Give 2 numercial expressions that can be compared without calculating the values. Explain.

Answers

Answer 1

The numercial expressions that can be compared without calculating the values include:

3x^2 + 4x - 5 > 2x^2 + x - 3

2/x < 4/x

How to illustrate the expression

In 3x^2 + 4x - 5 > 2x^2 + x - 3. This expression can be compared without calculating the values because it is a comparison of polynomials of the same degree (both are quadratics). The degree of a polynomial (in this case 2) is the highest power of the variable in the expression. Since the degree is the same, we can directly compare the coefficients of the highest degree term (x^2) and the second highest degree term (x) without calculating the values. In this case, 3x^2 > 2x^2 and 4x > x, therefore the polynomial on the left side is greater than the polynomial on the right side.

For 2/x < 4/x, this expression can be compared without calculating the values because it is a comparison of two different fractions, both of which have a common denominator of x^2. Since the denominators are the same, we can directly compare the numerators. In this case, 2 < 4, therefore the fraction on the left side is less than the fraction on the right side.

Learn more about expressions on:

https://brainly.com/question/723406

#SPJ1


Related Questions

Chapter 3 Lesson 4 Arithmetic Sequence

Answers

Answer:

Step-by-step explanation:

1) 1,15,29,43,57,.....

here, 15-1 =14 and 29-15=14

therefore,it is an arithmetic sequence with common difference = 14

2) 3,6,9,15,17,....

here, 6-3=3, 9-6=3 , 15-9=6

therefore,it is not an arithmetic sequence.

3) 93,86,79,72,65,......

here, 86-93=-7 , 79-86=-7 and 72-79=-7

therefore,it is an arithmetic sequence with common difference = -7

4) 37,34,31,29,26,......

here, 34-37 = -3,31 - 34 = -3,29 - 31 =-2

therefore,it is not an arithmetic sequence.

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

Before taking his last test in a class, the arithmetic mean of Brian's test scores is 91. He has determined that if he scores 98 on his last test, the arithmetic mean of all his test scores will be exactly 92. How many tests, including the last test, does Brian take for this class

Answers

On solving the provided question, we can say that the mean that 6 tests including the last test brian took.

What is mean?

A dataset's mean is the sum of all values divided by the total number of values, often known as the arithmetic mean (as opposed to the geometric mean). Often referred to as the "mean," this is the most often used measure of central tendency. Simply dividing the dataset's total number of values by the sum of all of those values yields this result. Both raw data and data that have been combined into frequency tables can be used for calculations. Average refers to a number's average. It is straightforward to calculate: Divide by how many digits there are after adding up all the digits. the total divided by the count.

(91n + 98) / (n + 1)  =  92

    91n + 98  =  92(n + 1)

 91n + 98  =  92n + 92

 98  =  n + 92

6  =  n

To know more about mean visit:

https://brainly.com/question/30094057

#SPJ4

You have $12 to spend at a vending machine. A pack of Starbursts cost $1 and a pack of M&M chocolates cost $2. You want to buy at least three packs of Starbursts.

a. Write a system of linear inequalities that represents this situation.
b. How many packs of each type of candy can you possibly purchase?

Answers

Answer:yes

Step-by-step explanation:

yes

Answer:

Starbursts = 12 dollars

M&M = 2 dollars

1. Make Startbursts and M&Ms into "x"

(a) 1x + 2x = 12

2. 3*1= 3

4+2x=12

(b) 4 packs

Find the total surface area of a cone with a base diameter of 7cm and height of 8cm

Answers

Answer: The formula for the surface area of a cone is S = π * r * s + π * r², where r is the radius of the base and s is the slant height of the cone.

To find the surface area of a cone, you first need to find the radius of the base. Since the base diameter is given as 7cm, you can divide this by 2 to find the radius of the base:

r = 7cm / 2 = 3.5cm

Next, you need to find the slant height of the cone. You can use the Pythagorean theorem to do this.

slant height = sqrt(r^2 + h^2) = sqrt(3.5² + 8²) = sqrt(12.25 + 64) = sqrt(76.25) = 8.766cm

Now you can substitute these values into the formula for the surface area of a cone and find the surface area of the cone.

S = π * r * s + π * r² = π * 3.5cm * 8.766cm + π * 3.5² cm² = 12.571 cm² + 38.485 cm² = 51.056 cm²

So the surface area of a cone with a base diameter of 7cm and height of 8cm is 51.056 cm²

Step-by-step explanation:

In an amphitheater, eat are aranged in 50 emi-circular rowfacing a dome tate. The firt row contain 23 eat, and each row contain4more eat than the previou row. How many eat are in the amphitheater?

Answers

In an amphitheater, seat are arranged in 50 semi-circular row-facing a dome Tate. The first row contain 23 seat, and each row contain 4 more eat than the previous row. Therefore, there are 6050 seat are in the amphitheater.

Given that:

There are total 50 semi circular row.

In the first row there are 23 seats.

The given problem is AP series:

Arithmetic Series:

An arithmetic sequence is defined as an algebraic sequence in which each successive term has an equal difference. It is obtained by adding a constant to any preceding term. For the first term 'a' and the tolerance 'd' of the AP, here is a list of commonly used arithmetic progressions to solve various AP related problems:

Common Difference of AP: d = a2 - a1 = a3 - a2 = a4 - a3 = an - a(n-1)  nth term of AP.AP: an = a + (n - 1)d of AP Sum of n terms: Sn = n/ 2( 2a+(n-1)d) = n/2(a + l),

where l is the last term in the arithmetic progression.

Now,

Sum of n terms  = n/2 [ 2a + (n-1)d]

                          = 50/2 [ 2× 23 + (50 -1)4]

                          = 25 [46 + 49×4]

                          = 25 × 242

                          = 6050

Learn more about Semi circular Row Facing:

https://brainly.com/question/13135497

#SPJ4

Consider y =f(x)=-3x+2 . Using space below, determine the equation that represents the inverse f(x)

Answers

Answer:   [tex]f^{-1}(\text{x}) = \frac{2-\text{x}}{3}[/tex]

Explanation:

Swap x and y, then solve for y to get the inverse.

[tex]f(\text{x}) = -3\text{x}+2\\\\\text{y} = -3\text{x}+2\\\\\text{x} = -3\text{y}+2\\\\\text{x}-2 = -3\text{y}\\\\\text{y} = \frac{\text{x}-2}{-3}\\\\\text{y} = \frac{2-\text{x}}{3}\\\\f^{-1}(\text{x}) = \frac{2-\text{x}}{3}\\\\[/tex]

T h e r e a r e 235 seven t h - g r a d e st u d e n t s g o i n g o n a fi e l d t r i p . T h e sc h o o l h a s 5 b u se s t o t a k e t h e st u d e n t s. E a c h b u s h a s 22 se a t s, a n d 2 st u d e n t s c a n si t i n e a c h se a t . B a se d o n t h i s i n f o r m a t i o n , h o w m a n y st u d e n t s w i l l n o t b e a b l e t o r i d e o n a b u s f o r t h e fi e l d t r i p ?

Answers

The number of students who will not be able to ride on the bus for the school trip is given by the equation A = 15 students

What is an Equation?

Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side.

It demonstrates the equality of the relationship between the expressions printed on the left and right sides.

Coefficients, variables, operators, constants, terms, expressions, and the equal to sign are some of the components of an equation. The "=" sign and terms on both sides must always be present when writing an equation.

Given data ,

Let the equation be represented as A

Now , the value of A is

The total number of students for the trip = 235 students

The number of buses = 5 buses

The number of students in a bus be = B

Now , each seat on the bus can occupy = 2 students

So , 22 seats can occupy = 22 x 2 students

22 seats in the bus can occupy = 44 students

So , the number of students in a bus B = 44 students

And , the total number of students in 5 buses = 5 x number of students in a bus B

Substituting the values in the equation , we get

The total number of students in 5 buses = 5 x 44

The total number of students in 5 buses = 220 students

So , the remaining number of students A = total number of students for the trip - total number of students in 5 buses

Substituting the values in the equation , we get

The remaining number of students A = 235 - 220

The remaining number of students A = 15 students

Therefore , the value of A is 15 students

Hence , the number of students is 15 students

To learn more about equations click :

https://brainly.com/question/19297665

#SPJ1

please help quickly
If UY=13p-1 and VX=20p-95 than what is UY

Answers

Viewing the given triangle, the information given helped to determine side UY to be 90

What are similar triangles?

This is a term used in geometry to mean that the respective sides of the triangles are proportional and the corresponding angles of the triangles are congruent

Hence assuming the corresponding angles of the triangle are congruent then the side should be in proportions

Examining the figure shows that pair of equivalent sides are

WX and WY, XV and YU

The solution is worked out using sides WX and XV, WY and YU

WX / WY = XV / YU

WX / WY = 1/2 since it is a mid segment

1 / 2 = (20p - 95) / (13p - 1)

13p - 1 = 2 * (20p - 95)

13p - 1 = 40p - 190

190 - 1 = 40p - 13p

189 = 27p

p = 7

solving for UY

= 13p - 1

= 13 * 7 - 1

= 90

Learn more about similar triangles here:

https://brainly.com/question/29333623

#SPJ1

If triangle NPZ ~ triangle HBZ find the measure of angle B.
Please show the steps

Answers

The measure of  angle B is m ∠B = 107°.

What is similar triangles?

Triangles that are similar in shape but differ in size are known as similar triangles. Examples of related objects include all equilateral triangles and squares with any side length. To put it another way, if two triangles are similar, then their corresponding angles and sides are congruent and equal in size.

Given:   Δ NPZ ~ Δ HBZ

As the triangles NPZ and triangle HBZ are similar that means the corresponding angles are congruent.

⇒ ∠N = ∠H,  ∠P = ∠B,  ∠Z = ∠Z

Since,

∠P = (8x - 37)°,  ∠Z = 42°,  ∠H = (2x - 5)°

⇒ 2x - 5 = ∠H,  ∠B = 8x - 37,  Z = 42°

Since, the sum of three angles of triangle is 180°.

⇒              ∠H + ∠B + ∠Z = 180°

(2x - 5)° + (8x - 37)° + 42° = 180°

                10x - 42° + 42° = 180°

                                  10x = 180°

                                     x = 18°

So,

∠B = (8x - 37)° = 8(18) - 37 = 144 - 37 = 107°.

Hence, the measure of  angle B is m ∠B = 107°.

To know more about similar triangles, click on the link

https://brainly.com/question/14285697

#SPJ1

what is -7 divided by 3/4 ?

Answers

Answer:

-9.333333333333333333333

Step-by-step explanation:

Answer-9 1/3

Step-by-step example

first, multiply 7x4 over 3 then next to that cross multiply that with 28 over 3

then simply that which’s gets to 28 over 3 then you get your answer 9.3333 then simplify that and you get 9 1/3

A line is perpendicular to y = x + 3
and intersects the point (-2, 4).
What is the equation of this
perpendicular line?
y = − ²x + [ ]
Hint: Use the Point-Slope Form:y-y₁ = m(x - X1)
Then write the equation in slope-intercept form.
Enter

Answers

Answer:

y =x+3

y =-x²+[?]

Find the gradient;

What is the formula for the gradient of a graph?

Finding the gradient of a straight-line graph

X2 = 2

Y2 = 7

ΔX = 4

ΔY = 3

θ = 36.869897645844°

Equation of the line:

y = 0.75x + 5.5

When x=0, y = 5.5

When y=0, x = -7.3333333333333

OR

X2 = -6

Y2 = 1

ΔX = -4

ΔY = -3

θ = 216.86989764584°

Equation of the line:

y = 0.75x + 5.5

When x=0, y = 5.5

When y=0, x = -7.3333333333333

Jay wants to go paddleboarding at least 8 hours each week. If he averages 2 hours per day, write and solve an inequality to find how many days he will have to go kayaking.​

Answers

An inequality to find how many days he will have to go kayaking. is; d ≥ 4

How to solve Inequality word problems?

We are told that Jay wants to go paddle boarding at least 8 hours each week. This means greater than or equal to 8. That is the minimum number of hours each week is 8 hours.

Now, we are told that he averages 2 hours per day. If the number of days is given by d, then we have the inequality as;

2d ≥ 8

Divide both sides by 2 to get;

d ≥ 4

That is the domain of the number of days required to go kayaking

Read more about Inequality word problems at; https://brainly.com/question/25275758

#SPJ1

There were 9 pieces of paper. Some of them were cut into 3 pieces. As a result, there
are now 15 pieces of paper. How many pieces of paper were cut?

Answers

Answer:15-9=3

6=3

6÷3

2 is the required answer for this question

What is the solution to the system of equations 3x 2y 7 and Y 3x 11?

Answers

The solution to the system of equations is x = 4 and y = 5.

3x + 2y = 7

y = 3x - 11

Substitute 3x - 11 for y in the first equation:

3x + 2(3x - 11) = 7

Simplify:

3x + 6x - 22 = 7

Combine like terms:

9x - 22 = 7

Add 22 to both sides:

9x = 29

Divide both sides by 9:

x = 29/9

x = 4

Change x in the second equation to 4:

y = 3(4) - 11

Simplify:

y = 12 - 11

y = 1

The solution to the system of equations is x = 4 and y = 1.

The solution to the system of equations 3x + 2y = 7 and y = 3x - 11 is x = 4 and y = 1. To solve this system, we first substituted 3x - 11 for y in the first equation. We then simplified the equation and combined like terms to get 9x - 22 = 7. We then added 22 to both sides, divided both sides by 9, and got x = 29/9 which is x = 4. We then substituted 4 for x in the second equation, simplified, and got y = 1. Thus, the solution to the system of equations is x = 4 and y = 1.

Learn more about equation here

https://brainly.com/question/29657992

#SPJ4

Which of these equations is equivalent to the following: 8/12 divided by 7/8=
Plsssss help me

Answers

Answer: o.7619

Step-by-step explanation: i used the standard algorithm i am sorry i cant do a more in depth just hard to do with words ;)

Answer: 0.7619

:)

Step-by-step explanation:

Convert 1.45454... into a ratio of two integers. Enter your answer as a fraction in lowest terms.​

Answers

Answer:

16/11

Step-by-step explanation:

Let x = 1.45454...

Multiply both sides by 100:

100x = 145.454...

Subtract both sides by x:

100x - x = 145.454... - x

100x - x = 145.454... - 1.45454...

99x = 144

x = 144/99

The term can be simplified in lowest as 16/11. Hence, 1.45454... can be written as the ratio of two integers of 16/11

Barrett earns $15 per hour cutting grass and $10 per hour tutoring reading. In one month, Barrett
needs to save at least $400 for a new lawnmower but does not want to work more than 35 hours.
Part A: Let x represent the hours cutting grass and y represent the hours tutoring. Given x ≥ 0 and
y ≥ 0, select all the inequalities that represent the situation.
A. x + y ≥ 35
B. 15x + 10y ≤ 400
C. x + y ≤ 35
D. 15x + 10y ≥ 400
E. 25x + 25y ≤ 400
F. 15x + 10y ≤ 35

Part B: Determine whether each point is a viable or nonviable solution according to the above scenario.

Viable Nonviable

(10, 25)

(10, 20)
(20, 12)
(35, 0)
(20, 20)

Answers

The inequalities that represent the situation are 15x + 10y ≥ 400 and x + y ≤ 35 and the viable solutions are (10, 25), (20, 12), (35, 0) and (20, 20)

The inequalities that represent the situation.

From the question, we have the following parameters that can be used in our computation:

Earnings from cutting = $15Earning from tutoring = $10Number of hours = not more than 35Total earnings = At least $400

These parameters above mean that

15x + 10y = Total earnings

x + y = Number of hours

So, we have

15x + 10y ≥ 400

x + y ≤ 35

The above represent the inequalities of the situation

The viable solutions

In (a), we have

15x + 10y ≥ 400

x + y ≤ 35

Next, we test the options

(10, 25)

15 * 10 + 10 * 25 ≥ 400 ⇒ 400 ≥ 400

10 + 25 ≤ 35 ⇒ 35 ≤ 35

True

(10, 20)

15 * 10 + 10 * 20 ≥ 400 ⇒ 350 ≥ 400

10 + 20 ≤ 35 ⇒ 30 ≤ 35

False

(20, 12)

15 * 20 + 10 * 12 ≥ 400 ⇒ 420 ≥ 400

20 + 12 ≤ 35 ⇒ 32 ≤ 35

True

(35, 0)

15 * 35 + 10 * 0 ≥ 400 ⇒ 525 ≥ 400

35 + 0 ≤ 35 ⇒ 35 ≤ 35

True

(20, 20)

15 * 20 + 10 * 20 ≥ 400 ⇒ 500 ≥ 400

20 + 20 ≤ 35 ⇒ 40 ≤ 35

False

Hence, the viable solutions are (10, 25), (20, 12), (35, 0) and (20, 20)

Read more about inequality at

https://brainly.com/question/25275758

#SPJ1

Could someone help me

Answers

[tex]\cfrac{6a^2 + 21a}{3a^2}\implies \cfrac{6a^2 }{3a^2}+\cfrac{21a}{3a^2}\implies 2+\cfrac{7}{a}[/tex]

If A=(7,9) and B=(3,12) what is the length of AB

Answers

The distance between two points A and B is 5 units.

A farmer took 2/3 of the trawberrie that he harveted to a market. At the the market, the farmer old 1/4 of the trawberrie. How can you find what part of the trawberrie the farmer harveted were old at the market?

Answers

There are 5/12 strawberries were left. This can be solved using the concept of fraction addition.

What is fraction?

A fraction is a piece of the entire. The number is stated in arithmetic as a quotient, which signifies the numerator divided by the denominator. Both are integers in a straightforward fraction. The numerator or denominator of a complex fraction is a fraction. A suitable fraction has a numerator that is smaller than its denominator.

Three main fractional kinds exist. They come in three varieties: appropriate fractions, incorrect fractions, and mixed fractions. The numerator and denominator words are known as fractions. We define its kinds in light of these two words.

Given that,

A farmer took 2/3 of the strawberry that he harvested to a market.

At the market, the farmer sold 1/4th of the strawberry.

Now, the farmer has left no of strawberries were:

= (2/3) - (1/4)

= (8 - 3) / 12

= 5 / 12

To know more about fraction refer to:

brainly.com/question/17220365

#SPJ4

9. A triangle with a height of 12 inches has an area of 36 square inches. How long is the base of the triangle?







If anyone knows this please tell me this is due tommorow!​

Answers

Area = 1/2(base)(height)

36 = 1/2(base)(12)
36 = 6(base)
6 = base

The base is 6 inches long.

Answer:

Step-by-step explanation

The triangle base would be 6

What role does place value have in finding 10% and 1% of a number? Write at least two complete sentences.

Answers

The fractions of the numbers are found as follows:

10% of a number is found moving the decimal digit one unit right.1% of a number is found moving the decimal digit two units right.

How to divide a number by powers of 10?

To divide a number by the nth power of 10, the decimal digit in the number is moved n units to the right.

The fraction that represents 10% of a number is given as follows:

10/100 = 1/10.

Meaning that the number is divided by 10, which is the first power of 10, and thus the decimal digit is moved one unit right in the number.

The fraction that represents 1% of a number is given as follows:

1/100.

Meaning that the number is divided by 100, which is the second power of 10, and thus the decimal digit is moved two units right in the number.

More can be learned about division by powers of 10 at https://brainly.com/question/29015488

#SPJ1

A line has a slope of – 1/7 and passes through the point (4,5). What is its equation in point-slope form?

Answers

Answer:

y-5=-1/7(x-4)

Step-by-step explanation:

The equation of the line in point-slope form is y-5=-1/7(x-4)

Answer:

y = -1/7 x + 39/7

Step-by-step explanation:

An equation in point slope form is

y = mx+b  where m is the slope and b is the y intercept

We are given the slope

y = -1/7 x + b

Substitute in the point for x and y and solve for b

5 = -1/7(4) +b

5 = -4/7 +b

5 + 4/7 = b

5*7/7 + 4/7 = b

35/7 + 4/7 = b

39/7 = b

The equation is

y = -1/7 x + 39/7

Don’t know need help

Answers

The meaning of adjoining  is nearby or next to.

What is meant by adjoining?

The terms neighboring, adjoining, contiguous, and juxtaposed denote close closeness. Adjacent may or may not indicate touch, but it always implies the lack of something like in between. A home with a garage attached. Adjoining means meeting and touching at some point or line. Two nearby dwellings are an example of adjacent. People on our block are typically considered our neighbors.

In the English language, “adjacent to” means “next to.” For two angles to be adjacent, they must meet the following three conditions: 1. The two angles must share (or have the same) side. 2. They must share a vertex (i.e. a common starting point for the sides).

To learn more about adjoining to refer:

https://brainly.com/question/16885438

#SPJ1

PS is the length of either segment multiplied by two ,PS is 38.

How to find PS?

A line connecting the vertex with the middle of the other side forms the median angle. As a result, we may state that PR = QS for the provided.

By equating PR and QS, we can determine X's value.

PR = QS

5x-11 = 2x+7

Combine related terms to get 5x-2x = 7+11; divide both sides by 3 to get the x value; and last, multiply the result by 2 to get x = 6.

Find the value of PR and QS, and we'll demonstrate that two are equal as a result.

Correct: 5(6)-11 = 2(6)+7 19 = 19.

PS is the length of either segment multiplied by two, or simply the product of PR and QS.

PS = 19 x 2 = 19 + 19 = 38 (D) (D)

To learn more about angle refer to:

https://brainly.com/question/25716982

#SPJ1

If Point B represents an alternate combination of flutternutters & blank books, then how much of each product could be produced?

Answers

From the given graph, at Point B a total of 8000 fluffernutters & 500 blank books could be produced.

The study of graphs, which are mathematical constructions used to represent pairwise relationships between things, is known as graph theory in mathematics. In this context, a graph is made up of vertices connected by edges.

In discrete mathematics, a graph is made up of vertices—a collection of points—and edges—the lines connecting those vertices. In addition to linked and disconnected graphs, weighted graphs, bipartite graphs, directed and undirected graphs, and simple graphs, there are many other forms of graphs.

Straight line graphs called linear graphs are used to show the relationship between two quantities. This graph makes it easier to show a result as a collection of straight lines. The term "linear" simply means a straight line; curves, dots, bars, etc. are not used.

To learn more about graphs from given link

https://brainly.com/question/30057644

#SPJ1

at the same time that a 60 foot tall buidling casts s shadow hat is 21.5 feet long a nearby tree casts a shadow that is 18 feet long, Which measure is closest to the height of the tree

Answers

The height of the tree is closest to 40 feet.

We can use the proportion of similar triangles to determine the height of the tree.

Let h be the height of the tree and s be the length of the shadow cast by the tree.

We know that the height of the building is 60 feet and the length of its shadow is 21.5 feet. So:

(h/s) = (60/21.5)

 

We also know that the length of the shadow cast by the tree is 18 feet.

So we can substitute that into the proportion and solve for h:

h = (60/21.5) * 18

h = (60*18)/21.5

h ≈ 40

To know more about proportion of similar triangles refer to:

https://brainly.com/question/28786152

#SPJ4

3) Camile offers you a challenge. Are the triangles below similar? Examine them and tell how
you know.

a) Use a flowchart to organize your explanation.
b) Camile says, "These triangles aren't just similar-they're congruent!" Is Camile
correct? What special value in your flowchart indicates that the triangles are
congruent?

Answers

a) The flowchart for the congruency of triangles is given below.

b) The triangles are congruent as DQ ≅ XZ, PQ ≅ XY, and ∠PQD ≅ ∠ZXY.

What is congruency?

The word 'congruent' means 'exactly equal' in terms of shape and size. Even when we turn, flip, or rotate the shapes, they remain equal.

In the given diagram, it can be seen that -

Line segment DQ = Line segment XZ.

Similarly, Line segment PQ = Line segment XY.

Since, the two sides of the triangle are equal, hence the third side must also be equal.

Line segment PD = Line segment ZY.

Also, in the diagram it can be seen that ∠PQD ≅ ∠ZXY.

Therefore, the triangles PDQ and ZXY are equal and congruent.

The flowchart for the same is given below.

To learn more about congruency from the given link

https://brainly.com/question/2938476

#SPJ1

1. Marta walked 6 miles in 1.5 hours. At this rate how long will it take her to walk 16 miles?

2. Lionel typed 320 words in 4 minutes. At this rate, how long will it take him to type 800 words?

Answers

Answer for no.2: 800

Step-by-step explanation:

solve 2x+4y=4 -2x+y=-4 using substitution 

Answers

According to the solving by  using substitution method the  x and y are x = 6/5 and y = -8/5 respectively.

What is a method of substitution?

The algebraic approach to solving simultaneous linear equations is known as substitution method. The value of one variable through one equation is substituted in the second equation in this procedure, as the name implies.

According to the given information:

given equations are 2x+4y = 4 and -2x+ y = -4

Now, simplifying -2x+y = -4

-2x+y = -4

∴ y = -4 + 2x

i.e. y = 2x - 4

By substitution method,

y = 2x - 4 in other given equation 2x+4y = 4,

 2x+4y = 4

 2x+4(2x - 4) = 4

∴ 2x + 8x - 8 = 4

∴ 10x = 4 + 8

∴10x = 12

∴ x = 12/10

∴ x = 6/5

Now ,

substituting x = 6/5 in y = 2x - 4,

 y = 2(6/5) - 4

∴ y = - 8/5

∴ x = 6/5  &  y = - 8/5.

To learn more about substitution method click:

brainly.com/question/26094713

#SPJ1

Other Questions
Please help! 1.) Explain why the term cycle is used to describe the biogeochemical cycles.2.) Compare and contrast the carbon and nitrogen cycles. Specifically, identify which happens when either exists in very large quantities in the environment. PBS Evolution: Great Transformations 1. If the worlds history were compressed into one hour, how long have humans been here? Microbes. Single-celled organisms 2. How long ago did mammals first appear on earth? Mammals first appeared about 200 million years ago 3. What type of animal did the skull that Dr. Gingrich discovered resemble? Dr. Gingrich discovered resembled a whale 4. What did "Whale Valley" used to be? 5. What unusual feature did they find at the end of the early tetrapods limbs? 6. How long ago did animals first appear on Earth? About 800 million years. 7. When the mouse "eyeless" gene was implanted into the fruit flies, what happened? 8. How would walking on two legs be an advantage? How do you choose which variable to eliminate when doing elimination method? true or false : the performing forces for farmers madrigal consist of a four-voice satb ensemble. A window is to be built in the shape of a rectangle surmounted by an isoscelestriangle. The area of the window must be 6m2. Use Lagrange Multipliers to findthe width and height of the rectangle for which the perimeter of the window will beas small as possible. (Clarications: (1) A rectangle surmounted by a triangle hasthe shape of a stick drawing of a house as might be drawn by a child, a rectanglewith a triangle on top. (2) The window's perimeter is made up of three sides ofthe rectangle and the two equal length sides of the triangle. Draw a diagram! (3)This may require some industrial strength algebra!) How doe changing the amplitude of a WATER wave affect what we ee/hear/experience? How and how would we likely experience thi in our everyday life? The structures of the amino acids serine, proline, and glycine are shown:The first diagram is of the amino acid serine. Serine is composed of a two carbon backbone. The first carbon is bound one amino group, one hydrogen atom, and one carboxyl group. The other carbon is bound to two hydrogen atoms and one hydroxyl group. The second diagram is of the amino acid proline. Proline is composed of a ring. The ring is made up of four carbons and one nitrogen. Three of the carbons are bound to two hydrogen atoms. The nitrogen is bound to one hydrogen atom. The final carbon is bound to one hydrogen atom and one carboxyl group. The third diagram is of the amino acid glycine. Glycine is composed of a carbon bound to two hydrogen atoms, one carboxyl group, and one amino group.The secondary structure of a protein consists of a single long beta sheet. The outer edges of the beta sheet are composed of serine and proline amino acids.Explain how the structure of amino acids determine the function.A mutation occurred in DNA of a globular enzyme. If the serine amino acids were found within the active site of the enzyme, describe the effect this change is likely to have on enzymatic function.If a mutation in the DNA of a globular enzyme changed all of the serine and proline amino acids to glycine, predict how the relative position of the amino acid on the secondary structure of the beta sheet would be affected when the protein is placed in an aqueous solution.Justify your prediction by providing evidence that supports your claim. The depth of water in a tank oscillates sinusoidally once every 8 hours. If the smallest depth is 6. 6 feet and the largest depth is 9. 4 feet, find a possible formula for the depth in terms of time t in hours. Assume that at t=0 the water level is at the average of the depth and is rising. . In some cultures such as the Navajo people color What happens to the 3 carbon sugar that exits the Calvin cycle? The population of a city decreases by 0.9% per year. If this year's population is pp, which expression does NOT represent next year's population?0.9910.9910.991p0.991p(1-0.009)p(10.009)p1p-0.009p1p0.009p Two factors that universally interfere with family function in every nation are:- A). Ethnic differences and low income- B). Low income and high conflict- C). High stress and high income- D). Religious differences and low income In E. coli the tryptophan operon is controlled by attenuation. The beginning of the Trp mRNA has several codons for Trp in a row. When Trp amino acid is limiting, the mRNA ________?a. is destroyed and the operon is not transcribedb. basepairs to itself, allows RNA polymerase to continue transcribing the operonc. basepairs to itself, blocking RNA polymerase from transcribingd. attaches to the promotor sequence to activate RNA polymerase 24,000 at 5 5% for 5 years What's the value of the following game: You roll a 100 sided die with sides 1-100. You can either take this number of dollars, or pay $1 to roll again. You can keep on paying $1 to roll for as long as you like. Who were the principal patrons of Haydn and Mozart, and did the two composers maintain a good relationship with their respective patrons? Explain your answer. I NEED HELPPPPPPP, PLSSS What is the number of terms in the expansion of 2x 3y 2 )( 2x 3y 2 2? Which of the following are key tasks in the strategy-making, strategy-executing process? O Developing a proven business model, deciding on the company's strategic intent, creating a balanced Scorecard, and crafting a strategy O Setting objectives, choosing what business approaches and operating practices to employ, selecting a business model, identifying the three best strategy alternatives, and monitoring developments and initiating corrective adjustments O Setting objectives, identifying the best strategy alternatives, choosing the very best of the strategy alternatives, implementing and executing the chosen strategy, and deciding what portion of the company's resources to employ in the pursuit of sustainable competitive advantage O Deciding on the company's strategic intent, creating a balanced Scorecard for monitoring performance, crafting a strategy, and choosing what business approaches and operating practices to employ O Developing a strategic vision, mission, and core values; setting objectives; and crafting a strategy to achieve the objectives and move the company along the path to accomplishing the mission and vision hinhibited and constitutes copyright violation Which bag of potatoes is the better deal? 1. When blood leaves the heart, where does it exit?A the aortaBthe capillariesc the lungsD the pulmonary vein