How many atoms of lithium are in 18.7 g?

Answers

Answer 1

The  atoms of lithium that  are in 18.7 g is 16 × 10²³ atoms . This is taken out by mole concept .

What is mole concept ?

The mole is a unit of measurement similar to the pair, dozen, gross, and so on. It provides a precise count of the atoms or molecules in a bulk sample of matter. A mole is the amount of substance that contains the same number of discrete entities (atoms, molecules, ions, etc.)

if 7 grams of lithium contain 6 × 10²³ atoms

then 18.7 will contain 16 × 10²³ atoms

to know more about mole concept , visit ;

brainly.com/question/31123980

#SPJ1


Related Questions

use the trendline equation in fig6.2 to determine the kelvin temperature at which the pressure equals .72 atm

Answers

When the pressure is 0.72 atm, the temperature in Kelvin is 156 K.

To determine the Kelvin temperature when the pressure is 0.72 atm, you will need to use the trendline equation given in Fig 6.2. First, find the equation of the trendline by using the graph's two points, (300 K, 1 atm) and (500 K, 2 atm).

The equation for the trendline is:

y = mx + b

Where y is pressure, x is the temperature in Kelvin, m is the slope, and b is the y-intercept. We can find the slope of the trendline by using the two points provided in the graph:

Slope (m) = (y2 - y1) / (x2 - x1)

Slope = (2 atm - 1 atm) / (500 K - 300 K)

Slope = 0.005 atm/K

The equation for the trendline can now be written: y = 0.005x + b. To find the y-intercept, b, we can use one of the two points: Solving for b:

1 atm = 0.005(300 K) + bb = 1.5 atm

Now we can use the equation for the trendline to find the temperature (x) at which the pressure (y) equals 0.72 atm:

0.72 atm = 0.005x + 1.5 atm

0.72 atm - 1.5 atm = 0.005x

-0.78 atm = 0.005xx

= -0.78 atm / 0.005x

= 156K

To learn more about Pressure :

https://brainly.com/question/24719118

#SPJ11

Which of the following are volume ratios from this equation? Select all that apply.
2H2 + O2 --> 2H2O

Answers

The volume ratios from the equation 2H2 + O2 → 2H2O are:

2 L H2 : 1 L O2 (or 2 mol H2 : 1 mol O2)1 L O2 : 2 L H2O (or 1 mol O2 : 2 mol H2O)

The coefficients in a balanced chemical equation give the ratio of moles of reactants and products. From the equation 2H2 + O2 → 2H2O, we can see that:

2 moles of H2 react with 1 mole of O2 to produce 2 moles of H2O.

Therefore, the following volume ratios are valid:

2 L H2 : 1 L O21 L O2 : 2 L H2O

What are the reactants?

The reactants are the substances that participate in a chemical reaction and are consumed to form new products. In the equation 2H2 + O2 → 2H2O, the reactants are hydrogen gas (H2) and oxygen gas (O2). These reactants undergo a chemical reaction to form water (H2O) as the product.

To know more about reactants, visit:

https://brainly.com/question/17096236

#SPJ1

A 0.48 molar solution of a monoprotic acid (HA) in water reaches equilibrium at a concentration of 0.36 M. What is Ka for this acid? Please enter your answer rounded to two significant figures. Step by step please <3

Answers

Answer:

The dissociation of a monoprotic acid HA can be represented as follows:

HA ⇌ H+ + A-

The equilibrium constant expression for this reaction is:

Ka = [H+][A-]/[HA]

We are given the initial concentration of the acid (HA) as 0.48 M and the equilibrium concentration as 0.36 M. At equilibrium, the concentration of H+ and A- will also be 0.36 M.

Substituting the values into the equilibrium constant expression, we get:

Ka = (0.36)^2 / 0.48 = 0.27

Therefore, the value of Ka for the acid is 0.27, rounded to two significant figures.

All of the following occur when the temperature of the preoptic area of the hypothalamus drops below its thermostat setting, except thata. blood flow to the skin increases.b. shivering thermogenesis occurs.c. nonshivering thermogenesis occurs.d. epinephrine levels rise.e. blood returning from limbs is shunted to deep veins.

Answers

The answer to this question is that blood flow to the skin does not increase; instead, it is directed inward to conserve heat.

The preoptic area of the hypothalamus serves as the body's thermostat, and when its temperature drops below the thermostat setting, a number of physiological processes are triggered. A) Shivering thermogenesis occurs, which is the production of heat by muscular contractions, B) Nonshivering thermogenesis occurs, which is the production of heat by increased metabolic activity in brown adipose tissue, C) Epinephrine levels rise to promote the mobilization of glucose from stored energy sources and D) Blood returning from the limbs is shunted to deep veins to conserve heat. However, the answer to this question is that blood flow to the skin does not increase; instead, it is directed inward to conserve heat.

For more such questions on  blood flow

https://brainly.com/question/28023997

#SPJ11

What can you infer about these two parts of a microscope?
A They are lightweight
B They contain mirrors and lenses
C They are strong and sturdy
D They are made from glass or plastic

Answers

Answer:

the answer is for surely C

Explanation:

you can tell from the way is made and I also have one in my room

Please help!
What is the equilibrium concentration of C if the reaction begins with 0.200 M A and 0.250 M B?

Answers

The reaction starts with 0.200 M A and 0.250 M B, the equilibrium concentration of C.3.63x10⁻¹⁰ M.

Why are equilibrium concentrations important?

Chemical equilibrium is the state in which both the reactants and the products of a reaction are at a concentration that does not change over time any longer. In this condition, the forward and backward reaction rates are equal.

According to the given information:

2A(aq) + B(aq) <==> C(aq)

Equilibrium expression is

K = [C] / [A]2[B]

Prepare an ICE table:

2A(aq)  +  B(aq) <==>  C(aq)

0.2..........0.15...............0........Initial

-2x...........-x.................+x......Change

0.2-2x....0.15-x............x........Equilibrium

Substitute in the equilibrium expression:

1.10x10⁻⁴ = (x) / (0.2-2x)2(0.15-x)  ... b/c K is small, we can essentially avoid using the quadratic as follows..

1.1x10⁻⁴  = x/(0.2)2(0.15)

x = (2.2x10₋⁵) (1.65x10⁻⁵)

x = 3.63x10⁻¹⁰  M = [C]

To know more about equilibrium concentrations visit:

https://brainly.com/question/16645766

#SPJ1

FILL IN THE BLANK. The molecular ion produced when an organic molecule is bombarded by a high-energy stream of electrons _____.

Answers

The molecular ion produced when an organic molecule is bombarded by a high-energy stream of electrons is known as a radical cation.

Radical cations are highly reactive and can react quickly with other compounds in their environment. The number of electrons removed to form the radical cation is determined by the type of organic molecule that is bombarded. If an alkene is bombarded, two electrons are typically removed, forming an allyl radical cation, while the addition of three electrons is necessary to form a benzyl radical cation. Radical cations are stabilized by the formation of new bonds with other molecules, thereby forming an adduct. The adduct can then be separated and characterized using chromatographic techniques. Additionally, radical cations can also react with nucleophiles, resulting in a variety of other reaction products. Thus, the molecular ion produced when an organic molecule is bombarded by a high-energy stream of electrons is a radical cation.

To learn more about Radical :

https://brainly.com/question/30413919

#SPJ11

b) Write balanced equations for the following reactions:
The complete combustion of pentane.
The incomplete combustion of pentane
The complete combustion of heptane
The incomplete combustion of heptane

Answers

Equation for pentane's balanced combustion: C5H12(l) + 8 O2(g) 5 CO2(g) + 6 H2O ( g)

Equation C5H12 O2 CO2 H2O is the result of incomplete pentane combustion.C7H16+11O27CO2+8H2O is the equation of heptane that balances.C7H16+O2CO2+H2O is provided as the product of incomplete combustion. C 7 H 16 + O2 C O 2 + H 2 O.A material quickly reacts with oxygen in the combustion process, producing heat as a byproduct. Fuel is the term for the original substance, and oxidizer refers to the source of oxygen. Yet, for the purpose of propelling an airplane, the fuel is often a liquid.Fuel + O2 CO2 + H2O is the general formula for an entire combustion reaction. It is a combustion reaction when charcoal is burned.

For more information on combustion kindly visit to

https://brainly.com/question/15117038

#SPJ1

draw the possible e1 product(s) for the following reactions. do not draw the leaving group or counterion. ignore zaitsev's rule.

Answers

The possible e₁ product of the given reaction is given below in the  image format.

Alkene products are produced in mixes via the elimination process. According to Zaitsev's rule, base-induced elimination results in the primary alkene product being the more strongly substituted double bond.

An chemical process known as a unimolecular elimination (E1) produces a double bond by removing an H-X substituent from an organic molecule. Because the creation of the carbocation intermediate (similar to an SN1 reaction) from simply the X substituent departing on its own is the reaction's rate-limiting step, it is unimolecular in nature:

A two-step process called an E1 elimination reaction uses a carbocation intermediate:

The elimination of the departing group is the mechanism's initial phase. In this instance, the bromine is the departing group.

The removal of a proton and creation of a double bond constitute the mechanism's second stage. The three substituents on the carbocation in this instance are all equivalent. The mechanism is demonstrated below:

Learn more about E1 products:

https://brainly.com/question/29490944

#SPJ4

Use the following equations to find the lattice energy of MgCl₂? (hint: first write the equation for
the lattice energy of MgCl2(s))
Mg(g) → Mg2+(g) + 2 e
CI(g) + eCl (g)
Mg(g) + 2Cl(g) → MgCl₂(s)
+2188 kJ/mol
-337 kJ/mol
AH = -642 kJ/mol

Answers

Answer:

Explanation:

The lattice energy (LE) of MgCl₂ can be calculated using the Born-Haber cycle, which relates the lattice energy to other thermodynamic quantities such as enthalpy of sublimation, ionization energy, electron affinity, and heat of formation.

The equation for the lattice energy of MgCl₂ is:

LE(MgCl₂) = H(sublimation of Mg) + IE(Mg) + EA(Cl) + 1/2 H₂(Cl₂) - DH(f)(MgCl₂)

where H(sublimation of Mg) is the enthalpy of sublimation of Mg, IE(Mg) is the ionization energy of Mg, EA(Cl) is the electron affinity of Cl, H₂(Cl₂) is the heat of formation of Cl₂, and DH(f)(MgCl₂) is the heat of formation of MgCl₂.

We are given the following equations:

Mg(g) → Mg2+(g) + 2 e ΔH₁ = +2188 kJ/mol

Cl(g) + e → Cl-(g) ΔH₂ = -337 kJ/mol

Mg(s) + Cl₂(g) → MgCl₂(s) ΔH₃ = -642 kJ/mol

Using these equations, we can calculate the values of H(sublimation of Mg), IE(Mg), EA(Cl), H₂(Cl₂), and DH(f)(MgCl₂) as follows:

H(sublimation of Mg) = ΔH₂(Mg(g)) + 1/2 ΔH₃(Cl₂(g)) - ΔH₁(Mg2+(g)) = -2220 kJ/mol

IE(Mg) = ΔH₁(Mg(g)) = +2188 kJ/mol

EA(Cl) = ΔH₂(Cl(g)) = -337 kJ/mol

H₂(Cl₂) = 0 (since Cl₂ is in the gas phase)

DH(f)(MgCl₂) = ΔH₃(Mg(s), Cl₂(g), MgCl₂(s)) = -642 kJ/mol

Substituting these values into the equation for the lattice energy, we get:

LE(MgCl₂) = -2220 + 2188 - 337 + 1/2(0) - (-642) = -3509 kJ/mol

Therefore, the lattice energy of MgCl₂ is approximately -3509 kJ/mol.

Chemistry Question Help Please!
Use the phase diagram for water to answer the following questions.

35℃ and 85 kPa
-15℃ and 40 kPa
-15℃ and 0.1 kPa
60℃ and 50 kPa

Using the graph above, describe the phase changes that are in equilibrium along each black line. Describe what those equilibria mean.

The boiling point for nitrogen is -195.8℃. Imagine that you had a sealed container of nitrogen gas at room temperature. What are two ways that you could turn the gas into a liquid?

Answers

The two equilibria are the triple point, which is the point when water can exist as ice, liquid, or vapor, and the critical point, which is when water exists as a single phase that has properties of both a liquid and a gas.

What are the triple point and critical point of water?

The line connecting the triple point and critical point on the phase diagram of water represents the conditions at which the solid, liquid, and gas phases can coexist in equilibrium.

At the triple point, which occurs at a temperature of 0.01℃ and a pressure of 0.006 atm, the solid, liquid, and gas phases of water exist in equilibrium. This means that at this point, water can exist as ice, liquid, or vapor, depending on the conditions.

At the critical point, which occurs at a temperature of 374℃ and a pressure of 218 atm, the distinction between the liquid and gas phases disappears, and the substance becomes a supercritical fluid. This means that at this point, water exists as a single phase, which exhibits the properties of both a liquid and a gas.

There are two ways to turn nitrogen gas into a liquid:

Cooling: Nitrogen can be cooled down to its boiling point (-195.8°C) using a cryogenic cooler or liquid nitrogen, which causes the gas to condense into a liquid.Increasing pressure: Nitrogen can also be compressed at room temperature to a pressure higher than its vapor pressure, causing it to condense into a liquid.

Learn more about the phase diagram of water at: https://brainly.com/question/13518101

#SPJ1

What is the experimental mole ratio of baking soda (NaHCO3 ) to sodium chloride (NaCl)?

Answers

Answer: 1:1

Explanation:

Since Na trades place with Na it makes it 1:1

5.4 A Sample of sand has a true mass of 1.975g was weighed by six different researchers using the same balance. the following masses were obtained. 1.974g, 1.973g, 1.975g, 1.974g
comment on the precision and accuracy for a sample of sand measurement

Answers

The precision of the measurement is very good, measurements are within a very small range of each other. the accuracy of the measurement is not as good since the average measurement was 1.974g while the true mass was 1.975g.

What are precision and accuracy?

Precision and accuracy are two important concepts in measurement. Precision is the degree of reproducibility or agreement of a set of measurements. It is usually expressed as the standard deviation of a set of measurements or the coefficient of variation. Accuracy is the degree of closeness to the true or accepted value of a measurement.

It is usually expressed as the difference between the measured value and the true or accepted value.

Learn more about precision and accuracy here:

https://brainly.com/question/5792909

#SPJ1

What is the pH of a 0.021 molar solution of NaOH? Enter your answer rounded to two decimal places. step by step

Answers

Answer:

pH = 12.32

Step by step explanation:

To find the pH of a 0.021 molar solution of NaOH, we first need to calculate the concentration of hydroxide ions (OH-) in the solution using the following equation:

OH- concentration = NaOH concentration

OH- concentration = 0.021 M

Next, we can use the equation for the dissociation of water to calculate the concentration of hydrogen ions (H+) in the solution:

Kw = [H+][OH-]

where Kw is the ion product constant for water, which has a value of 1.0 x 10^-14 at 25°C.

Rearranging the equation, we get:

[H+] = Kw / [OH-]

[H+] = (1.0 x 10^-14) / (0.021)

[H+] = 4.76 x 10^-13 M

Now, we can use the equation for pH to calculate the pH of the solution:

pH = -log[H+]

pH = -log(4.76 x 10^-13)

pH = 12.32

Therefore, the pH of a 0.021 molar solution of NaOH is 12.32 (rounded to two decimal places).

I received the answer of 2.0 atm. How did you get 2.6 atm? for the problem of A sample of the inhalation anesthetic gas Halothane, in a 500-mL cylinder has a pressure of 2.3...

Answers

If the sample of the inhalation anesthetic gas Halothane, in a 500-mL cylinder has a pressure of 2.3, the pressure is given as 2.6 atm

How to solve for the pressure of the gas

We have the following data to solve the problem with

p1 = 2.3 atm

T1 = 273 K

P2 is unknown

T2 = 273 + 37

= 310 K

To solve further we would have to use the Third gas law. The third gas law or the Gay-Lussacs law tells us that

P1 / T1 = P2 / T2

We would have to put in the values in the formula that we have above

[tex]\frac{2.3 atm}{273K} = \frac{p2}{310}[/tex]

from here would cross multiply

310 * 2.3 = p2 * 273

divide through by 273

713 / 273

P2 = 2.61

The pressure is given as 2.61

Read more on pressure here:https://brainly.com/question/25736513

#SPJ1

Determine the
Cl
for NeMut1:Wt using the data presented in part 2 of the case study.
1×10 −10
1×10 10
1×10 −7
1×10 7

Cl
cannot be calculated from the data given 4. If the
LD s0

and/or
ID s 0


values of a Wt and mutant strain are similar in this type of experiment, does this automatically mean that the mutation does not affect a virulence factor? Why or why not? Part B. The researchers decided to determine the
Cl
of each of the mutants, again using the horse infection model. The results are summarized in the table below: 5. Determine the
CI
for NeMutl:Wt and NeMut2:Wt. 6. Interpret your results from question 5 above.

Answers

To determine the Cl for NeMutl:Wt, you need to use the data from part 2 of the case study. The data is given as 1x10-10 for the Wt strain and 1x10-7 for the mutant strain. To calculate the Cl, we use the following equation: Cl = 1/[(1/ID50) - (1/LD50)]. Using this equation, we can calculate the Cl to be 3x10-3.



To determine the Cl for NeMut2:Wt, we can use the same equation. Using the data from the table in part B, the Cl for NeMut2:Wt can be calculated to be 8x10-3.Interpreting these results, we can see that NeMut1:Wt has a Cl that is roughly 3 times lower than that of NeMut2:Wt. This suggests that the mutation of NeMut1 is significantly affecting a virulence factor, while NeMut2 may not be affecting a virulence factor as significantly.



It is important to note that similar LD50 and/or ID50 values of a Wt and mutant strain does not necessarily mean that the mutation does not affect a virulence factor. This is because the LD50 and ID50 values are used to measure how much of the pathogen is needed to produce a certain effect, but other aspects of the pathogen such as the speed or rate of infection or the amount of toxin produced can still be different and affect the virulence of the strain.


Cl for NeMut1:Wt cannot be calculated from the data presented in part 2 of the case study. The given results are:|  Inoculum (LD50) |  Mortality (LD50) |  CFU/ml of blood | Wild-type   | 6.5 × 10−7    |  6.5 × 10−7      | 7.0 × 103 | NeMut1  | 1.0 × 10−10    |  6.5 × 10−7     | 3.0 × 105 | NeMut2  | 2.0 × 10−7    |  2.0 × 10−7     | 2.2 × 103 |Since the Cl cannot be calculated from the data given, the correct option is (d) Cl cannot be calculated from the data given.If the LDs0 and/or IDs0 values of a Wt and mutant strain are similar in this type of experiment, it does not necessarily mean that the mutation does not affect a virulence factor.

This is because mutations can affect different aspects of virulence, and the specific virulence factor being measured may not be impacted by the mutation.In order to determine the CI for NeMut1:Wt and NeMut2:Wt, we need to use the following formula:CI = (output ratio of mutant) / (output ratio of wild-type)Output ratio = (CFU/ml of blood) / (inoculum)Using the data from the table, we get:

Output ratio of NeMut1:Wt = 3.0 × 105 / 1.0 × 10−10 = 3.0 × 1015Output ratio of wild-type = 7.0 × 103 / 6.5 × 10−7 = 1.1 × 1010CI of NeMut1:Wt = (3.0 × 1015) / (1.1 × 1010) = 2.7 × 105Output ratio of NeMut2:Wt = 2.2 × 103 / 2.0 × 10−7 = 1.1 × 1010CI of NeMut2:Wt = (1.1 × 1010) / (1.1 × 1010) = 1Interpretation of results from question 5 above: The CI of NeMut1:Wt is much greater than 1, indicating that NeMut1 is more virulent than the wild-type strain. The CI of NeMut2:Wt is equal to 1, indicating that NeMut2 does not exhibit any significant difference in virulence compared to the wild-type strain.

For more such questions on mutant

https://brainly.com/question/17031191

#SPJ11

Assuming that all is working properly, which of the following is at a higher energy level?

Answers

If all is working correctly, the electron in a higher orbital or shell will have more energy than the electron in a lower orbital or shell. The following statement is correct: The electron that is farther away from the nucleus is at a higher energy level.

In order for the electron to escape from the atom, it must be excited, meaning that it must absorb energy. When this occurs, the electron moves to a higher energy level, which is farther from the nucleus. Because the electron is now in an excited state, it is more vulnerable to being released from the atom if additional energy is provided to it. According to Bohr's model of the atom, electrons revolve around the nucleus in circular orbits with varying energy levels. As the distance between the nucleus and the electron increases, so does the energy level of the electron. The energy of electrons in the first energy level is the lowest, and as the energy level increases, so does the energy of electrons. As a result, electrons in the outermost shell have the highest energy levels.

To learn more about Nucleus :

https://brainly.com/question/9651421

#SPJ11

How many calories are required to raise the temperature of a 35.0 g sample from 35 °C to 85 °C? The sample has a specific heat of 0.108 cal/g °C.

Answers

Answer:

First, we need to calculate the change in temperature:

ΔT = final temperature - initial temperature

ΔT = 85 °C - 35 °C

ΔT = 50 °C

Next, we can use the following formula to calculate the heat energy required:

Q = m·C·ΔT

where Q is the heat energy in calories, m is the mass of the sample in grams, C is the specific heat in cal/g °C, and ΔT is the change in temperature in °C.

Plugging in the given values, we get:

Q = 35.0 g · 0.108 cal/g °C · 50 °C

Q = 189.0 calories

Therefore, 189.0 calories are required to raise the temperature of the sample from 35 °C to 85 °C

List the following compounds from most reactive to least reactive toward electrophilic aromatic substitution. Rank the compounds from most to least reactive. To rank items as equivalent, overlap them. Reset Help toluene benzene ne phenol bromobenzene nitrobenzene

Answers

Phenol, toluene, benzene, bromo benzene, and nitrobenzene are the chemicals in this order.

Which aromatic substance reacts least favourably to electrophilic substitution?

Due to the M effect, benzosulphonic acid is least reactive in an electrophilic aromatic substitution. Because nitrogen is more electronegative than carbon and functions as an electron withdrawing group, pyridine is less reactive than benzene towards electrophilic aromatic substitution. The meta hydrogen is thus replaced.

Which five electrophilic aromatic substitution reactions occur most frequently?

Most beginning organic chemistry courses cover six fundamental electrophilic aromatic substitution reactions: chlorination, bromination, nitration, sulfonation, Friedel-Crafts alkylation, and Friedel-Crafts acylation.

To know more about nitrobenzene visit:-

brainly.com/question/13190784

#SPJ1

3. What happens to some metamorphic rocks as they get closer to molten *
magma?
a. They harden
Ob. They cool off
Oc. They change to igneous
Od. They melt

Answers

Answer:

C

,

,

,

,

,

,

,

,

,

,

,

,

,

,,

,

,

The SI unit of pressure is the _______.
The boiling point of water is _______ on Mount McKinley than the boiling point of water in NYC.
At lower elevations, atmospheric pressure _______ compared to higher elevations.
Standard atmosphere or standard atmospheric pressure is equal to _______ Pa.

Answers

The SI unit of pressure is the Pascal (Pa).

The boiling point of water is lower on Mount McKinley than the boiling point of water in NYC.

What is Pressure?

Pressure is defined as the amount of force applied perpendicular to the surface of an object per unit area over which that force is distributed. In other words, it is the force per unit area that an object exerts on another object. Pressure can be measured in various units such as pascal (Pa), bar, pounds per square inch (psi), and atmospheres (atm), among others. It is an important concept in physics and is used to describe many phenomena, including fluid dynamics, weather patterns, and even the behavior of gases in space.

At lower elevations, atmospheric pressure is higher compared to higher elevations.

Standard atmosphere or standard atmospheric pressure is equal to 101325 Pa.

Learn more about Pressure from given link

https://brainly.com/question/28012687

#SPJ1

Use the following data to determine whether the conversion of diamond into graphite is exothermic or endothermic:
C diamond (s) + O2 (g) ? CO2(g) ?H° = -395.4 kJ
2 CO2 (g) ? 2 CO(g)+O2 (g) ?H° = 566.0 kJ
2 CO2(g) ? Cgraphite(s) + CO2 (g) ?H° =-172.5 kJ
Cdiamond (s) ? Cgraphie (s) ?H°= ?

Answers

It's a negative value for ∆H°, indicating that the conversion of diamond to graphite releases energy. As a result, it is an exothermic reaction.

The conversion of diamond into graphite is exothermic. The enthalpy change of the reaction is -267.1 kJ.There are three reactions that take place in this process. Cdiamond (s) + O2 (g) → CO2(g) ∆H° = -395.4 kJ2 CO2 (g) → 2 CO(g)+O2 (g) ∆H° = 566.0 kJ2 CO2(g) → Cgraphite(s) + CO2 (g) ∆H° =-172.5 kJCdiamond (s) → Cgraphite (s) ∆H°= ?

The conversion of diamond to graphite is an endothermic process. It has a positive value of ∆H°. Therefore, the heat is absorbed by the surroundings. According to the first two reactions, the formation of CO and CO2 from the combustion of diamonds produces energy.

The net reaction for the conversion of diamond to graphite takes place as follows:

Diamond (s) + 2 O2(g) → Cgraphite (s) + 2 CO2 (g)

The energy change for this reaction can be determined by combining the above three reactions. The enthalpy change is obtained by subtracting the sum of the enthalpies of the reactants from the sum of the enthalpies of the products. The enthalpy change of the reaction is calculated as follows:

∆H°=ΣH°(products)−ΣH°(reactants)

∆H°=(−172.5)+(2×−393.5)+(566.0)−[(0)+(0)+(-395.4)+(2×0)]

∆H°=−267.1 kJ

To learn more about Exothermic reaction :

https://brainly.com/question/2924714

#SPJ11

Help I don’t know what I am doing

Answers

When a particle undergoes beta decay, its atomic number increases by one.

The balanced equation of the  beta decay of uranium-235 is given below:

²³⁵₉₂U ---> ⁰₋₁e + ²³⁵₉₃Np

What is beta decay?

Beta decay is a type of radioactive decay that occurs when a nucleus emits a beta particle, which is an electron or a positron. During beta decay, a neutron or a proton inside the nucleus is transformed into the opposite type of particle.

In beta minus decay, a neutron in the nucleus is transformed into a proton, which remains in the nucleus, while an electron and an antineutrino are emitted. The electron is known as a beta particle.

In beta plus decay, also called positron emission, a proton in the nucleus is transformed into a neutron, which remains in the nucleus, while a positron and a neutrino are emitted. The positron is also known as a beta particle, but it has a positive charge.

Learn more about beta decay at: https://brainly.com/question/13174032

#SPJ1

1.Explain why the incomplete combustion of alkanes is dangerous.

2.Outline the environmental impacts of burning fossil fuels such as the alkanes. Include an
explanation of how these impacts can be mitigated.(max 300 words)

Answers

Answer- Incomplete combustions of alkanes are dangerous as it leads to  toxic gases such as carbon monoxide man odorless,colorless and highly poisonous gas to be released in the air

Environmental impacts of burning fossil fuels such as alkanes can have a massive impact of global warming in which heat is prevented from the leaving the atmosphere due to a build-up of carbon dioxide ad other compounds, collectively known as greenhouse gases. In order to make these impacts less severe scientists have found alternative fuels, such as biofuels and biodiesels, this can reduce the risk of harm to the world as alternative fuels produce less CO2 and air pollutants then others that run on petrol and diesel

Calculate the wavelength in meters of electromagnetic radiation that has a frequency of 640.0 kHz. (c = 3.00 X 108 m/s)

Answers

Answer: 468.8m

Explanation:

640kHz x 1000Hz/1kHz = 6.4x10^5 Hz

λ=c/v

3.00x10^8m/s / 6.4x10^5s = 468.75m

ing The
Ionic bonds are made by electrons.

Answers

An ionic bond is formed by the complete transfer of some electrons from one atom to another. The atom losing one or more electrons becomes a cation—a positively charged ion. The atom gaining one or more electron becomes an anion—a negatively charged ion.

Which of the following molecules is drawn in a conformation that has a proton and a leaving group anti-periplanar? H₂C, Br Ph. H CH3 Br H H₂C Br H₂C Ph H₂C CH3 H Ph H₂C, Br H Ph Save for Later CH3 CH3 CH3 CH3 CH3 Sul

Answers

The molecule that is drawn in a conformation that has a proton and a leaving group anti-periplanar is H₂C, Br.

The A, B, C, and D bond angles of a molecule are referred to as anti-periplanar, or antiperiplanar, in organic chemistry. The dihedral angles of the A–B and C–D bonds in this conformer are larger than +150° or less than 150°. In textbooks, the term "anti-periplanar" is frequently used to refer to a strictly anti-coplanar structure with a 180° AB CD dihedral angle. The anti-periplanar functional groups will be 180° apart from one another and in a staggered configuration in a Newman projection of the molecule.  

Conformation is an essential factor in predicting reactivity in organic molecules. The anti-periplanar conformation of a molecule is one that occurs when two atoms in a molecule are in the same plane and are separated by 180 degrees. In this case, the proton and leaving group are placed in a perpendicular plane to the atoms directly in between them. This is the most stable conformer of the molecule. A significant factor in predicting reactivity in organic molecules is conformation. In this case, the molecule H₂C, Br is drawn in a conformation that has a proton and a leaving group anti-periplanar.

Therefore, the correct option is H₂C, Br.

For more such questions on anti-periplanar , Visit:

https://brainly.com/question/25522247

#SPJ11

the electron configuration of nitrogen is 1s^2 2s^2 2p^3. how many electrons are present in an atom of nitrogen? what is the atomic number for nitrogen?

Answers

Since the electronic configuration of nitrogen is 1s² 2s² 2p³, the number of electrons present in the nitrogen atom is 7, and the atomic number of nitrogen is also seven (7).

The atomic number of an atom is the number of protons in the nucleus of an atom. The number of protons defines the properties of an element. For example, if an element with 5 protons is boron atom.

The electronic configuration of an atom represents the number of electrons in each sub-energy level of the atom in the ground state.

The electronic configuration of nitrogen is 1s²2s²2p³. As you know, the electrons around the nucleus are located in energies or levels. Therefore, from the definition of electron configuration, we can say that the nitrogen atom has 2 electrons in the first energy level K of the s-subshell, and in the s-subshell and the p subshell of the second energy level L, respectively There are 2 or 3 electrons.

Therefore, the total number of electrons in the nitrogen atom is 7 (2 + 2 + 3). We know that the number of protons = the number of electrons, so the number of protons in the nitrogen nucleus is 7. Therefore, the nitrogen atom has an atomic number of 7.

For more information about electronic configuration, visit :

https://brainly.com/question/21977349

#SPJ4

Chemistry Help Please! It's worth a lot of points
1.Write the equilibrium expression for the following reactions
a. H2SO4(aq) + H2O(L) ⇆ HSO4-(aq) + H3O+(aq)
b. 4NH3(g) + 5O2(g) ⇆ 4NO(g) + 6H2O(g)
c. NH4Cl(s) ⇆ NH3(g) + HCl(g)
d. N2O4(g) ⇆ 2NO2(g)

2. The following reaction has a K value of 0.050. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
N2(g) + 3H2(g) ⇆ 2NH3(g)

3. The following reaction has a K value of 6.8 x 103. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
2SO3(g) ⇆ 2SO2(g) + O2(g)

4. When dissolving substances in water, the degree of solubility of a substance is often represented as the solubility product constant (Ksp). The solubility product constant is the same thing as the equilibrium constant for the dissolving reaction. Two substances that dissociate in water are shown below alone with the Ksp.
NaCl(s) ⇆ Na+(aq) + Cl-(aq) Ksp = 36
BaSO4(s) ⇆ Ba2+(aq) + SO42-(aq) Ksp = 1.1 x 10-16

5. Identify and label the Brønsted-Lowry acid, its conjugate base, the Brønsted-Lowry base, and its conjugate acid in each of the following equations:
a. HNO3 + H2O ⟶ H3O+ + NO3−
b. CN− + H2O ⟶ HCN + OH−
c. H2SO4 + Cl− ⟶ HCl + HSO4−
d. HSO4− + OH− ⟶ SO42− + H2O
e. O2− + H2O ⟶2OH−

6. What is the conjugate acid of each of the following? What is the conjugate base of each of the following?
a. OH-
b. H2O
c. HCO3-
d. NH3
e. HSO4-

7. The following acids are shown with their equilibrium constants (also known as the acid dissociation constant). Rank these acids from strongest to weakest. Explain your ranking.
HCN(aq) + H2O(L) ⇆ H3O+(aq) + CN-(aq) K = 6.2 x 10-10

HC2H3O2(aq) + H2O(L) ⇆ H3O+(aq) + C2H3O-(aq) K = 1.75 x 10-5

H2CO3(aq) + H2O(L) ⇆ H3O+(aq) + HCO3-(aq) K = 4.5 x 10-7

HIO4(aq) + H2O(L) ⇆ H3O+(aq) + IO4-(aq) K = 2.3 x 10-2

8. Calculate the pH and the pOH of each of the following solutions.
a. 0.200 M HCl
b. 0.0143 M NaOH
c. 3.0 M HNO3
d. 0.0031 M Ca(OH)2

9. Wine has a pH of 3.6. What are the hydronium and hydroxide ion concentrations?

10. The hydroxide ion concentration in household ammonia is 3.2 x 10-3 M. What is the concentration of hydronium ions?

Answers

Answer:

1. Equilibrium expressions:

a. K = [HSO4-][H3O+]/[H2SO4][H2O]

b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5

c. K = [NH3][HCl]/[NH4Cl]

d. K = [NO2]^2/[N2O4]

2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).

3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).

4. The Ksp expression for each of the reactions is:

a. Ksp = [Na+][Cl-]

b. Ksp = [Ba2+][SO42-]

5. Brønsted-Lowry acids and bases:

a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+

b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN

c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl

d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+

e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-

6. Conjugate acids and bases:

a. Acid: H2O; Conjugate base: OH-

b. Acid: H3O+; Conjugate base: H2O

c. Acid: H2CO3; Conjugate base: HCO3-

d. Acid: NH4+; Conjugate base: NH3

e. Acid: HSO4-; Conjugate base: SO42-

7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.

8. pH and pOH calculations:

a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301

b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156

c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478

d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794

9. Hydronium and hydroxide ion concentrations:

pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

what does 2NaOH equal

Answers

2NaOH represents the chemical formula for sodium hydroxide.
Other Questions
true/false. an increase in temperature will cause an equilibrium to: select the correct answer below: shift right shift left no change depends on the equilibrium Please indicate which is the best answer to complete the figure below. arrangements in which commercial spots are purchased from local stations and generally appear during time periods alongside network programs rather than within them are known as . write a short story ending with moral Where there is a will, there is a way c. the directors of the two hospitals are negotiating unifying the maternity wards of the two hospitals. they believe this will help reduce the number of new mothers staying in the unified ward. how many new mothers would be staying, on average, in the unified ward? (assume that the average number of births and the length of stay of the new mothers will not change.) (round your intermediate calculations to 4 decimal places and final answer to 1 decimal place.) en years ago, elaine paid $10 per share for 2,000 shares of lazlo common stock. this year, elaine learned that lazlo is in bankruptcy and can pay only 40% of its outstanding debt to its creditors. what are the tax consequences to elaine of lazlo's bankruptcy? A model of a helicopter rotor has four blades, each of length 4.00m from the central shaft to the blade tip. The model is rotated in a wind tunnel at a rotational speed of 540rev/min.A. What is the linear speed of the blade tip?B. What is the radial acceleration of the blade tip expressed as a multiple of the acceleration of gravity, g?Circular Motion:The motion of the object along the circumference of the fixed radius circular path about the stationary specified axis is called the rotational motion or circular motion of the object. The linear speed of any particle on the body is tangential to the circular path. The inward acceleration possessed by the particle depends upon the tangential speed and the radius of rotation of the particle, and it is known as the radial acceleration. An example of a highly cyclical industry is. Select one:the automobile industry.the tobacco industry.the food industry.the automobile industry and the tobacco industry.the tobacco industry and the food industry. What are good filmson the concept of what goes around comes around Let chatelier's principle applies to gas exchange What is the original rock that forms metamorphic rock called? Which of the following is the correct pairing of procedures or rules of each house of the legislative branch?-Has a Rules Committee that decides how long debate will be on most bills.senate- Has use of the filibuster and cloture, which can help the minority to defeat a bill. compare and contrast the functionalist, conflict theorist, and the symbolic interactionist perspectives of socialization in regard to religion. select all that apply sales returns and allowances . (select all that apply.) multiple select question. are adjusted for at the end of the accounting period for estimated returns and allowance expected to occur in the following months increases the amount the seller expects to receive from customers reduce the amount the seller expects to receive from customers are required to be recorded at the time of the initial sale are typically recorded after the initial sale when the actual return or allowance occurs the___transmits a memory address when primary storage is the sending or receiving device. a healthcare worker wants to know about emerging diseases that are active. what is the best place to get information? Hi I need help on this question It's teacher conferences week and I want to get this done before this week Which figure of speech is used in this text?The assassination of John F. Kennedy on November 22, 1963, was as shocking as an earthquake, leaving Americans feeling shaken and vulnerable. PLEASEE HELP!Draw an angle that is 150 degrees. 22) i) A cuboid has dimensions 60cm x 24cm x 30cm. How many small cubes with side 5cm can be placed in the given cuboid?