which has a molar mass of 17.0 g/mol, the magnitude of the heat that needs to be removed is approximately 2772.6 J.

The amount of heat that needs to be removed:

Q = mcΔT

Now,

Total mass = mass of steel container + mass of ammonia

Total mass = 140 g + 22.0 g = 162.0 g

Total mass = 162.0 g = 0.162 kg

The change in temperature:

ΔT = final temperature - initial temperature

ΔT = (-20.0°C) - (18.0°C) = -38.0°C

Substituting the values into the equation, we can calculate the amount of heat required:

Q = (0.162 kg) * (452 J/(kg · °C)) * (-38.0°C)

Calculating this, we find:

Q ≈ -2772.6 J

Thus, the magnitude of the heat that needs to be removed is approximately 2772.6 J.

For more details regarding temperature, visit:

https://brainly.com/question/7510619

#SPJ4

The magnitude of the heat that needs to be removed to reach a temperature of -20.0 °C is approximately 1,084.536 J.

To calculate the amount of heat that needs to be removed to reach a temperature of -20.0 °C, we can use the equation:

q = mcΔT

Where:

q is the heat (in joules)

m is the mass of the ammonia (in kilograms)

c is the specific heat capacity of steel (in J/(kg · °C))

ΔT is the change in temperature (in °C)

First, we need to convert the given masses from grams to kilograms:

Mass of ammonia, m = 22.0 g = 0.022 kg

Mass of steel container, M = 140 g = 0.14 kg

Next, we calculate the total mass of the system:

Total mass, M_total = m + M

Total mass, M_total = 0.022 kg + 0.14 kg

Total mass, M_total = 0.162 kg

Now we can calculate the heat required using the equation above:

ΔT = (-20.0°C) - (18.0°C)

ΔT = -38.0°C

q = (0.162 kg) × (452 J/(kg · °C)) × (-38.0°C)

q = -1,084.536 J

Hence, the magnitude of the heat required is approximately 1,084.536 J.

Learn more about specific heat here:

https://brainly.com/question/31608647

#SPJ 2

exchangeable acidity can be measured with a ph meter. explain

Answers

Yes, exchangeable acidity is an easy measurement with the help of the pH meter.

In Soil chemistry, exchangeable acidity is a very important parameter to be considered. Exchangeable acidity is the measure of the number of cations that are readily exchanged with acidic ions like H⁺ ions. In soil chemistry, it is mainly used to assess the nutrient contents of the soil and its fertility for needs.

The instrument which can be perfectly used to get measurements about this parameter is the pH meter.

pH meter is an instrument, which measures the acidity or alkalinity in soil solutions. It simply finds the concentration of H⁺ ions in the solution, which is a direct correlation to pH. This is a short introduction to how it works.

First, the pH meter is calibrated using buffer solutions with known pH values. Then after preparing the soil solution into a slurry by mixing with distilled water, and removing the settled sediments, the meter is introduced into the supernatant liquid.

The electrodes in the meter are what measure the voltage data, which is later corresponded to and converted to appropriate pH values. This gives us valuable insights into the ranges of exchangeable acidity.

Note: The pH meter doesn't give a direct value to the exchangeable acidity, but provides us useful data, which is then used for performing chemical reactions on samples to arrive at the results.

For more on Soil Chemistry,

brainly.com/question/32741896

#SPJ4

One important test for kidney disease involves measuring the levels of bicarbonate (HCO
3


)in blood. Normal bicarbonate levels for a person ranging in age from 18 to 59 years old is 23−29mmol/L. A lab purchased a new instrument to measure bicarbonate levels in blood and needs to certify it against their current instrument. The bicarbonate levels in the blood of a 38 year old woman was measured using the old and new instrument. The blood was tested 6 times using each instrument. The mean concentration of bicarbonate using the old instrument was found to be 24.8mmol/L with a standard deviation of 1.60mmol/L. The new instrument yielded a mean concentration of 25.8mmol/L with a standard deviation of 0.53mmol/L. Determine if there is a significant difference in the standard deviations of the two sets of measurements made by the two instruments at the 95% confidence level. Determine the value of F
calc

. F
calc

= Determine the value of F
table

. Refer to the table of critical values of F as needed. F
table

= Is there is a significant difference in the standard deviations of the two sets of measurements made by the two instruments at the 95% confidence level? no yes

Answers

There is a significant difference in the standard deviations of the two sets of measurements made by the two instruments at the 95% confidence level.

Does the analysis indicate a significant difference in the standard deviations of the measurements made by the two instruments at the 95% confidence level?

To determine if there is a significant difference in the standard deviations of the measurements made by the two instruments, we can perform an F-test.

The F-test compares the variances of two datasets to assess if they are significantly different from each other.

In this case, we have the standard deviations of the bicarbonate measurements obtained from the old and new instruments.

The F-test involves calculating the ratio of the variances and comparing it to the critical value from the F-distribution table.

Using the formula F = ([tex]s1^2 / s2^2[/tex]), where s1 and s2 are the standard deviations, we can calculate the calculated F-value ([tex]F_{calc[/tex]).

[tex]F_{calc} = (1.60\ mmol/L)^2 / (0.53\ mmol/L)^2[/tex]

Next, we need to compare [tex]F_{calc[/tex] to the critical value of F from the F-distribution table for a given level of significance (in this case, a 95% confidence level).

If [tex]F_{calc[/tex] is greater than the critical value, we can conclude that there is a significant difference in the standard deviations.

By referring to the F-distribution table, we find the critical value of F ([tex]F_{table[/tex]) for the degrees of freedom associated with the measurements.

By comparing [tex]F_{calc}\ to\ F_{table[/tex], we can determine if there is a significant difference in the standard deviations of the two sets of measurements.

Learn more about F-test

brainly.com/question/32683356

#SPJ11

cryolite na3alf6 an ore used in the production of aluminum

Answers

1) The balanced chemical equation:

AlO₃(s) + 3NaOH(l) + 3HF(g) → Na₃AlF₆ + 3H₂O(g)

2) When 17.5 kilograms of Al₂O₃, 51.4 kilograms of NaOH, and 51.4 kilograms of HF react completely, approximately 36.02 kilograms of cryolite will be produced.

1.

To balance the equation:

AlO₃(s) + NaOH(l) + HF(g) → Na₃AlF₆ + H₂O(g)

We start by balancing the elements other than oxygen and hydrogen:

AlO₃(s) + 3NaOH(l) + HF(g) → Na₃AlF₆ + H₂O(g)

Next, we balance the oxygen atoms:

AlO₃(s) + 3NaOH(l) + 3HF(g) → Na₃AlF₆ + H₂O(g)

Finally, we balance the hydrogen atoms:

AlO₃(s) + 3NaOH(l) + 3HF(g) → Na₃AlF₆ + 3H₂O(g)

Now, the equation is balanced.

2.

To determine the amount of cryolite produced, we need to calculate the limiting reactant, which is the reactant that is completely consumed and determines the maximum amount of product formed.

The molar masses of the compounds are:

Al₂O₃: 101.96 g/mol

NaOH: 39.997 g/mol

HF: 20.01 g/mol

Na₃AlF₆: 209.94 g/mol

First, let's convert the masses of the reactants into moles:

Al₂O₃: 17.5 kg × (1000 g/kg) / (101.96 g/mol) = 171.54 mol

NaOH: 51.4 kg × (1000 g/kg) / (39.997 g/mol) = 1285.79 mol

HF: 51.4 kg × (1000 g/kg) / (20.01 g/mol) = 2570.71 mol

Looking at the balanced equation, we see that the mole ratio between Al₂O₃ and Na₃AlF₆ is 1:1. So, the number of moles of cryolite produced will be equal to the number of moles of Al₂O₃ consumed.

Hence, the amount of cryolite produced is 171.54 mol.

Finally, to determine the mass of cryolite produced, we multiply the number of moles by the molar mass:

Mass of cryolite = 171.54 mol × (209.94 g/mol) = 36,017.08 g

Therefore, 36,017.08 grams (or 36.02 kilograms) of cryolite will be produced when 17.5 kilograms of Al₂O₃, 51.4 kilograms of NaOH, and 51.4 kilograms of HF react completely.

The completed question is given as,

Cryolite, Na3AlF6(s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation.

1.) Balance the equation

- AlO3(s)+NaOH(l)+HF(g)-->Na3AlF6+H2O(g)

2.)If 17.5 kilograms of Al2O3(s), 51.4 kilograms of NaOH(l), and 51.4 kilograms of HF(g) react completely, how many kilograms of cryolite will be produced?

Learn more about Cryolite from the link given below.

https://brainly.com/question/31116628

#SPJ4

Consider the gas phase system below at a high temperature. The form of the expression for the equilibrium constant, K c, ____.
4NH3 + 5O2 --> 4NO + 6H2O
A. is Kc = [NO]4 [H2O]6 / [NH3]4 [O2]5
B. is Kc = [NH3]4 [O2]5 / [NO]4 [H2O]6
C. is Kc = [NH3] [O2] / [NO] [H2O]
D. is Kc = [NO]4[H2O]6 / [NH3]4[O2]5
E. cannot be determined without rate data

Answers

The correct answer is B. The expression for the equilibrium constant, Kc, is given by Kc = [NH3]^4 [O2]^5 / [NO]^4 [H2O]^6.

This expression is determined by the stoichiometric coefficients of the balanced equation. The equilibrium constant expression is obtained by raising the concentrations of the products to the power of their respective stoichiometric coefficients and dividing them by the concentrations of the reactants raised to their respective stoichiometric coefficients. The coefficients in the balanced equation indicate the ratio of moles of each substance involved, and the equilibrium constant reflects the ratio of concentrations at equilibrium.

Learn more about NH3]^4 [O2]^5 / [NO]^4 [H2O]^6 here:

https://brainly.com/question/26478798

#SPJ11

Propose a reason for why 2,4-DNP or semicarbazone derivatives usually precipitate out of their ethanolic solutions.

Answers

Answer:

One reason for the precipitation is the formation of insoluble crystals or complexes between the derivatives and the carbonyl compounds. The reaction between 2,4-DNP or semicarbazone derivatives and carbonyl compounds involves the formation of stable imine or hydrazone derivatives. These derivatives have lower solubility in ethanol compared to the original derivatives. As a result, they tend to form solid precipitates or crystals that separate out from the solution.

Explanation:

When 2,4-DNP or semicarbazone derivatives react with carbonyl compounds, they undergo a chemical reaction to form stable imine or hydrazone derivatives. These derivatives have a lower solubility in ethanol compared to the original derivatives. As a result, they tend to come together and form insoluble crystals or complexes.The formation of these insoluble crystals or complexes is due to the intermolecular forces present in the system. The imine or hydrazone derivatives have specific structural features that allow them to interact with each other or with the carbonyl compounds through various intermolecular forces such as hydrogen bonding or van der Waals forces. These interactions lead to the aggregation of molecules, resulting in the formation of solid precipitates or crystals.Since the solubility of these derivatives is lower in ethanol, the solvent cannot effectively disperse or dissolve the formed crystals or complexes. Instead, they separate out from the solution and become visible as a precipitate.Overall, the formation of insoluble crystals or complexes between the 2,4-DNP or semicarbazone derivatives and carbonyl compounds, along with their decreased solubility in ethanol, leads to the precipitation of these derivatives from ethanolic solutions.

Hope this helped

why are the epidermal layers coated in a waxy cuticle

Answers

The waxy cuticle on the epidermal layers of plants serves several important functions. It reduces water loss by creating a barrier that limits the movement of water out of the plant, which is particularly beneficial in dry environments. The cuticle also acts as a physical barrier against pathogens, protecting the plant from infections.

The epidermal layers of plants are coated in a waxy cuticle for several reasons:

Reduction of water loss: The waxy cuticle acts as a barrier that helps reduce the loss of water through the plant's surface. It prevents excessive evaporation by creating a hydrophobic layer that limits the movement of water out of the plant. This is especially important for plants growing in arid or dry environments where water availability is limited.

Protection against pathogens: The cuticle provides a physical barrier against pathogens such as bacteria, fungi, and viruses. It makes it difficult for these microorganisms to penetrate the plant's tissues and cause infections or diseases.

Prevention of damage from external factors: The waxy cuticle helps protect the plant from various external factors, including ultraviolet (UV) radiation, extreme temperatures, and physical damage. The cuticle can reflect or absorb harmful UV radiation, reducing its damaging effects on the underlying tissues. It also helps to insulate the plant against temperature extremes and can provide some protection against mechanical injuries, such as abrasions.

Reduction of non-stomatal water loss: The cuticle helps minimize non-stomatal transpiration, which refers to water loss through the leaf surface other than through stomata (tiny openings on the leaf surface). By reducing non-stomatal water loss, the cuticle helps the plant regulate its water balance more efficiently.

Learn more about Waxy cuticle from the link given below.

https://brainly.com/question/13604599

#SPJ4

a. State Charles Law and Boyles Law.

b. A rigid tank of Volume 0.1m³ contains air at P= 320 kPa and T1= 110ºC. As a result of cooling

the temperature drops to T2= 55°C. determine the following:

i. The mass of air inside the tank

ii. The final pressure inside the tank after cooling

c. If the above case in b is considered as heating from 25°C to 175°C, determine the mass and the final pressure. Also compare using the obtained results. [for both cases Take R = 0.287 kJ/Kg K

Answers

i. The mass of air inside the tank is calculated using the ideal gas law: m₁ = (P₁V₁) / (RT₁), and m₂ = (P₂V₂) / (RT₂).

ii. The final pressure inside the tank after cooling is determined using Boyle's Law: P₁V₁ = P₂V₂.

iii. Repeat the calculations for heating from 25°C to 175°C using the given temperatures and equations to determine mass and final pressure, then compare the results.

a) Charles' Law states that at constant pressure, the volume of a gas is directly proportional to its temperature, expressed mathematically as V₁ / T₁ = V₂ / T₂. Boyle's Law states that at constant temperature, the pressure of a gas is inversely proportional to its volume, expressed as P₁V₁ = P₂V₂.

b)

i. To determine the mass of air inside the tank, we need to use the ideal gas law equation:

PV = mRT, where P is pressure, V is volume, m is mass, R is the gas constant, and T is temperature.

Step 1: Convert temperatures to Kelvin:

T₁ = 110°C + 273.15 = 383.15 K

T₂ = 55°C + 273.15 = 328.15 K

Step 2: Calculate the initial mass using the ideal gas law:

m₁ = (P₁V₁) / (RT₁)

Step 3: Calculate the final mass using the ideal gas law:

m₂ = (P₂V₂) / (RT₂)

ii. To determine the final pressure inside the tank after cooling, we can use Boyle's Law:

P₁V₁ = P₂V₂

c)

To calculate the mass and final pressure for heating from 25°C to 175°C, we follow the same steps as in part b, using the given temperatures and applying the ideal gas law and Boyle's Law.

Step 1: Convert temperatures to Kelvin:

T₁ = 25°C + 273.15 = 298.15 K

T₂ = 175°C + 273.15 = 448.15 K

Step 2: Calculate the mass using the ideal gas law:

m₁ = (P₁V₁) / (RT₁)

m₂ = (P₂V₂) / (RT₂)

Step 3: Calculate the final pressure using Boyle's Law:

P₁V₁ = P₂V₂

Finally, compare the obtained results for both cases to analyze the effect of cooling and heating on the mass and final pressure of the air inside the tank.

Learn more about Boyle's Law from the given link: https://brainly.com/question/21184611

#SPJ11

draw a tetrahedral representation of (r)-2-fluoropentane.

Answers

Arrange the remaining three groups (C atoms) in a clockwise direction around the central carbon atom to represent the (R)  configuration.

Visualize a tetrahedron with four vertices. Each vertex represents a group or atom in the molecule.

Assign one vertex to the fluorine atom (F). This atom is directly bonded to the second carbon atom (C) in the pentane chain.

Assign the other three vertices to the three remaining carbon atoms (C) in the pentane chain.

Determine the stereochemistry of the molecule. To represent (R)-2-fluoropentane, the priority of the groups attached to the second carbon atom (C) must be assigned according to the Cahn-Ingold-Prelog (CIP) priority rules. Assign priorities based on the atomic number, where fluorine (F) has the highest priority.

Place the highest priority group (F) on a dashed line extending out of the plane of the tetrahedron, indicating it is coming out of the paper or screen.

Arrange the remaining three groups (C atoms) in a clockwise direction around the central carbon atom (C) to represent the (R) configuration. The image is given below.

To know more about tetrahedral representation:

https://brainly.com/question/30216028

#SPJ4

the most common laboratory method used to assess brain natriuretic peptides is group of answer choices serum electrophoresis. nephelometry. immunoassay. hplc.

Answers

The most common laboratory method used to assess brain natriuretic peptides is immunoassay.

Immunoassay is a technique that utilizes specific antibodies to detect and measure the levels of target molecules, such as brain natriuretic peptides, in a biological sample. It is a widely used method due to its high sensitivity and specificity in detecting and quantifying biomarkers. Immunoassays for brain natriuretic peptides involve the binding of specific antibodies to the peptides, followed by a detection system that produces a measurable signal. This method allows for accurate assessment of brain natriuretic peptide levels, which are important in diagnosing and managing heart failure and other cardiovascular conditions.

Learn more about common laboratory here:

https://brainly.com/question/32549357

#SPJ11

Calculate the mass percent composition of sulfur in Al2(SO4)3. (The molar mass of Al2(SO4)3 is 342.14 g/mol.)
a. 9.372%
b. 21.38%
c. 42.73%
d. 28.11%
e. 35.97%

Answers

The mass percent composition of sulfur in Al₂(SO₄)₃ is approximately 28.11%. Option D is correct.

To calculate the mass percent composition of sulfur in Al₂(SO₄)₃, we need to determine the molar mass of sulfur and divide it by the molar mass of Al₂(SO₄)₃, then multiply by 100%.

The molar mass of sulfur (S) will be 32.06 g/mol.

The molar mass of Al₂(SO₄)₃ will be calculated as;

2(Al) + 3(S) + 12(O)

2(26.98) + 3(32.06) + 12(16.00)

53.96 + 96.18 + 192.00

342.14 g/mol

Next, we calculate the mass percent composition of sulfur;

(mass of sulfur / mass of Al₂(SO₄)₃ × 100%

(mass of sulfur) = 3(S) × (molar mass of S)

= 3(32.06)

= 96.18 g

(mass of Al₂(SO₄)₃) = molar mass of Al₂(SO₄)₃

= 342.14 g

mass percent composition of sulfur = (96.18 g / 342.14 g) × 100%

≈ 28.11%

Therefore, the mass percent composition of sulfur in Al₂(SO₄)₃ is approximately 28.11%.

Hence, D. is the correct option.

To know more about mass percent composition here

https://brainly.com/question/33444158

#SPJ4

A parcel of air is travelling across a warm lake and takes up moisture.
a) Will the isotopic composition of the moisture be more enriched or more depleted in the heavy isotopes of oxygen and hydrogen?
b) what will happen to the isotopic composition of the lake?

c) The air parcels reach a mountain and are forced upwards and they rain out most of their moisture. When is the isotopic composition of this rain lower (more depleted in the heavy isotope): at the beginning or the end of the dry period in the lowland?

Answers

When a parcel of air is travelling across a warm lake and takes up moisture, then a) The isotopic composition of the moisture will be more enriched in the heavy isotopes of oxygen and hydrogen ; b) The isotopic composition of the lake will become more depleted ; c) The isotopic composition of the rain is lower (more depleted in the heavy isotope) at the end of the dry period in the lowland.

Isotopes are atoms that contain an equal number of protons but different numbers of neutrons. The isotopic composition of water, or its ratio of heavy isotopes to light isotopes, can provide information about the environment in which the water formed.The isotopic composition of precipitation (rain, snow) varies with temperature, humidity, and other factors.

(a) As air masses travel over the ocean, they absorb water vapor with isotopic compositions determined by the temperature and humidity of the surface waters. The air masses pick up moisture as they travel over the lake, and this moisture has a higher isotopic composition (more enriched in heavy isotopes) than the initial moisture content in the parcel of air.

(b) The isotopic composition of the lake will be affected by the evaporation of the surface water, resulting in the concentration of isotopically light water molecules. When the parcel of air passes over it and takes up moisture, the isotopic composition of the lake will become more depleted in the heavy isotopes of oxygen and hydrogen than the remaining lake water.

(c) The isotopic composition of precipitation (rain) is lower (more depleted in the heavy isotope) at the end of the dry period in the lowland, when the amount of moisture in the air is minimal and it has lost most of its isotopically heavy fraction. Rain is produced by the condensation of moisture in the atmosphere, which has an isotopic composition determined by the temperature, humidity, and history of the air mass. Therefore, when there is a minimal amount of moisture in the air, the isotopic composition of the rain is lower.

Thus, the required answers are described above.

To learn more about isotopes :

https://brainly.com/question/13604636

#SPJ11

when heat is added to boiling water, its temperature

Answers

When heat is added to boiling water, its temperature remains constant.

When heat is added to boiling water, its temperature remains steady at the boiling point. This is because the added heat is primarily used to convert the liquid water into steam, rather than increasing its temperature.

During the boiling process, the heat energy breaks the intermolecular bonds between water molecules, allowing them to escape as vapor. As long as the water continues to boil, the temperature will stay constant until all the liquid water has been converted to steam.

Therefore, when heat is added to boiling water, its temperature remains constant.

Learn more about boiling water from the link given below.

https://brainly.com/question/27161253

#SPJ4

Which of the following statements about the
15
N isotope of nitrogen is true? Although not very abundant,
15
N is 'NMR active' and a stable (nonradioactive) isotope of nitrogen. The
14
N atom is not 'NMR active' because of the fact that it is relatively non-abundant. Since
15
N is is an isotope of the far more abundant
14
N atom, the
15
N isotope must decay to
14
N and therefore it is radioactive. Black soldier fly larva (BSFL) preferentially take up bacteria that are
14
N labelled. Question 17 5 pts Which of the following statements is true regarding purpose of the control
1
HNMR experiment? The control
1
HNMR experiment was used to detect the ratio of
15
N to
1
H(
15
N/
1
H). The control
1
H NMR experiment was performed in order to prove that there was actual protein within the NMR tubes that correspond to days 1,2,3,4, and 6 . The control 'H NMR experiment was used to determine the ratio of 15 N atoms when comparing egg white proteins relative to eg8 yolk proteins. The control
1
HNMR experiment was used to detect the ratio of
15
N to
14
N(
15
N/
14
N).

Answers

- The correct statement about the 15N isotope of nitrogen is: Although not very abundant, 15N is 'NMR active' and a stable (nonradioactive) isotope of nitrogen.

- Regarding the purpose of the control 1HNMR experiment, the true statement is: The control 1HNMR experiment was performed to prove that there was actual protein within the NMR tubes that correspond to days 1, 2, 3, 4, and 6.

The statement that is true about the 15N isotope of nitrogen is that although not very abundant, 15N is 'NMR active' and a stable (nonradioactive) isotope of nitrogen. This means that despite its lower abundance compared to the more common 14N isotope, 15N can still be detected and analyzed using nuclear magnetic resonance (NMR) spectroscopy. Being 'NMR active' indicates that the isotope can interact with the magnetic field and provide valuable information about its chemical environment and molecular structure.

Contrary to the statement, the 15N isotope of nitrogen is stable and does not decay into 14N. It is not radioactive. Both 14N and 15N are stable isotopes of nitrogen, but they differ in the number of neutrons present in their nuclei.

Regarding the purpose of the control 1HNMR experiment, it was performed to confirm the presence of actual protein within the NMR tubes corresponding to specific days (1, 2, 3, 4, and 6). The control 1HNMR experiment serves as a reference or baseline measurement to ensure that the observed NMR signals are indeed related to the protein samples being studied. By comparing the spectra obtained from the control experiment with the spectra of the protein samples, researchers can assess the changes and dynamics of the protein structure over time. It helps validate the experimental setup and ensure the reliability of the data obtained during the study.

Learn more about isotopes at https://brainly.com/question/13604636

#SPJ11

Chemistry problem, I’m conflicted between A or D

Answers

If the balloons are placed in a warmer room, all of the balloons will increase in volume equally because they have equal numbers of molecules.

The correct answer is D.

What happens to the volume of gases when they are heated?

According to the ideal gas law, the volume of a gas is directly proportional to its temperature when the pressure and number of moles are held constant.

When the balloons are placed in a warmer room, the temperature increases resulting in an increase in volume. Since all three balloons have the same number of molecules and experience the same increase in temperature, they will all increase in volume equally.

Learn more about the volume of gases at: https://brainly.com/question/25736513

#SPJ1

explain how water moves from the soil into the root

Answers

Water enters the roots of plants through osmosis, as it moves from an area of high concentration in the soil to an area of lower concentration in the root cells. Root pressure, caused by the accumulation of mineral ions, further aids in pushing water up the plant through the xylem vessels.

Water moves from the soil into the root through the process of osmosis and root pressure. The root is the main organ that uptakes water and minerals from the soil. Here is how the process works:

Osmosis

Osmosis is the process by which water molecules move from an area of high concentration to an area of low concentration across a semi-permeable membrane. In plants, the cell membrane of root hair cells acts as a semi-permeable membrane. As the soil around the root contains more water than the cells in the root, water moves into the root hair cells by osmosis.

Root pressure

Root pressure is the pressure that develops in the root due to the accumulation of mineral ions in the root cells. This pressure forces the water to move up the plant and into the xylem vessels in the stem. The xylem vessels then transport water and dissolved minerals to all parts of the plant, providing the necessary nutrients for growth and survival.

In conclusion, water moves from the soil into the root by osmosis and root pressure.

To know more about root, refer to the link below:

https://brainly.com/question/29790023#

#SPJ11

name of the arrhenius acid that contains the fluoride anion

Answers

The name of the Arrhenius acid that contains the fluoride anion is hydrofluoric acid (HF). Hydrofluoric acid is a strong acid that consists of hydrogen (H) and fluoride (F) ions. In its pure form, hydrofluoric acid is a colorless liquid with a strong and pungent odor.

Hydrofluoric acid is unique because it is the only known inorganic acid that readily ionizes in water to produce fluoride ions (F⁻) and hydronium ions (H₃O⁺). The dissociation reaction can be represented as follows:

HF (aq) ↔ H⁺ (aq) + F⁻ (aq)

Fluoride anion (F⁻) is a highly reactive species and plays a crucial role in various chemical and biological processes. It is widely used in industrial applications, including the production of fluorine-containing compounds and as a reagent in organic synthesis.

However, hydrofluoric acid is also known for its hazardous properties. It is corrosive to the skin and can cause severe burns. Moreover, fluoride ions have the ability to penetrate tissues deeply and can lead to systemic toxicity. Therefore, the handling and use of hydrofluoric acid require proper safety precautions and protective measures.

To know more about Hydrofluoric acid, refer to the link below:

https://brainly.com/question/30750257#

#SPJ11

is an ionic bond stronger in water or organic solvent

Answers

Ionic bond is stronger in an organic solvent as compared to water. The reason behind this is explained below:

An ionic bond is formed when an electron from one atom is completely transferred to another atom. Thus, two ions, a positively charged ion (cation) and a negatively charged ion (anion), are formed.

The electrostatic force of attraction between the oppositely charged ions results in the formation of an ionic bond. The ionic compounds dissociate into ions in a solution. The extent of dissociation depends on the solvent used.

The polar nature of water molecules causes the water molecules to surround the ions and separate them by disrupting the attractive forces between the cations and the anions.

This effect is known as hydration, and it causes the ionic bonds to weaken in water. Therefore, ionic bonds are weaker in water than in organic solvents where the solvent does not interfere with the ionic bond.

To learn more about solvent, refer below:

https://brainly.com/question/11985826

#SPJ11

Choose the most correct answer – several will be true but only one is correct

1. A fuel cell is the best way to convert chemical energy to electrical energy because:

a. It has the least pollution of all energy conversion devices.

b. It is easily portable because you can make them very small.

c. It has only H2O as effluent.

d. Fuel cells have an energy conversion efficiency that is quite high.

2. One of these statements is not correct.

a. Fuel cells are scalable by adding cells to the stack

b. Voltage of a fuel cell can be increased by adding them in series.

c. Many different types of electrolytes generate different types of fuel cells.

d. The voltage generated by a single cell is very low (1.4V or so).

e. Fuel cells generate very little pollution regardless of the reactants.

f. Fuel cells can range in application from small handheld devices to generators for large cities.

3. Having done this course, you are now experts in sustainability. Which of the following statements is not an example of sustainable behavior?

a. Feed recycled plastics into the coker to get rid of difficult polymers and generate fuel.

b. Reuse my broken mugs as window-sill herb pots.

c. Use NH3 instead of marine fuel oil in ocean liners.

d. Convert an existing nuclear plant in California to a massive geothermal facility using deep well water in Salton Sea.

e. Trade in my fancy gas-guzzling SUV for a Tesla and a bike.

Answers

The most correct answers are : (1)  (option d) Fuel cells have an energy conversion efficiency that is quite high ; (2) (option d) The voltage generated by a single cell is very low (1.4V or so) ; (3) (option a) Feed recycled plastics into the coker to get rid of difficult polymers and generate fuel.

1. A fuel cell is the best way to convert chemical energy to electrical energy because fuel cells have an energy conversion efficiency that is quite high.

Fuel cells have emerged as one of the most promising technologies for generating electricity with high efficiency and low pollution. Fuel cells can be used in a wide range of applications, including transportation, stationary power generation, and portable power generation.

Fuel cells have a higher efficiency than traditional combustion technologies and have the potential to produce electricity at lower costs.

Fuel cells are also cleaner than combustion technologies, producing fewer emissions such as carbon dioxide (CO2) and pollutants such as nitrogen oxides (NOx).

2.The statement which is not correct is : The voltage generated by a single cell is very low (1.4V or so) because the voltage generated by a single fuel cell can vary depending on the type of fuel cell, the type of fuel used, and the operating conditions.

For example, some fuel cells can generate several volts, while others generate less than one volt.

3. The statement that is not an example of sustainable behavior is : feed recycled plastics into the coker to get rid of difficult polymers and generate fuel.

Feeding recycled plastics into the coker is not an example of sustainable behavior because it is not a sustainable method of waste management. The coking process generates a large amount of greenhouse gases and air pollutants, which contribute to climate change and air pollution.

Thus the correct answers are :

option doption doption a

To learn more about polymers :

https://brainly.com/question/24632066

#SPJ11

Other Questions
which of the following statements about tab order is false A. The actual tab order setting for a form can be used in the Form View.B. The tab order setting determines the movement of the insertion point through a form.C. The tab order setting is usually right-to-left and top-to-bottom.D. The default tab order setting can be altered by moving the controls in the Design View. When discussing communication, Auditor General Randall L. Exley explains that how a person communicates (i.e., what channels he or she uses) is just as important as the message. He also feels that receiving feedback is often more important than sending a message. Knowing your receivers and establishing a relationship with them is vital (Skidmore-Williams, 2013). What do you think about Exley's ideas about communication? Do you agree that it is more about listening than talking? Is audience analysis as important of a concept as he believes it to be? Explain. If a bank currently holds $600 million in deposits, $10 million in cash in its vault, $40 million in reserves, and has a target reserve ratio of 6 percent, this bank has:O excess reserves of $40 million.O target reserves of $2.4 million.O excess reserves of $14 million.O a reserve deficiency of $4 million. how many moles of argon are in a sample containing 2.4 x 10^24 atoms of argon?known:gramsunknown:molesconversion factor: 1 mole=6.022 x 10^23 atoms list two ways that invasive plant species can alter fireregimes in your own words define a target market. how does a company determine the target market for a specific product? How do we keep from misidentifying a target market? explain/defend your position(s) with at least one credible reference. Which of the following would allow a Quebec employer to review their statement of account from Revenu Quebec on a regular basis?Releve-1My Account for Businesses online serviceTeleReplyNone of the above Which of the following is the angle between the vectors u=7,2 and v=10,1? a. 162.323 b. 159.259 C. 155.275 d. 158.344 1 An electroscope is negatively charged, and its leaves diverge. What would happen to the leaves (and why) if you touched the bulb with a) your finger and b) a glass rod that has been rubbed with silk? #2 Why do static electricity effects, such as sparks jumping to door knobs, occur best on dry days? #3 You might have noticed a chain or conductive strip dangling to the ground from a gasoline truck. Why is this the case? an office building was damaged by fire caused by a careless tenant. after paying for the loss, the insurance company pursued the tenant to collect the damages. which principle is this describing? Present the descriptive statistics of the variables total_casesand total_deaths. Comment on the means and measures of dispersion(standard deviation, skewness, and kurtosis) of these twovariables. Which of the following best describes the difference between a marketing communication mix and a personal communication mix?Question 1 options:The need for continuous modification.The types of tools used to create the mix.The need for self-awareness.The use of different tools to communicate an intended message. Assume that you are building a website with a database back-end for a bookshop which specialises in antique and rare books. The bookshop does not have any web presence at the moment and the long-time staff and owners have minimal experience of the use of computers and the Internet. You are the Project Leader for this project and you need to develop sections of a Project Plan as outlined below. (The website itself will not be a deliverable of this project and will not be assessed as part of the Applied Software Project Management Module). The documentation which will be submitted will be developed on a portfolio basis building on what has been covered in the labs and lectures week by week.The Project Documents should include the following:Feasibility Study: (20%) A feasibility study before embarking on the project. You will need to outline how a feasibility study could be carried out and will also need to provide a sample Return on Investment (ROI) Calculation and a sample Net Present Value (NPV) or Internal Rate of Return (IRR) as part of the study. You should explain what these values represent and what they are used for. You will also need to make some assumptions on how the project could make profits and value those profits, for example by saving headcount costs or through increased sales revenues. b. A 200 g ball is thrown upwards with a speed of 12 ms^1. (i) How high does it rise if friction are negligible (ii) If it rises up to 6.0 m, how large is average frictional force impedes its motion. (iii) Under the average frictional force in b, how fast is the ball moving when it returns to the thrower? Bagehot explained why borrowing is so attractive to firms, despite the risks. Suppose an investor has $10,000 to invest and can borrow $20,000 at a 5% interest rate. He makes a gross profit of $2,000 a year. Of that $2,000, he has to pay interest on his debt. QUESTION: What is that investor's rate of return on his investment? 10% 90% 55% 90.9% None of the above. the batteries in mobile computers and devices typically are rechargeable lithium-ion batteries.a. true b, false Which of the following is a problem when using management science approaches to management? Quantitative approaches are more effective for solving worker engagement problems than they are for actually increasing productivity. Many managers do not know enough about mathematical techniques to use them effectively, so they often arrive at the wrong conciusions when using management science. Modern computers do not have the power needed to handle highly complex mathematical modeling. The managers using these techniques may fail to take factors into account that change the outcomes of mathematical models. this is the general name given to the expenses that a borrower pays when his or her mortgage loan is closed, the funds are paid to the seller, and the buyer receives title to the purchased property. 1. (a) Simplify the following combination of sets:i) ()()cii) (c)(cc)(b) Show that for any two events, and , P()+P()1P().(c) Given the experimental events , and , show that, P()=P()+P()+P()P()P()P()+P()(d) Show that if , then P(c)P(c) , where c and c are the complements of and respectively. The solution by the last solver was incorrect. All sections of the excel sheet need to be filled out in order to properly complete. The 1.2234 unity cost was deemed incorrect by excel which was done by the first solver. Numbers with decimals at the end such as 27,751,59 were also too long and incorrect.