Name the following compound: CH₂-C- CH₂-CH₂-CH₂-C - H butanal O2-butanol O propyl hydrogen ether 1-propanone​

Name The Following Compound: CH-C- CH-CH-CH-C - H Butanal O2-butanol O Propyl Hydrogen Ether 1-propanone

Answers

Answer 1

Answer:

butanal

Explanation:

It's not 1-propanone because otherwise you have OH bonded to C not O and H bonded to C separately. 2-butanol means that the O and H would be bonded to a different C atom, and it's not propyl hydrogen ether because the O would be in the chain of bonded Cs.
Hope this helps :)

Answer 2

Answer:

Butanal

Explanation:

trust


Related Questions

He heat of solution of kcl is 17. 2 kj/mol and the lattice energy of kcl(s) is 701. 2 kj/mol. calculate the total heat of hydration of 1. 00 mol of gas phase k ions and cl– ions

Answers

The total heat of hydration of 1. 00 mol of gas phase [tex]K^{+}[/tex] ions and [tex]Cl^{-}[/tex]ions is - 684 kJ/mol.

Calculation ,

Given data ,

Heat of solution =  17. 2 kJ/mol

lattice energy of KCl(s) = 701. 2 kJ/mol.

heat of hydration = ?

The KCl is formed by[tex]K^{+}[/tex] ions and [tex]Cl^{-}[/tex]– ions

Δ[tex]H_{solution}[/tex] = U° + Δ[tex]H_{hydration}[/tex]

Δ[tex]H_{hydration}[/tex] = Δ[tex]H_{solution}[/tex] - U° =  17. 2 kJ/mol - 701. 2 kJ/mol = - 684 kJ/mol

Hence, heat of hydration of 1. 00 mol of gas phase [tex]K^{+}[/tex] ions and [tex]Cl^{-}[/tex] ions is - 684 kJ/mol.

To learn more about  hydration

https://brainly.com/question/15724859

#SPJ4

For a typical titration, 0. 010 m naoh is the titrant (in the buret). if the initial buret reading is 2. 45 ml, and the final buret reading is 18. 70 ml, how much naoh was used for the titration?

Answers

16.25 ml NaOH was used for the titration.

Titration:

"The process of calculating the quantity of a material A by adding measured increments of substance B, the titrant, with which it reacts until exact chemical equivalency is obtained (the equivalence point)" is the definition of titration.

A titration is a method for figuring out the concentration of an unknown solution by using a solution with a known concentration. Until the reaction is finished, the titrant (the known solution) is typically added from a buret to a known volume of the analyte (the unknown solution).

0. 010 m NaOH is the titrant (in the buret).

The initial buret reading is 2. 45 ml

The final buret reading is 18. 70 ml

The volume of NaOH = 18.70ml - 2.45 ml

                                    = 16.25 ml

Therefore, 16.25 ml NaOH was used for the titration.

Learn more about titration here:

https://brainly.com/question/27107265

#SPJ4

three difference between radicle and plumule​

Answers

Answer:

1)RADICLE ->It is the embryonic root of the plant.

PLUMULE ->It is the embryonic shoot of the plant.

2)RADICLE ->It grows downwards into the soil.

PLUMULE ->It grows upwards into the air.

3)RADICLE ->Radicle is the first part of the seedling.

PLUMULE -> Plumule grows after the radicle.

4)Radicles are negatively phototropic. Plumule is positively phototropic.

i am glad i helped

A buffer is prepared by adding 300. 0 ml of 2. 0 mnaoh to 500. 0 ml of 2. 0 mch3cooh. what is the ph of this buffer? ka= 1. 8 10-5(ans. 4. 92)

Answers

The Henderson-Hasselbalch equation can be used to determine the pH of the buffer from the pKa value. The pH of the buffer will be 4.75.

What is the Henderson-Hasselbalch equation?

Henderson-Hasselbalch equation is used to determine the value of pH of the buffer with the help of the acid disassociation constant.

Given,

Acid disassociation constant (ka) = 1. 8 10⁻⁵

Concentration of NaOH = 2.0 M

Concentration of CH₃COOH = 2.0 M

pKa value is calculated as,

pKa = -log Ka

pKa = - log (1. 8 x 10⁻⁵)

Substituting the value of pKa in the Henderson-Hasselbalch equation as

pH = - log (1. 8 x 10⁻⁵) + log [2.0] ÷ [2.0]

pH = - log (1. 8 x 10⁻⁵) + log [1]

= 4.745 + 0

= 4.75

Therefore, 4.75 is the pH of the buffer.

Learn more about the Henderson-Hasselbalch equation here:

https://brainly.com/question/27751586

#SPJ4

What is the oxidation number for n in the compound nh3? (recall that h usually has an oxidation number of 1.)

Answers

The oxidation number for n in the compound [tex]NH_{3}[/tex] will be -3.

The charge an atom would have if all of its links to other atoms formed fully ionic could be known as the oxidation state, also known as the oxidation number. It describes how much an atom in a chemical molecule has been oxidized. The oxidation state can theoretically be positive, negative, and zero.

The oxidation number of N in  [tex]NH_{3}[/tex] will be calculated as:

Let the oxidation number of H is 1.

[tex]NH_{3}[/tex] = 0

x + 3(1) = 0

x = -3.

Therefore, the oxidation number for N in the compound [tex]NH_{3}[/tex] will be -3.

To know more about oxidation number

https://brainly.com/question/15167411

#SPJ4

What volume of H2 gas will be produced if 60 L of ammonia, NH3, is decomposed into H2 and N2, assuming that all conditions are at STP?

a)

30 L

b)

90 L

c)

60 L

d)

120 L

e)

150 L
need answer ASAP!!

Answers

Answer:

I think the answer is c I'm not sure but probaly dont put c if your. ot sure try looking up the answers that helps me alot through my word

The volume of H₂ gas produced is approximately 90 L, Option (b) is correct.

To find the volume of H₂ gas produced when 60 L of ammonia (NH₃) is decomposed, we use the balanced chemical equation for the decomposition of ammonia:

2 NH₃(g) → 3 H₂(g) + N₂(g)

According to the equation, 2 moles of ammonia produce 3 moles of hydrogen gas (H₂). At STP (Standard Temperature and Pressure), 1 mole of any gas occupies 22.4 liters.

First, calculate the moles of ammonia present in 60 L:

Moles of NH₃ = Volume / Molar Volume at STP = 60 L / 22.4 L/mol ≈ 2.68 moles

Using the stoichiometric ratio, 3 moles of H₂ are produced from 2 moles of NH₃. So, we can calculate the moles of H₂ produced:

Moles of H₂ = (3/2) * Moles of NH₃ ≈ (3/2) * 2.68 moles ≈ 4.02 moles

Now, find the volume of H₂ gas produced:

Volume of H₂ = Moles of H₂ * Molar Volume at STP = 4.02 moles * 22.4 L/mol ≈ 89.9 L

Rounded to one decimal place, the volume of H₂ gas produced is approximately 90 L, which corresponds to option b).

To learn more about  H₂ gas  here

https://brainly.com/question/31127081

#SPJ2

The external expression of a mineral’s orderly internal arrangement of atoms is referred to as:____.

Answers

The external expression of a mineral’s orderly internal arrangement of atoms is referred to as its crystal form

Internally, a mineral's crystal structure, or regular, repeating arrangement of atoms, reflects the chemical makeup of the mineral. A CHEMICAL FORMULA, which only lists the proportions of the various elements and groups of elements in the mineral, can be used to describe the composition of a mineral. For minerals with a narrow range of composition, the latter idea—groups of elements—comes into play. Color, hardness, luster, crystal formations, density, and cleavage are characteristics that aid geologists in determining a mineral's identity in a rock. The atomic structure of a crystal essentially determines its form, cleavage, and hardness. Chemical composition is the main determinant of color and density.

To learn more about minerals please visit-
https://brainly.com/question/1333886
#SPJ4

Which term describes this molecular shape?

Answers

Answer:

B.) Trigonal planar

Explanation:

This molecule has 3 bonds and no lone pairs. The angles are all 120° and the bonds are within the same plane. These molecules have the molecular shape of trigonal planar.

The malonic ester synthesis is a method for preparing carboxylic acids from alkyl halides. For each of the carboxylic acid products, draw the structure of the alkyl bromide that would be used in its synthesis.

Answers

Haloalkanes are another name for alkyl halides. Alkyl halides are substances in which halogen atoms have taken the place of one or more hydrogen atoms in an alkane (fluorine, chlorine, bromine, or iodine).

What is the structural property of alkyl bromide?Alkyl halides are halogen-substituted alkanes in which a halogen atom, such as fluorine, chlorine, bromine, or iodine, is used in place of one or more hydrogen atoms in an alkane. An alkyl halide has a link between the carbon atom and the halogen atom, which is sp3-hybridized and has a tetrahedral form.Vinyl halides are substances, as opposed to alkyl halides, in which a halogen atom is attached to a sp2-hybridized carbon atom of a carbon-carbon double bond (C=C). In contrast, aryl halides are substances in which a halogen atom is joined to an aromatic ring's sp2-hybridized carbon atom.Alkyl halides are further divided into primary, secondary, and tertiary alkyl halides based on the level of substitution at the carbon atom holding the halogen. The term "- carbon" refers to the carbon that is bound to a halogen atom. The term "-carbon" refers to the carbon atom that is connected to it. Greek alphabets are then used to represent the neighboring carbons (, and so on).

To learn more about Alkyl halides click here-

https://brainly.com/question/25175333

#SPJ4

The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a ________ group

Answers

The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a Carboxyl group.

What is the Carboxyl Group ?

The carboxyl group is an organic functional group. Carboxyl group contains two functional groups that is carbonyl group (C = O) and hydroxyl group (OH) which attached with single carbon atom. The structural formula for carboxyl group is RCOOH where R is alkyl or aryl group.

Example of Carboxyl group: HCOOH (Methanoic Acid) , CH₃COOH (Ethanoic acid) etc.

Thus from the above conclusion we can say that The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a Carboxyl group.

Learn more about the Carboxyl group here: https://brainly.com/question/15942533

#SPJ4

g. Hot water at 100 °C is added to 300 g of water at 0 °C until the final temperature is 40 °C. Find the mass of the hot water added. The specific heat capacity of water is 4200 Jkg-¹°C¹.​

Answers

Answer:

000

Explanation:

hi

my

name

is

God

000answer

If the density of blood is 1. 060 g/ml. What is the mass of 6. 56 pints of blood?

Answers

Answer:

3290 gm

Explanation:

6.56 pints  * 473.1765 ml/pint  * 1.060 g/ml = 3290  gm  

If the density of blood is 1. 060 g/ml. 3290 grams is the mass of 6. 56 pints of blood.

In the study of chemistry, physics, and engineering, comprehending and characterising different substances depend greatly on density, a fundamental physical attribute. It is described as the ratio of a material's mass to volume. Being an intense quality, density is solely reliant on the composition of the substance and is not dependent on its quantity.

1 pint=473.176 milliliters.

6.56 pints ×473.176 ml/pint = 3099.57 milliliters

Density of blood = 1.060 g/ml

Volume of blood = 3099.57 ml

Mass = Density × Volume

Mass = 1.060 g/ml × 3099.57 ml ≈ 3290 grams

To know more about density, here:

https://brainly.com/question/29775886

#SPJ7

Which are products of nuclear fusion? check all that apply. energy helium gas high temperatures hydrogen gas low pressure

Answers

The products created during nuclear fusion are Energy and Helium Gas

Overall, two positrons, two neutrinos (which convert two of the protons into neutrons), and energy are released along with the fusion of four protons into one alpha particle.

What is Nuclear fission ?

Nuclear fission is a nuclear reaction in which low energy neutrons are used to smash the nucleus of an atom into smaller nuclei. In this process, a large amount of energy is released. Nuclear fission reactions are employed in nuclear power reactors due to their simplicity and high energy output.

What is Nuclear fusion ?

When two or more atoms come together to produce one heavier nucleus, the process is known as nuclear fusion. This process releases a tremendous quantity of energy, far more than the energy

Learn more about Nuclear fusion and fission here:

https://brainly.com/question/13859758

#SPJ4

What is the mass (g) of a piece of magnesium wire that produces 41. 8 ml of hydrogen gas collected over water at 21. 0 °c and at a pressure of 752 torr?

Answers

The mass (g) of a piece of magnesium wire that produces 41. 8 ml of hydrogen gas collected over water at 21. 0 °c and at a pressure of 752 torr is  0.041 gm.

Calculation,

According to ideal gas equation,

PV = nRT

Where, P is the pressure = 752 torr = 752 mmHg/760 mmHg/atm

P is the pressure in atm = 0.989atm

V is the volume = 41. 8 ml = 0.0418 L

R is the universal gas constant = 0.0821 Latm/mol K

T is the temperature =  21. 0 °C = 21. 0 + 273 = 294 K

n is the number of moles = ?

By putting value of P , V , T , and  R in equation (i) we get,

0.989atm × 0.0418 L = n ×0.0821 Latm/mol K ×294 K

n = 0.989atm × 0.0418 L/0.0821 Latm/mol K×294 K = 0.00171 mol

Number of moles (n) = given mass/ molar mass =  given mass/24.305

Mass = Number of moles×molar mass =  0.00171 mol×24.305 g/mol

Mass of the magnesium wire = 0.041 gm

learn more about hydrogen gas

https://brainly.com/question/12745309

#SPJ4

When nahco3 completely decomposes, it can follow this balanced chemical equation: 2nahco3 → na2co3 h2co3 determine the theoretical yields of each product using stoichiometry if the mass of the nahco3 sample is 3.80 grams. (show work for both) in an actual decomposition of nahco3, the mass of one of the products was measured to be 2.36 grams. identify which product this could be and justify your reasoning. calculate the percent yield of the product identified in part b. (show your work)

Answers

Theoretical yield = 2.397

The product could be sodium carbonate

percent yield = 98.456%

When nahco3 completely decomposes, it can follow this balanced chemical equation:

2nahco3 → na2co3 h2co3

If the mass of the NaHCO3 sample is 3.80 g, we must use stoichiometry to calculate the theoretical yields of each of the products.

mass of NaHCO₃ = 3.80 g

molar mass of NaHCO₃ = 84 g/mol

so the no of moles of NaHCO₃ = 3.80/84 =  0.0452 mol

You see, one mole of sodium carbonate and one mole of hydrogen carbonate are produced from two moles of sodium bicarbonate.

so, the no of moles of sodium carbonate = 0.0452/2 = 0.0226 mol

∴ mass of sodium carbonate ( Na₂CO₃) = no of moles of Na₂CO₃ × molar mass of Na₂CO₃

=  0.0226 × 106 ≈ 2.397 g

no of moles of hydrogen carbonate = 0.0452/2 = 0.0226 mol

mass of the hydrogen carbonate ( H₂CO₃) = no of moles of H₂CO₃ × molar mass of H₂CO₃

= 0.0226 × 62 g = 1.401 g

mass of one of the products was measured to be 2.36 g , from above data, we can say it must be sodium carbonate because value is the nearest of 2.397 g.

percentage yield = experimental yield/theoretical yield × 100

here experimental yield of Na₂CO₃ = 2.36 g

and theoretical yield of Na₂CO₃ = 2.397 g

% yield = 2.36/2.397 × 100 ≈ 98.456%

Therefore the percentage yield of the product is 98.456%

To learn more about percentage yield visit:

https://brainly.com/question/22257659

#SPJ4

THEIR ANSWER IS RIGTH, ALL THREE PARTS

Theoretical yeild is 2.397, sodium bicarbonate is the possible product I chose, and percent yeild is 98.456

What mass of silver can be plated onto an object in 33. 5 minutes at 8. 70 a of current? ag (aq) e- → ag(s) 19. 6 g 9. 78 g 0. 326 g 3. 07 g 0. 102 g

Answers

Mass of silver can be plated onto an object in 33. 5 minutes at 8. 70 a of current is 19.55 g

Given, I=8.70A, t=33.5min=33.5*60=2010 sec, m of Ag = 19600g M=107.87 g/mol

From  faradays law we can write q=I*t= 8.70*2010=17487 C.

moles of Ag =17487/ 19600=0.1812 moles

Ag deposited = 0.1812*107.87 = 19.55 g

Silver

Having the atomic number 47 and the Latin word argentum, which means "bright" or "white," silver is a chemical element. Its symbol is Ag. The highest electrical, thermal, and reflectivity of any metal are displayed by this transition metal, which is soft, white, and lustrous. The metal can be found in the Earth's crust in three different forms: as an alloy with other metals like gold and in minerals like argentite and chlorargyrite. It can also be found in its pure, free elemental form, also known as "native silver." During the refining of copper, gold, lead, and zinc, the majority of silver is created as a byproduct. As a valuable metal, silver has long been treasured.

What mass of silver can be plated onto an object in 33. 5 minutes at 8. 70 a of current? ag (aq) e- → ag(s) 19. 6 g 9. 78 g 0. 326 g 3. 07 g 0. 102 g

Learn more about Silver here:

https://brainly.com/question/14587716

#SPJ4

What is regular (specular)
reflection?
A. when all light rays come in at different angles of
incidence
B. when the rays of light reflect at different angles
C. when all light rays reflect at the same angle
D. when all light rays are perpendicular

Answers

Answer:

specular reflection reflects all light which arrives from a given direction at the same angles where diffus reflection reflects light in a broad range of direction

3. 2.71x1022 molecules of CO2 to atoms I NEED HELP

Answers

2.71 x 10²² molecules of CO2 is equivalent to 2.71 x 10²² atoms.

What is number of molecules?

The number of molecules in an element is the combination of atoms in that element.

The number of molecules of an element can be calculated by multiplying the number of moles of that element by Avogadro's number, which is 6.02 × 10²³.

However, the number of molecules in a substance is equivalent to the number of atoms in that substance.

Therefore, 2.71 x 10²² molecules of CO2 is equivalent to 2.71 x 10²² atoms.

Learn more about number of atoms at: https://brainly.com/question/14190064

#SPJ1

What process permanently rearranges the basic structure of curly hair into a straight or smoother form?

Answers

Chemical hair relaxing is the process that permanently rearranges the basic structure of curly hair into a straight or smoother form.

Chemical relaxers disrupt disulfide bonds by using chemicals and extremely high heat.

The procedure of permanently altering the fundamental structure of excessively curly hair into a straight shape is known as chemical hair relaxing.

Professionally performed, it leaves the hair straight and in good enough condition to be styled into practically any shape.

Sodium hydroxide, which does not require pre-shampooing, and ammonium thioglycolate, which may require pre-shampooing, are the two main categories of hair relaxers.

Processing, neutralizing, and conditioning are the three fundamental phases in all chemical hair relaxing procedures.

Hence, Chemical hair relaxing is the process that permanently rearranges the basic structure of curly hair into a straight or smoother form.

Learn more about chemical hair relaxing here https://brainly.com/question/5142460

#SPJ4

What volume will 5.6 moles of sulfur hexafluoride
(SF6) gas occupy if the temperature and pressure of
the gas are 128°℃ and 9.4 atm?

Answers

Answer:

19.6 L SF₆

Explanation:

To find the volume, you need to use the Ideal Gas Law:

PV = nRT

In this equation,

-----> P = pressure (atm)

-----> V = volume (L)

-----> n = moles

-----> R = Ideal Gas constant (0.08206 atm*L/mol*K)

-----> T = temperature (K)

After converting the temperature from Celsius to Kelvin, you can plug the given values into the equation and simplify to find "V".

P = 9.4 atm                               R = 0.08206 atm*L/mol*K

V = ? L                                      T = 128 °C + 273.15 = 401.15 K

n = 5.6 moles

PV = nRT

(9.4 atm)V = (5.6 moles)(0.08206 atm*L/mol*K)(401.15 K)

(9.4 atm)V = 184.3429

V = 19.6 L

If the a of a monoprotic weak acid is 2. 6×10−6, what is the ph of a 0. 33 m solution of this acid?

Answers

The pH of the monoprotic weak acid is 2.79.

What are weak acids?

The weak acids are the acids that do not fully dissociate into ions in the solution. Strong acids fully dissociate into ions.

The chemical reaction is HA(aq) ⇄ A⁻(aq) + H⁺(aq).

c (monoprotic acid) = 0.33 M.

Ka = 1.2·10⁻⁶

[A⁻] = [H⁺] = x

[HA] = 0.33 M - x

Ka = [A⁻]·[H⁺] / [HA]

2. 6 × 10⁻⁶ = x² / (0.33 M - x)

Solve quadratic equation: [H⁺] = 0.000524 M.

pH = -log[H⁺]

pH = -log(0.000524 M)

pH = 2.79

Thus,  the pH of the monoprotic weak acid is 2.79

To learn more about weak acids, refer to the below link:

https://brainly.com/question/13032224

#SPJ4

Potassium permanganate is a strong oxidizer that reacts explosively with easily oxidized materials. What is its formula?

Answers

Answer: KMnO4 (subscript 4)

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

Answers

The products formed when ester is treated with lithium hydroxide and water is given below.

[tex]CH_{3} CH_{2} CH(CH_{3} )OC=OCH(CH_{3} )_{2} +LiOH +H_{2} O[/tex]→[tex]CH_{3} CH_{2} CH(CH_{3} )OH+LiOC=OCH(CH_{3} )_{2} +H_{2} O[/tex]

The products formed when ester is treated with lithium hydroxide and water is alcohol and salt of acid.

The reaction of ester with water in the presence of base is called hydrolysis of ester in the presence of base. The product of hydrolysis  of of ester in the presence of base ( lithium hydroxide ) is alcohol and salt of acid.

The hydrolysis of ester is also takes place in the presence of acid and give the product of alcohol and carboxylic acid. Lithium hydroxide is an inorganic base and it is soluble in water and slightly soluble in ethanol. The  Lithium hydroxide is less soluble in water as compare to sodium hydroxide due to the anomalous behavior shown by lithium from rest of the family member.

to learn more about ester please click here.

https://brainly.com/question/10840252

#SPJ4

Calculate the number of atoms in a 5.31 x 10³ g sample of sodium.

number of atoms:

Answers

Answer:

        no of atoms =   13.9 x 10^25

Explanation:

                No. of moles = mass of compound / molar mass of   compound

   

       As ; mass of sodium = 5.3 x 10^3 g

       

        Molar mass of sodium = 22.9 g/ mol

         

        putting values  

         

         n = 5.3 x 10^3 / 22.9

       

         n = 231.4 mol

Also; no of mol (n) = no of particles / Avagadros number

               so no of particles = n x Avagadros no.

     

               put n = 231.4 and Avagadros no = 6.023 x 10^23

 

                 no of particles = 231.4 x 6.023 x 10^23

                                   =   13.9 x 10^25  

       

             

The reaction of hydrogen bromide(g) with chlorine(g) to form hydrogen chloride(g) and bromine(g) proceeds as follows:
2HBr(g) + Cl2(g) -->2HCl(g) + Br2(g)
When 23.5 g HBr(g) reacts with sufficient Cl2(g), 11.8 kJ is evolved.

Calculate the value of △,H for the chemical equation given.

Answers

Answer:
The enthalpy of reaction per mole of HBr for this
reaction = ArH =-40.62 kJ/mole.
Explanation:
2HBr(g) + C12(g) > 2HC|(g) + Br2 (g)
When 23.9 g HBr(g) reacts with sufficient C12(g),
12.0 kJ of heat is evolved, calculate the value of
Ar for the chemical reaction.
Note that ArH is the enthalpy per mole for the
reaction.
Molar mass of HBr (g) = 80.91 g/mol.
Hence, 1 mole of HBr = 80.91 g
23.9 g of HBr led to the reaction giving off 12.0
kJ of heat
80.91 g of HBr will lead to the evolution of (80.91
× 12/23.9) = 40.62 kJ heat is given off.
Hence, 40.62 kJ of heat is given off per 80.91 g
of HBr.
This directly translates to that 40.62 kJ of heat is
given off per 1 mole of HBr
Hence, the heat given off per mole of HBr for
this reaction is 40.62 kJ/mole.
But since the reaction liberates heat, it means
the reaction is exothermic and the enthalpy
change for the reaction (AHrxn) is negative.

-40.62

Is this equation balanced and in the lowest form? 4NH3 → 2N2 + 6H2

A.
Yes, because there are equal amounts of atoms of each element on both sides.
B.
No, because the coefficients could be reduced to 2,1, and 3.
C.
Yes, because the coefficients are in their lowest whole number ratio.
D.
No, because the coefficients could be reduced to 2, 2, and 4.

Answers

Answer:

B.) No, because the coefficients could be reduced to 2,1, and 3.

Explanation:

The equation is not in its lowest molar ratio form. In this case, all of the coefficients can be divided by 2 and still result in whole numbers.

As such, the correct balanced equation is:

2 NH₃ ----> N₂ + 3 H₂

1.50 moles of N2 at 825 mmhg and 303 K are contained in a 34.3 L bottle. What is the pressure of the system if an additional 1.00 mole of gas is added to the bottle and the temperature is reduced to 273 K?

Answers

Answer:

1240 mmHg

Explanation:

Since volume is being held constant, we can use the following variation of the Ideal Gas Law to find the new pressure.

[tex]\frac{P_1}{T_1N_1}=\frac{P_2}{T_2N_2}[/tex]

In the equation, "P₁", "T₁", and "N₁" represent the initial pressure, temperature, and moles. "P₂", "T₂", and "N₂" represent the final pressure, temperature, and moles. Your answer should have 3 sig figs to match the sig figs of the given values.

P₁ = 825 mmHg                            P₂ = ? mmHg

T₁ = 303 K                                     T₂ = 273 K

N₁ = 1.50 moles                             N₂ = 1.50 + 1.00 = 2.50 moles

[tex]\frac{P_1}{T_1N_1}=\frac{P_2}{T_2N_2}[/tex]                                                     <----- Formula

[tex]\frac{825 mmHg}{(303K)(1.50 moles)}=\frac{P_2}{(273 K)(2.50 moles)}[/tex]                   <----- Insert values

[tex]\frac{825 mmHg}{454.5}=\frac{P_2}{682.5}[/tex]                                               <----- Simplify denominators

[tex]1.815=\frac{P_2}{682.5}[/tex]                                                     <----- Simplify left side

[tex]1238.86 mmHg={P_2}[/tex]                                          <----- Multiply both sides by 682.5

[tex]1240 mmHg={P_2}[/tex]                                              <----- Apply sig figs

Answer:1240

Explanation:

What is the daughter nucleus produced when zn63 undergoes electron capture? replace each question mark with the appropriate integer or symbol

Answers

The daughter nucleus that is produced is ₂₉⁶³cu.

What is Electron capture?

The process of drawing an electron to the nucleus, where it combines with a proton to create a neutron and a neutrino particle, is known as electron capture.

The daughter nucleus is the nucleus that is made by the parent nucleus. The nucleus that remains after the decay is called the daughter nucleus.

Here is the chemical formula for the reaction that results in the electron capture of the zinc-63 nucleus:

[tex]_A^ZX + e^- = _A^Z_-_1 Y + ye[/tex]

[tex]_3_0^6^3Zn\; + e^- = _2_9^6^3Cu + ye[/tex]

Thus, the daughter nucleus produced when zn63 undergoes electron capture is [tex]_2_9^6^3Cu[/tex].

To learn more about Electron capture, refer to the below link:

https://brainly.com/question/10964824

#SPJ4

340. ml of a 0. 150 m solution of nh3(aq) is titrated with 0. 100 m hcl. calculate the ph of the solution after 350. ml of hcl has been added. (ka(nh4 ) = 5. 6 x 10-10)

Answers

340. ml of a 0. 150 m solution of nh3(aq) is titrated with 0. 100 m hcl.  the ph will be 7 of the solution after 350. ml of hcl has been added. (ka(nh4 ) = 5. 6 x 10-10).

What is ph?

The ph. of a solution gives information about the concentration of hydrogen ion in the solution or the solution is acidic or basic in nature if the given value is 7 then the solution is neutral or greater then 7 then basic and less then 7 then acidic.

Here, NH3 is a base while adding HCl to it the reaction gets neutralized and known as  neutralizatio reaction and attend the ph. of value 7.

After due to the formation of hydronium ion the ph. would be less then 7.

Therefore, the ph. is 7.

Learn more about ph , here:

https://brainly.com/question/14253666

#SPJ4

For the reaction ag2s(s) ⇌ 2ag (aq) + s2−(aq). What happens to the equilibrium position if the amount of silver ion is halved?

Answers

The equilibrium shifts to the right.

What is Equilibrium law?According to this law, if a process in equilibrium is subjected to change in the factors that affect equilibrium, then the equilibrium shifts in a specific direction which tends to counteract the effect of change imposed.The common ion effect is a result of this lawFactors affecting equilibrium areChange in concentration of reactants or productChange in temperatureChange in pressureAdding an inert gas

According to this law,

The concentration of the product is decreased and hence, the equilibrium shifts to the right.

Learn more about Equilibrium law:

https://brainly.com/question/19340344

#SPJ4

Other Questions
Five hats and three shirts cost $176. Three hats and five shirts cost $208. What is the cost of one hat? The cost of one hat is __ dollars. The slope of the line shown in the graph is __ and the y-intercept of the line __ find the zeros of the following please solve step by step1. x+x-4x-4=02. 2x-11x+17x-6=0 If a shift in the price of mayonnaise results in a rise in the consumption of miracle whip, then:_____. Suppose a bicyclist rides at a constant velocity of 4.4 m/s up a 10 slope. the total mass of bicycle and rider is 85 kg. neglecting air friction, what is his power output? Please help, How could you tell a Ca(NO3)2 solution from a Zn(NO3)2 solution? A girl get n cedis pocket money money each week. she saves her money for five weeks and buys a present for her mother which cost gh 7900 i. write an expression for the amount of the money left ii.what is the minimum amount she needs to save each week to be able to afford the gift (04.02 lc) read and choose the option with the regular verb in the imperfect tense. What will happen to the urine volume if adh is not added to the collecting duct?. So US GovernmentPlease help Hiroshima, Japan was selected for what main reasons? It was a completely military target. It had already been heavily bombed so civilian casualties would be low. As an ancient capital of Japan it had high symbolic value. It was important for the Japanese military for communication and supplies. The data a firm can leverage is a true strategic asset when it is valuable, rare, imperfectly imitable, and non-substitutable.a) true b) false The hearing assessment tasks used on a person with a hearing loss can include presentation of:__________. Pls what phylum does bacteria belong in. Please help ASAP will mark the brainliest In the embryonic stage, the brain begins to undergo rapid development, which causes the head to represent about __________ of the total length of the embryo. The electric potential at the origin of an xy-coordinate system is 40 v. a -8.0-c charge is brought from x = [infinity] to that point. what is the electric potential energy of this charge at the origin? For a fundraiser, 1000 raffle tickets are sold, and the winner is chosen at random. There is only one prize, $500 in cash. You buy one ticket. What is the probability you will win the prize of $500 At the Teheran Conference, Roosevelt and Churchill agreed to open up a second front to the war by invading which of the following countries: A) Italy B) Japan C) Africa D) France The black graph is the graph of y =f(x). Choose the equation for the red graph. A. y - 1 = f() B. y + 1 = f() C. = f(x - 1) D. f(x) How should the nozzle tip of an air-polishing device be positioned for anterior teeth?