Consider the functions p and q.
p(x) = 9x /7x+3
q(x) = 4x – 1
Calculate r′ if r(x) = p(x)/q(x) r’ =

Answers

Answer 1

The derivative of the function r(x) OR r' is given by :

r'(x) = (27(4x - 1)/(7x + 3)^2 - 36x/(7x + 3)) / (4x - 1)^2.

To find the derivative of the function r(x) = p(x)/q(x), we can use the quotient rule. The quotient rule states that if we have two functions u(x) and v(x), then the derivative of their quotient is given by:

r'(x) = (u'(x)v(x) - u(x)v'(x)) / (v(x))^2

Let's calculate r'(x) step by step using the given functions p(x) and q(x):

p(x) = 9x / (7x + 3)

q(x) = 4x - 1

First, we need to find the derivatives of p(x) and q(x):

p'(x) = (d/dx)(9x / (7x + 3))

      = (9(7x + 3) - 9x(7))/(7x + 3)^2

      = (63x + 27 - 63x)/(7x + 3)^2

      = 27/(7x + 3)^2

q'(x) = (d/dx)(4x - 1)

      = 4

Now, we can substitute these values into the quotient rule to find r'(x):

r'(x) = (p'(x)q(x) - p(x)q'(x)) / (q(x))^2

      = (27/(7x + 3)^2 * (4x - 1) - (9x / (7x + 3)) * 4) / (4x - 1)^2

      = (27(4x - 1)/(7x + 3)^2 - 36x/(7x + 3)) / (4x - 1)^2

So, r'(x) = (27(4x - 1)/(7x + 3)^2 - 36x/(7x + 3)) / (4x - 1)^2.

Learn more about derivative here:

brainly.com/question/32963989

#SPJ11


Related Questions

Which package has the lowest cost per ounce of rice ( 12, 18, 7)

Answers

Package 3 has the lowest cost per ounce of rice.

To determine the package with the lowest cost per ounce of rice, we need to divide the cost of each package by the number of ounces of rice it contains.

Let's calculate the cost per ounce for each package:

Package 1: Cost = 12, Ounces of rice = 18

Cost per ounce = 12 / 18 = 0.67

Package 2: Cost = 18, Ounces of rice = 7

Cost per ounce = 18 / 7 = 2.57

Package 3: Cost = 7, Ounces of rice = 12

Cost per ounce = 7 / 12 = 0.58

Comparing the cost per ounce for each package, we can see that Package 3 has the lowest cost per ounce of rice, with a value of 0.58.

Therefore, Package 3 has the lowest cost per ounce of rice among the three packages.

Learn more about lowest cost here:

https://brainly.com/question/31781702

#SPJ11

Trying to escape his pursuers, a secret agent skis off a slope inclined at 30

below the horizontal at 50 km/h. To survive and land on the snow 100 m below, he must clear a gorge 60 m wide. Does he make it? Ignore air resistance. Help on how to format answers: units (a) How long will it take to drop 100 m ? (b) How far horizontally will the agent have traveled in this time? (c) Does he make it?

Answers

Given,The slope is inclined at 30° below the horizontal velocity of the agent is 50 km/h. The agent has to clear a gorge 60 m wide to survive and land on the snow 100 m below.

The following are the units required to solve the problem;

(a) seconds(s)(b) meters(m)(c) Yes or No (True or False)The solution to the problem is given below;The agent has to cover a horizontal distance of 60 m and a vertical distance of 100 m.We can use the equations of motion to solve this problem.Here, the acceleration is a = g

9.8 m/s².

(a) Time taken to drop 100 m can be found using the following equation, {tex}s=ut+\frac{1}{2}at^2 {/tex}.

Here, u = 0,

s = -100 m (negative since the displacement is in the downward direction), and

a = g

= 9.8 m/s².∴ -100

= 0 + 1/2 × 9.8 × t²

⇒ t = √20 s ≈ 4.5 s

∴ The time taken to drop 100 m is approximately 4.5 s.

(b) The horizontal distance covered by the agent can be found using the formula, {tex}s=vt {/tex}. Here, v is the horizontal velocity of the agent. The horizontal component of the velocity can be calculated as, v = u cos θ

where u = 50 km/h and

θ = 30°

∴ v = 50 × cos 30° km/h

= 50 × √3 / 2

= 25√3 km/h

We can convert km/h to m/s as follows;1 km/h = 1000 / 3600 m/s

= 5/18 m/s

∴ v = 25√3 × 5/18 m/s

= 125/18√3 m/s

∴ The horizontal distance covered by the agent in 4.5 s is given by,

s = vt

= (125/18√3) × 4.5

≈ 38.7 m.

∴ The agent has traveled 38.7 m horizontally in 4.5 seconds.(c) The agent has to cover a horizontal distance of 60 m to land on the snow 100 m below.

As per our calculation, the horizontal distance covered by the agent in 4.5 seconds is 38.7 m. Since 38.7 m < 60 m, the agent cannot make it to the snow and will fall in the gorge.

Therefore, the answer is No (False).

To know more about horizontal velocity visit:

https://brainly.com/question/32746323

#SPJ11

Q2. Solve the following inequalities: a) 6x+2(4−x)<11−3(5+6x) b) 2∣3w+15∣≥12 (10 marks)

Answers

Ther solution of the following inequalities are

a) x < -6/11

b) w ≤ -7 or w ≥ -3

For inequality (a), let's simplify the expression on both sides. Distribute the constants within the parentheses:

6x + 2(4 - x) < 11 - 3(5 + 6x)

6x + 8 - 2x < 11 - 15 - 18x

Combine like terms on each side:

4x + 8 < -4 - 18x

Move the variables to one side and the constants to the other:

22x < -12

Divide by the coefficient of x, which is positive, so the inequality does not change:

x < -12/22

Simplifying further, we get:

x < -6/11

Thus, the solution for inequality (a) is x < -6/11.

For inequality (b), we start by isolating the absolute value expression:

2|3w + 15| ≥ 12

Since the inequality involves an absolute value, we consider two cases:

Case 1: 3w + 15 ≥ 0

In this case, the absolute value becomes:

2(3w + 15) ≥ 12

Simplify and solve for w:

6w + 30 ≥ 12

6w ≥ -18

w ≥ -3

Case 2: 3w + 15 < 0

In this case, the absolute value becomes:

2(-(3w + 15)) ≥ 12

Simplify and solve for w:

2(-3w - 15) ≥ 12

-6w - 30 ≥ 12

-6w ≥ 42

w ≤ -7

Thus, the solution for inequality (b) is w ≤ -7 or w ≥ -3.

Learn more about Inequalities

brainly.com/question/19491153

#SPJ11

Section \( 1.1 \) 1) Consider \( x^{2} y^{\prime \prime}(x)+\sin (y(x))+6 y(x)=13 \). State the order of the differential equation and whether it is linear or nonlinear.

Answers

The differential equation is of order 2 and nonlinear. The order of a differential equation is the highest order derivative that appears in the equation. In this case, the highest order derivative is y′′(x), so the order of the differential equation is 2.

The equation is nonlinear because the term sin(y(x)) contains a product of the dependent variable y(x) and its derivative y′(x). If the equation did not contain this term, then it would be linear.

The order of the differential equation is 2 because the highest order derivative is y′′(x). The equation is nonlinear because the term sin(y(x)) contains a product of the dependent variable y(x) and its derivative y′(x). If the equation did not contain the term sin(y(x)), then it would be linear.

To learn more about differential equation click here : brainly.com/question/32645495

#SPJ11

a force vector points at an angle of 41.5 ° above the x axis. it has a y component of 311 newtons (n). find (a) the magnitude and (b) the x component of the force vector.

Answers

the magnitude of the force vector is approximately 470.41 N, and the x component of the force vector is approximately 357.98 N.

(a) The magnitude of the force vector can be found using the given information. The y component of the force is given as 311 N, and we can calculate the magnitude using trigonometry. The magnitude of the force vector can be determined by dividing the y component by the sine of the angle. Therefore, the magnitude is given by:

Magnitude = y component / sin(angle) = 311 N / sin(41.5°)

Magnitude = y component / sin(angle)

Magnitude = 311 N / sin(41.5°)

Magnitude ≈ 470.41 N

(b) To find the x component of the force vector, we can use the magnitude and the angle. The x component can be determined using trigonometry by multiplying the magnitude by the cosine of the angle. Therefore, the x component is given by:

x component = magnitude * cos(angle)

x component = magnitude * cos(angle)

x component = 470.41 N * cos(41.5°)

x component ≈ 357.98 N

Learn more about force vector here:

brainly.com/question/28969457

#SPJ11

If the temperature (T) is 10 K, what is the value of T⁴? (Remember, this is the same as T×T×T×T. )
a. 1
b. 10000
c. 4000
d. −1000

Answers

None of the provided answer choices accurately represents the value of T⁴ when T is 10 K. The correct value is 10⁸ K².

The value of T⁴ can be calculated by multiplying the temperature (T) by itself four times. In this case, the given temperature is 10 K. Let's perform the calculation step by step.

T⁴ = T × T × T × T

T⁴ = 10 K × 10 K × 10 K × 10 K

Now, let's calculate the value of T⁴.

T⁴ = 10,000 K × 10,000 K

T⁴ = 100,000,000 K²

To simplify further, we can rewrite 100,000,000 K² as 10⁸ K².

Therefore, the value of T⁴ is 10⁸ K².

Now let's consider the answer choices provided:

a. 1: The value of T⁴ is not equal to 1; it is much larger.

b. 10,000: The value of T⁴ is not equal to 10,000; it is much larger.

c. 4,000: The value of T⁴ is not equal to 4,000; it is much larger.

d. -1,000: The value of T⁴ is not equal to -1,000; it is a positive value.

In conclusion, the value of T⁴ when T is 10 K is 10⁸ K².

Learn more about simplify at: brainly.com/question/23002609

#SPJ11

Consider the following events. Event A : The number rolled is greater than 4. Event B : The number rolled is odd. Give the outcomes for each of the following events. If there is more than one element in the set, separate them with commas. (a) Event " A and B" : (b) Event " A or B" : (c) The complement of the event A :

Answers

(a) Event "A and B": **There are no outcomes that satisfy both Event A and Event B.**

Event A consists of the numbers {5, 6}, which are greater than 4.

Event B consists of the numbers {1, 3, 5}, which are odd.

Since there are no common elements between Event A and Event B, the intersection of the two events is empty.

(b) Event "A or B": **The outcomes that satisfy either Event A or Event B are {1, 3, 5, 6}.**

Event A consists of the numbers {5, 6}, which are greater than 4.

Event B consists of the numbers {1, 3, 5}, which are odd.

Taking the union of Event A and Event B gives us the set of outcomes that satisfy either one of the events.

(c) The complement of the event A: **The outcomes that are not greater than 4 are {1, 2, 3, 4}.**

The complement of Event A consists of all the outcomes that do not belong to Event A. Since Event A consists of numbers greater than 4, the complement will include numbers that are less than or equal to 4.

To learn more about satisfy
https://brainly.com/question/29262604
#SPJ11


How much interest could you earn, over 8 months on an investment of \( \$ 84000 \) at \( 12 \% \) simple interest?

Answers

Over 8 months, an investment of $84,000 at a simple interest rate of 12% would earn $8,400 in interest.

To calculate the interest earned on a simple interest investment, we use the formula: Interest = Principal × Rate × Time. In this case, the principal is $84,000 and the rate is 12% or 0.12 (converted to decimal form). The time is 8 months.

First, we convert the time to years by dividing 8 months by 12 (number of months in a year). This gives us 0.67 years.

Next, we plug in the values into the formula: Interest = $84,000 × 0.12 × 0.67.

Calculating this, we find that the interest earned over 8 months is $8,400. This means that after 8 months, the investment would have grown to a total of $92,400 ($84,000 principal + $8,400 interest).

It's important to note that simple interest assumes a constant interest rate over the entire period and does not take compounding into account. If compounding were involved, the interest earned would be higher.

Learn more about compounding here:

https://brainly.com/question/22621039

#SPJ11

[q: 10,8,8,7,3,3]
What is the largest value that the quota q can
take?

Answers

The largest value that the quota q can take is 10.

To find the largest value that the quota q can take, we look at the given set of numbers: 10, 8, 8, 7, 3, 3. To determine the largest value the quota q cannot take, we examine the given set of numbers: 10, 8, 8, 7, 3, 3. By observing the set, we find that the number 9 is absent.

Therefore, 9 is the largest value that the quota q cannot attain. Consequently, the largest value the quota q can take is 10, as it is present in the given set of numbers.

For more questions like Quota click the link below:

https://brainly.com/question/29072521

#SPJ11

Determine the equation of the tangent for the graph of \[ y=5 \cdot \sin (x) \] at the point where \( x=-4 \cdot \pi \) Enter your solution in the form of \( y=m x+b \)

Answers

The equation of the tangent line to the graph of \(y = 5 \cdot \sin(x)\) at the point where \(x = -4 \cdot \pi\) is \(y = 0x + 0\).

The equation of the tangent line, we need to find the slope of the tangent line at the given point and then use the point-slope form of a line to write the equation.

1. Find the derivative of the function \(y = 5 \cdot \sin(x)\) with respect to \(x\) to obtain the slope of the tangent line. The derivative of \(\sin(x)\) is \(\cos(x)\), so the derivative of \(y\) is \(\frac{dy}{dx} = 5 \cdot \cos(x)\).

2. Substitute \(x = -4 \cdot \pi\) into the derivative \(\frac{dy}{dx}\) to find the slope of the tangent line at the given point. Since \(\cos(-4 \cdot \pi) = \cos(4 \cdot \pi) = 1\), the slope is \(m = 5 \cdot 1 = 5\).

3. The equation of the tangent line in point-slope form is given by \(y - y_1 = m(x - x_1)\), where \((x_1, y_1)\) is the given point of tangency. Substituting \((x_1, y_1) = (-4 \cdot \pi, 5 \cdot \sin(-4 \cdot \pi))\) into the equation, we have \(y - 0 = 5(x - (-4 \cdot \pi))\).

4. Simplify the equation to obtain the final form: \(y = 5x + 0\).

Therefore, the equation of the tangent line is \(y = 5x\).

Learn more about tangent : brainly.com/question/10053881

#SPJ11

Decide whether each of the following series converges. If a given series converges, compute its sum. Otherwise, enter INF if it diverges to infinity. MINF if it diverges to minus infinity, and DIV otherwise: 1. ∑
n=1
[infinity]

(sin(2n)−sin(2(n+1))) 2. ∑
n=1
[infinity]

(sin(
n
2

)−sin(
n+1
2

)) 3. ∑
n=1
[infinity]

(e
1in
−e
11(n+1)
) Note: In order to get credit for this problem all answers must be correct.

Answers

The series [tex]\sum_{n=1}^\infty[/tex] sin (2 n) - sin (2 (n + 1)) diverges to ∞.

The series [tex]\sum_{n=1}^\infty[/tex] [sin (2/n) - sin (2/(n + 1))] converges to sin(2).

The series [tex]\sum_{n=1}^\infty[/tex] [e¹¹ⁿ - e¹¹⁽ⁿ⁺¹⁾] diverges to - ∞.

Given that, the first series is

S = [tex]\sum_{n=1}^\infty[/tex] sin (2 n) - sin (2 (n + 1))  

Now calculating,

Sₖ = [sin 2 + sin 4 + sin 6 + ..... + sin 2k] - [sin 4 + sin 6 + ..... + sin 2k + sin (2k + 2)]

Sₖ = sin 2 - sin (2k + 2)

So now, limit value is,

[tex]\lim_{k \to \infty}[/tex] Sₖ = [tex]\lim_{k \to \infty}[/tex] [sin 2 - sin (2k + 2)] = ∞

Hence the series diverges.

Given that, the second series is

S = [tex]\sum_{n=1}^\infty[/tex] [sin (2/n) - sin (2/(n + 1))]

Now calculating,

Sₖ = [sin 2 + sin 1 + sin (2/3) + .... + sin (2/k)] - [sin 1 + sin (2/3) + ..... + sin (2/k) + sin (2/(k + 1))]

Sₖ = sin 2 - sin (2/(k + 1))

So now, limit value is,

[tex]\lim_{k \to \infty}[/tex] Sₖ = [tex]\lim_{k \to \infty}[/tex] [sin 2 - sin (2/(k + 1))] = sin 2 - 0 = sin 2

Hence the series is convergent and converges to sin (2).

Given that, the third series is

S = [tex]\sum_{n=1}^\infty[/tex] [e¹¹ⁿ - e¹¹⁽ⁿ⁺¹⁾]

Now calculating,

Sₖ = [e¹¹ + e²² + e³³ + ..... + e¹¹ᵏ] - [e²² + e³³ + ....+ e¹¹ᵏ + e¹¹⁽ᵏ⁺¹⁾]

Sₖ = e¹¹ - e¹¹⁽ᵏ⁺¹⁾

So now, limit value is,

[tex]\lim_{k \to \infty}[/tex] Sₖ = [tex]\lim_{k \to \infty}[/tex] [e¹¹ - e¹¹⁽ᵏ⁺¹⁾] = - ∞.

Hence the series diverges.

To know more about series here

https://brainly.com/question/32549533

#SPJ4

The question is not clear. The clear and complete question will be -

a. Find the linear approximation for the following function at the given point. b. Use part (a) to estimate the given function value. f(x,y)=−3x2+y2;(3,−2); estimate f(3.1,−2.07) a. L(x,y)= b. L(3.1,−2.07)=

Answers

The linear approximation for the function f(x,y) = -3x^2 + y^2 at the point (3,-2) is L(x,y) = -15x - 4y - 15.

To find the linear approximation, we start by taking the partial derivatives of the function with respect to x and y.

∂f/∂x = -6x

∂f/∂y = 2y

Next, we evaluate these partial derivatives at the given point (3,-2):

∂f/∂x (3,-2) = -6(3) = -18

∂f/∂y (3,-2) = 2(-2) = -4

Using these values, we can form the equation for the linear approximation:

L(x,y) = f(3,-2) + ∂f/∂x (3,-2)(x - 3) + ∂f/∂y (3,-2)(y + 2)

Substituting the values, we get:

L(x,y) = -3(3)^2 + (-2)^2 - 18(x - 3) - 4(y + 2)

       = -15x - 4y - 15

Therefore, the linear approximation for the function f(x,y) = -3x^2 + y^2 at the point (3,-2) is L(x,y) = -15x - 4y - 15.

Learn more about linear approximation:

brainly.com/question/1621850

#SPJ11

Let f(x)=√2x+1​. Use definition of the derivative Equation 3.4 to compute f′(x). (No other method will be accepted, regardless of whether you obtain the correct derivative.) (b) Find the tangent line to the graph of f(x)=√2x+1​ at x=4.

Answers

To compute f'(x) using the definition of the derivative, we need to use the formula for the derivative:

f'(x) = lim(h->0) [(f(x + h) - f(x))/h]

Substituting f(x) = √(2x + 1), we can calculate the derivative by evaluating the limit as h approaches 0. We need to substitute (x + h) and x into the function f(x), subtract them, and divide by h. Simplifying and evaluating the limit will give us the derivative f'(x).

To find the equation of the tangent line to the graph of f(x) = √(2x + 1) at x = 4, we need to use the derivative f'(x) that we computed in part (a). The equation of a tangent line can be written in the point-slope form:

y - y1 = m(x - x1)

where (x1, y1) is a point on the tangent line and m is the slope of the tangent line. Substituting x1 = 4 and using the calculated derivative f'(x), we can determine the slope of the tangent line. Then, using the point-slope form and the point (4, f(4)), we can write the equation of the tangent line. Simplifying the equation will give us the final result.

Learn more about derivative here:

brainly.com/question/29144258

#SPJ11

The value of R2 always ...
lies below 0
lies above 1
lies between 0 and 1
lies between -1 and +1

Answers

The value of R2 always lies between 0 and 1.The value of R2 represents the proportion of the variation in the dependent variable that can be explained by the independent variables, ranging from 0 to 1.

The value of R2, also known as the coefficient of determination, measures the goodness of fit of a regression model. It represents the proportion of the total variation in the dependent variable that is explained by the independent variables in the model.

R2 ranges between 0 and 1, where 0 indicates that the independent variables have no explanatory power and cannot predict the dependent variable's variation. On the other hand, an R2 value of 1 indicates that the independent variables perfectly explain all the variation in the dependent variable.

An R2 value greater than 1 or less than 0 is not possible because it would imply that the model explains more than 100% or less than 0% of the dependent variable's variation, which is not meaningful. Therefore, the value of R2 always lies between 0 and 1, providing a measure of the model's explanatory power.

To learn more about coefficient, click here:

/brainly.com/question/1594145

#SPJ1

Please Identify Binomial, Hypergeometric, Poisson and Geometric distributions from special discrete distributions and explain them with probability functions.

Answers

Special discrete distributionsBinomial distributionThis distribution refers to the number of successes occurring in a sequence of independent and identical trials. It has a fixed sample size, n, and two possible outcomes.

Binomial distribution is a probability distribution that is widely used in statistical analysis to model events that have two possible outcomes: success and failure.Hypergeometric distributionThis distribution refers to the number of successes occurring in a sample drawn from a finite population that has both successes and failures. It has no fixed sample size, n, and the population size is usually small. The number of successes in the sample will be different from one trial to another.Poisson distributionThis distribution refers to the number of events occurring in a fixed interval of time or space.

Poisson distribution is a probability distribution used to model rare events with a high level of randomness. It is a special case of the binomial distribution when the probability of success is small and the number of trials is large.Geometric distributionThis distribution refers to the number of trials needed to obtain the first success in a sequence of independent and identical trials. It has no fixed sample size, n, and two possible outcomes. Geometric distribution is a probability distribution used to model the number of trials required to get the first success in a sequence of independent and identically distributed Bernoulli trials (each with a probability of success p).

Probability functionsBinomial distribution: P(X=k) = (n k) * p^k * (1-p)^(n-k) where X represents the number of successes, k represents the number of trials, n represents the sample size, and p represents the probability of success.Hypergeometric distribution: P(X=k) = [C(A,k) * C(B,n-k)] / C(N,n) where X represents the number of successes, k represents the number of trials, A represents the number of successes in the population, B represents the number of failures in the population, N represents the population size, and n represents the sample size.Poisson distribution: P(X=k) = (e^(-λ) * λ^k) / k! where X represents the number of events, k represents the number of occurrences,

and λ represents the expected value of the distribution.Geometric distribution: P(X=k) = p * (1-p)^(k-1) where X represents the number of trials, k represents the number of successes, and p represents the probability of success in a single trial.

Learn more about Probability here,https://brainly.com/question/13604758

#SPJ11

There are two ways to compare ME alternatives for equal life service: - Least common multiple (LCM) of lives - Specified study period Comparing two different-life alternatives using any of the methods results: a. none of the answers b. the same alternative is selected. c. each method may result in selecting a different alternative.

Answers

The correct option is C. Each method may result in selecting a different alternative. Two ways to compare mutually exclusive alternatives for equal life service are the LCM of lives method and the specified study period method, with each method potentially leading to the selection of a different alternative.

Each method may result in selecting a different alternative. There are two ways to compare ME alternatives for equal life service, they include:

Least common multiple (LCM) of lives

Specified study period

Comparing two different-life alternatives using any of the methods results in selecting a different alternative.

When using the least common multiple (LCM) method to compare alternatives with different lives for equal life service, the following steps are taken:

Identify the lives of the alternatives.

Determine the least common multiple (LCM) of the lives by multiplying the highest life by the lowest life’s common factors.

Choose the service life of the alternatives to be the LCM.

Express the PW of each alternative as an equal series of PWs having a number of terms equal to the LCM divided by the life of the alternative.

Compute the PW of each alternative using the computed series and the minimum acceptable rate.

When using the specified study period method to compare alternatives with different lives for equal life service, the following steps are taken:

Identify the lives of the alternatives.

Determine the common study period that represents the period during which service is required.

Express the PW of each alternative as an equal series of PWs having a number of terms equal to the common study period.

Compute the PW of each alternative using the computed series and the minimum acceptable rate.

Thus, the correct option is : (c).

To learn more about Least common multiple (LCM) visit : https://brainly.com/question/10749076

#SPJ11

If f(x)=sin√(2x+3), then f ′(x) = ____

Answers

The derivative of f(x) = sin√(2x+3) is f'(x) = (cos√(2x+3)) / (2√(2x+3)). This derivative formula allows us to find the rate of change of the function at any given point and can be used in various applications involving trigonometric functions.

The derivative of f(x) = sin√(2x+3) is given by f'(x) = (cos√(2x+3)) / (2√(2x+3)).

To find the derivative of f(x), we use the chain rule. Let's break down the steps:

1. Start with the function f(x) = sin√(2x+3).

2. Apply the chain rule: d/dx(sin(u)) = cos(u) * du/dx, where u = √(2x+3).

3. Differentiate the inside function u = √(2x+3) with respect to x. We get du/dx = 1 / (2√(2x+3)).

4. Multiply the derivative of the inside function (du/dx) with the derivative of the outside function (cos(u)).

5. Substitute the values back: f'(x) = (cos√(2x+3)) / (2√(2x+3)).

Learn more about click here: brainly.com/question/30710281

#SPJ11

Find the radius of convergence, R, of the series. n=2∑[infinity]​n​xn+2/√n​ R= Find the interval, I, of convergence of the series. (Enter your answer using interval notation.) I = ___

Answers

The interval of convergence (I) is then (-1, 1), as it includes all values of x that satisfy |x| < 1.

To find the radius of convergence (R) of the series, we can apply the ratio test. The ratio test states that for a series ∑a_n*x^n, if the limit of |a_(n+1)/a_n| as n approaches infinity exists, then the series converges if the limit is less than 1 and diverges if the limit is greater than 1.

In this case, we have a_n = n(x^(n+2))/√n. Let's apply the ratio test:

|a_(n+1)/a_n| = |(n+1)(x^(n+3))/√(n+1) / (n(x^(n+2))/√n)|

             = |(n+1)(x^(n+3))/√(n+1) * √n/(n(x^(n+2)))|

             = |(n+1)/n| * |x^(n+3)/x^(n+2)| * |√n/√(n+1)|

Simplifying further, we get: |a_(n+1)/a_n| = (n+1)/n * |x| * √(n/(n+1))

As n approaches infinity, (n+1)/n approaches 1, and √(n/(n+1)) approaches 1. Therefore, the limit of |a_(n+1)/a_n| is |x|.

To ensure convergence, we want |x| < 1. Therefore, the radius of convergence (R) is 1. The interval of convergence (I) is then (-1, 1), as it includes all values of x that satisfy |x| < 1.

By applying the ratio test to the series, we find that the limit of |a_(n+1)/a_n| is |x|. For convergence, we need |x| < 1. Therefore, the radius of convergence (R) is 1. The interval of convergence (I) includes all values of x that satisfy |x| < 1, which is expressed as (-1, 1) in interval notation.

LEARN MORE ABOUT convergence here: /brainly.com/question/32240414

#SPJ11

Given a normal distribution with μ=50 and σ=5, and given you select a sample of n=100, complete parts (a) through (d). a. What is the probability that Xˉ is less than 49 ? P( X<49)= (Type an integer or decimal rounded to four decimal places as needed.) b. What is the probability that Xˉ is between 49 and 51.5 ? P(49< X<51.5)= (Type an integer or decimal rounded to four decimal places as needed.) c. What is the probability that X is above 50.9 ? P( X >50.9)= (Type an integer or decimal rounded to four decimal places as needed.) d. There is a 35% chance that Xˉ is above what value? X=

Answers

a.The probability that Xˉ is less than 49 is 0.0228.b.The probability that X is above 50.9 is 0.0359.c.The probability that X is above 50.9 is 0.0359.d.There is a 35% chance that Xˉ is above 50.01925.

a. What is the probability that Xˉ is less than 49 ?The given μ=50 and σ=5. We have a sample of n=100. The Central Limit Theorem states that the sampling distribution of the sample mean is normal, mean μ and standard deviation σ/sqrt(n).

So the mean of the sampling distribution of the sample mean is 50 and the standard deviation is 5/10=0.5. To find P( X <49) we need to standardize the variable.  z=(x-μ)/σz=(49-50)/0.5=-2P( X <49)= P(z < -2)P(z < -2)= 0.0228Therefore, the probability that Xˉ is less than 49 is 0.0228.

b.Using the mean of the sampling distribution of the sample mean 50 and the standard deviation 0.5, let’s calculate the standardized z-scores for 49 and 51.5. z1=(49-50)/0.5=-2 and z2=(51.5-50)/0.5=1P(49< X <51.5)=P(-250.9)= P(z > 1.8)P(z > 1.8)= 0.0359.

c.Therefore, the probability that X is above 50.9 is 0.0359.

d.We want to find the value of Xˉ such that P(Xˉ > x) = 0.35.Using the standard normal distribution table, the z-score that corresponds to 0.35 is 0.385. Therefore,0.385 = (x - μ) / (σ/√n)0.385 = (x - 50) / (0.5/10)We can solve for x.0.385 = 20(x - 50)0.385/20 = x - 50x = 50 + 0.01925x = 50.01925Therefore, there is a 35% chance that Xˉ is above 50.01925.

Learn more about Central Limit Theorem here,

https://brainly.com/question/13652429

#SPJ11

1. Mrs. Washington went to the store to purchase white boards for her students. The boards she chose cost $7.98 each. Her school has authorized up to $225, therefore, Mrs. Washington can purchase 29 boards. True False 2. When Sarah bought school supplies, the total cost was $31.76. Sarah gave the cashier two twentydollar bills, so her change should be $8.24. * True False 3. Juan wants to place a border along his four flower gardens. He measures the lengths of each and finds them to be 1.25 m,1.4 m,0.83 m, and 1.68 m. If Juan buys 5 meters of border, he will have just enough border to line the front of the four gardens. * True

Answers

The first statement is False. Mrs. Washington can purchase 28 boards, not 29, with the authorized budget. The second statement is False. If Sarah gave the cashier two twenty-dollar bills for a total of $40, her change should be $8, not $8.24. The third statement is True.

In the first statement, the cost of each white board is given as $7.98. To find the number of boards Mrs. Washington can purchase with a budget of $225, we divide the budget by the cost per board: $225 / $7.98 ≈ 28 boards. Therefore, Mrs. Washington can purchase 28 boards, not 29, so the statement is False.

In the second statement, if Sarah gave the cashier two twenty-dollar bills, the total amount given would be $40. If the total cost of the school supplies was $31.76, her change should be $8, not $8.24. Therefore, the second statement is False.

In the third statement, Juan measures the lengths of his four flower gardens and finds the total length to be 1.25 m + 1.4 m + 0.83 m + 1.68 m = 5.16 m. If Juan buys 5 meters of border, it will be just enough to line the front of the four gardens, as 5 meters is equal to the total length of the gardens. Therefore, the third statement is True.

Learn more about budget : brainly.com/question/31952035

#SPJ11

If applied to the function, f, the transformation (x,y)→(x−4,y−6) can also be written as Select one: [. f(x+4)−6 b. f(x−4)−6 c. f(x+4)+6 d. f(x−4)+6 Clear my choice

Answers

The correct answer is b. f(x−4)−6. The other options are not correct because they do not accurately represent the given transformation.

The transformation (x,y)→(x−4,y−6) shifts the original function f by 4 units to the right and 6 units downward. In terms of the function notation, this means that we need to replace the variable x in f with (x−4) to represent the horizontal shift, and then subtract 6 from the result to represent the vertical shift.

By substituting (x−4) into f, we account for the rightward shift. The transformation then becomes f(x−4), indicating that we evaluate the function at x−4. Finally, subtracting 6 from the result represents the downward shift, giving us f(x−4)−6.

Option a, f(x+4)−6, would result in a leftward shift by 4 units instead of the required rightward shift. Option c, f(x+4)+6, represents a rightward shift but in the opposite direction of what is specified. Option d, f(x−4)+6, represents a correct horizontal shift but an upward shift instead of the required downward shift. Therefore, option b is the correct choice.

To know more about the transformation visit:

https://brainly.com/question/10904859

#SPJ11

Commuting Times for College Students The mean travel time to work for Americans is 25.3 minutes. An employment agency wanted to test the mean commuting times for college graduates and those with only some college. Thirty college graduates spent a mean time of 40.30 minutes commuting to work with a population variance of 56.73. Thirty workers who had completed some college had a mean commuting time of 36.34 minutes with a population variance of 35.58. At the 0.01 level of significance, can a difference in means be concluded? Use μ1 for the mean for college graduates. (a) State the hypotheses and identify the claim. H0: H1 ÷ This hypothesis test is a test. (b) Find the critical value(s). Critical value(s): (c) Compute the test value.

Answers

The null hypothesis is rejected. At the 0.01 level of significance, there is sufficient evidence to conclude that there is a difference in the mean commuting times for college graduates and those who had completed some college.

a) State the hypotheses and identify the claim.HypothesesH0: μ1=μ2H1: μ1≠μ2This hypothesis test is a two-tailed test.Identify the claimA difference in means can be concluded.

b) Find the critical value(s).We can find the critical value(s) from t-distribution table at degree of freedom (df) = n1+n2-2=30+30-2=58 and level of significance α=0.01. This gives us the critical values of t at the level of significance as follows: Upper critical value: t=±2.663

c) Compute the test value.We can use the formula below to calculate the test value:t=  (x1-x2) / [sqrt(sp2/n1 + sp2/n2)], wherepooled variance sp2 = [(n1-1)*s12 + (n2-1)*s22] / (n1+n2-2), n1=30, n2=30, x1=40.30, x2=36.34, s12=56.73, and s22=35.58.pooled variance sp2 = [(30-1)*56.73 + (30-1)*35.58] / (30+30-2)= [(29*56.73) + (29*35.58)] / 58= 46.6552t=  (x1-x2) / [sqrt(sp2/n1 + sp2/n2)]= (40.30-36.34) / [sqrt(46.6552/30 + 46.6552/30)]= 3.60The calculated value of the test statistic is t = 3.60. The upper critical value of t at α = 0.01 is t = 2.663.

The calculated value of the test statistic, 3.60 is greater than the upper critical value of t = 2.663. Therefore, the null hypothesis is rejected. At the 0.01 level of significance, there is sufficient evidence to conclude that there is a difference in the mean commuting times for college graduates and those who had completed some college.

Learn more about Hypothesis here,https://brainly.com/question/606806

#SPJ11

A sample of size n=83 is drawn from a population whose standard deviation is σ=12. Find the margin of error for a 95% confidence interval for μ. Round the answer to at least three decimal places. The margin of error for a 95% confidence interval for μ is

Answers

Given that the sample size `n = 83`,

the population standard deviation `σ = 12` and the confidence level is `95%`.

The formula for finding the margin of error is as follows:`

Margin of error = (z)(standard error)`

Where `z` is the z-score and `standard error = (σ/√n)`.

The `standard error` represents the standard deviation of the sampling distribution of the mean.

Here, the formula becomes:`

Margin of error = z(σ/√n)`

The z-score corresponding to a `95%` confidence level is `1.96`.

Substitute the given values into the formula to obtain the margin of error:

`Margin of error = (1.96)(12/√83)`

Solve for the margin of error using a calculator.`

Margin of error = 2.3029` (rounded to four decimal places).

The margin of error for a `95%` confidence interval for μ is `2.303` (rounded to at least three decimal places).

Answer: `2.303`

To know more about confidence visit:

https://brainly.com/question/29048041

#SPJ11

The validity of measurement or data refers to the
a. Deductive justification of the numerical scale for data
b.Elimination of effects of constructive perception on data
c.Elimination of theory-laden data from science
d.Explanation of data points
e.Accuracy of the measurement instrument or data-acquisition tool

2.The constructive nature of perception is best described as
a.The influence of expectations on sense-perception
b.Memories that are literal copies
c.A one-to-one correspondence between perception and reality
d.Pareidolia misperception
e. All of the above

Answers

The validity of measurement or data refers to the accuracy of the measurement instrument or data-acquisition tool. The answer is option(e).

The constructive nature of perception is best described as the influence of expectations on sense-perception. The answer is option(a).

1) The validity of measurement or data refers to the accuracy of the measurement instrument or data-acquisition tool. It is a basic assessment of the instrument's accuracy, including whether it can properly and appropriately evaluate what it was intended to evaluate.

2) Our experiences can affect how we interpret sensory data, causing us to see things that aren't there or failing to see things that are. As a result, perception is a two-way street in which sensory input is combined with prior experiences to create our understanding of the world around us.

Learn more about validity of measurement:

brainly.com/question/32767708

#SPJ11

Solve x+5cosx=0 to four decimal places by using Newton's method with x0​=−1,2,4. Disenss your answers. Consider the function f(x)=x+sin2x. Determine the lowest and highest values in the interval [0,3] Suppose that there are two positive whole numbers, where the addition of three times the first numbers and five times the second numbers is 300 . Identify the numbers such that the resulting product is a maximum.

Answers

Using Newton's method with initial approximations x0 = -1, x0 = 2, and x0 = 4, we can solve the equation x + 5cos(x) = 0 to four decimal places.

For x0 = -1:

Using the derivative of the function, f'(x) = 1 - 5sin(x), we can apply Newton's method:

x1 = x0 - (f(x0))/(f'(x0)) = -1 - (−1 + 5cos(-1))/(1 - 5sin(-1)) ≈ -1.2357

Continuing this process iteratively, we find the solution x ≈ -1.2357.

For x0 = 2:

x1 = x0 - (f(x0))/(f'(x0)) = 2 - (2 + 5cos(2))/(1 - 5sin(2)) ≈ 1.8955

Continuing this process iteratively, we find the solution x ≈ 1.8955.

For x0 = 4:

x1 = x0 - (f(x0))/(f'(x0)) = 4 - (4 + 5cos(4))/(1 - 5sin(4)) ≈ 4.3407

Continuing this process iteratively, we find the solution x ≈ 4.3407.

So, the solutions to the equation x + 5cos(x) = 0, using Newton's method with initial approximations x0 = -1, 2, and 4, are approximately -1.2357, 1.8955, and 4.3407, respectively.

Regarding the function f(x) = x + sin(2x), we need to find the lowest and highest values in the interval [0,3]. To do this, we evaluate the function at the endpoints and critical points within the interval.

The critical points occur when the derivative of f(x) is equal to zero. Taking the derivative, we have f'(x) = 1 + 2cos(2x). Setting f'(x) = 0, we find that cos(2x) = -1/2. This occurs at x = π/6 and x = 5π/6 within the interval [0,3].

Evaluating f(x) at the endpoints and critical points, we find f(0) = 0, f(π/6) ≈ 0.4226, f(5π/6) ≈ 2.5774, and f(3) ≈ 3.2822.

Therefore, the lowest value in the interval [0,3] is approximately 0 at x = 0, and the highest value is approximately 3.2822 at x = 3.

Regarding the problem of finding two positive whole numbers such that the sum of three times the first number and five times the second number is 300, we can denote the two numbers as x and y.

Based on the given conditions, we can form the equation 3x + 5y = 300. To find the numbers that maximize the resulting product, we need to maximize the value of xy.

To solve this problem, we can use various techniques such as substitution or graphing. Here, we'll use the substitution method:

From the equation 3x + 5y = 300, we can isolate one variable. Let's solve for y:

5y = 300 - 3x

y = (300 - 3x)/5

Now, we can express the product xy:

P = xy = x[(300 - 3x)/5

]

To find the maximum value of P, we can differentiate it with respect to x and set the derivative equal to zero:

dP/dx = (300 - 3x)/5 - 3x/5 = (300 - 6x)/5

(300 - 6x)/5 = 0

300 - 6x = 0

6x = 300

x = 50

Substituting x = 50 back into the equation 3x + 5y = 300, we find:

3(50) + 5y = 300

150 + 5y = 300

5y = 150

y = 30

Therefore, the two positive whole numbers that satisfy the given conditions and maximize the product are x = 50 and y = 30.

Learn more about Newton's method here:

brainly.com/question/30763640

#SPJ11

The following relationship is know to be true for two angles A and B : sin(A)cos(B)+cos(A)sin(B)=0.985526 Express A in terms of the angle B. Work in degrees and report numeric values accurate to 2 decimal places. A= Enter your answer as an expression. Be sure your variables match those in the question. If sinα=0.842 and sinβ=0.586 with both angles' terminal rays in Quadrant-I, find the values of (a) cos(α+β)= (b) sin(β−α)= Your answers should be accurate to 4 decimal places.

Answers

sin(β−α) = -0.9345 is accurate to four decimal places.

Let's find the solution to the given problem.The given relationship is sin(A)cos(B) + cos(A)sin(B) = 0.985526. The relationship sin(A)cos(B) + cos(A)sin(B) = sin(A+B) is also known as the sum-to-product identity. We can therefore say that sin(A+B) = 0.985526.

Let sinα = 0.842 and sinβ = 0.586. This places both angles' terminal rays in the first quadrant. We can therefore find the values of cosα and cosβ by using the Pythagorean Identity which is  cos²θ + sin²θ = 1.  Here, cos²α = 1 - sin²α = 1 - (0.842)² = 0.433536 which gives cosα = ±0.659722.

Here, cos²β = 1 - sin²β = 1 - (0.586)² = 0.655956 which gives cosβ = ±0.809017. From the problem, we need to find the values of cos(α+β) and sin(β−α).

a) Using the sum identity, cos(α+β) = cosαcosβ - sinαsinβ, which is cosαcosβ - sinαsinβ = (0.659722)(0.809017) - (0.842)(0.586) = 0.075584.Therefore, cos(α+β) = 0.0756. This is accurate to four decimal places.b) Using the difference identity, sin(β−α) = sinβcosα - cosβsinα, which is sinβcosα - cosβsinα = (0.586)(0.659722) - (0.809017)(0.842) = -0.93445Therefore, sin(β−α) = -0.9345. This is accurate to four decimal places.

To know more about decimal refer here:

https://brainly.com/question/30958821

#SPJ11

The charge across a capacitor is given by q=e2tcost. Find the current, i, (in Amps) to the capacitor (i=dq/dt​).

Answers

The current, i, to the capacitor is given by i = -2e^(-2t)cos(t) Amps.

To find the current, we need to differentiate the charge function q with respect to time, t.

Given q = e^(2t)cos(t), we can use the product rule and chain rule to find the derivative.

Applying the product rule, we have:

dq/dt = d(e^(2t))/dt * cos(t) + e^(2t) * d(cos(t))/dt

Differentiating e^(2t) with respect to t gives:

d(e^(2t))/dt = 2e^(2t)

Differentiating cos(t) with respect to t gives:

d(cos(t))/dt = -sin(t)

Substituting these derivatives back into the equation, we have:

dq/dt = 2e^(2t) * cos(t) - e^(2t) * sin(t)

Simplifying further, we get:

dq/dt = -2e^(2t) * sin(t) + e^(2t) * cos(t)

Finally, rearranging the terms, we have:

i = -2e^(-2t) * sin(t) + e^(-2t) * cos(t)

Therefore, the current to the capacitor is given by i = -2e^(-2t) * sin(t) + e^(-2t) * cos(t) Amps.

Learn more about probability here

brainly.com/question/13604758

#SPJ11

Find d2y​/dx2:y=lnx−xcosx.

Answers

The second derivative of y = ln(x) - xcos(x) with respect to x (d²y/dx²) is given by -1/x^2 + 2sin(x) + 2xcos(x).

To find the second derivative of y = ln(x) - xcos(x) with respect to x (d²y/dx²), we need to take the derivative of the first derivative with respect to x.

First, let's find the first derivative dy/dx:

dy/dx = d/dx(ln(x)) - d/dx(xcos(x))

Differentiating ln(x) with respect to x gives us:

d/dx(ln(x)) = 1/x

For the second term, we need to apply the product rule:

d/dx(xcos(x)) = cos(x) - xsin(x)

Now we have the first derivative:

dy/dx = 1/x - cos(x) + xsin(x)

To find the second derivative, we differentiate dy/dx with respect to x:

d²y/dx² = d/dx(1/x - cos(x) + xsin(x))

Differentiating each term separately, we have:

d/dx(1/x) = -1/x^2

d/dx(-cos(x)) = sin(x)

d/dx(xsin(x)) = sin(x) + xcos(x)

Now we can combine these results to find the second derivative:

d²y/dx² = -1/x^2 + sin(x) + xcos(x) + sin(x) + xcos(x)

Simplifying further:

d²y/dx² = -1/x^2 + 2sin(x) + 2xcos(x)

Therefore, the second derivative of y = ln(x) - xcos(x) with respect to x (d²y/dx²) is:

d²y/dx² = -1/x^2 + 2sin(x) + 2xcos(x)

To learn more about derivative  Click Here: brainly.com/question/29144258

#SPJ11

The horse racing record for a 1.50-mi track is shared by two horses: Fiddle Isle, who ran the race in 147 s on March 21, 1970, and John Henry, who ran the same distance in an equal time on March 16, 1980.What were the horses' average speeds in a) mi/s? b) mi/h?

Answers

The horses' average speeds are approximately:

(a) mi/s: 0.0102 mi/s

(b) mi/h: 58.06 mi/h

To calculate the horses' average speeds, we need to calculate the speed as distance divided by time.

We have:

Distance: 1.50 miles

Time: 147 seconds

(a) To calculate the average speed in mi/s, we divide the distance by the time:

Average speed = Distance / Time

Speed of Fiddle Isle = 1.50 miles / 147 seconds ≈ 0.0102 mi/s

Speed of John Henry = 1.50 miles / 147 seconds ≈ 0.0102 mi/s

(b) To calculate the average speed in mi/h, we need to convert the time from seconds to hours:

Average speed = Distance / Time

Since 1 hour has 3600 seconds, we can convert the time to hours:

Time in hours = 147 seconds / 3600 seconds/hour

Speed of Fiddle Isle = 1.50 miles / (147 seconds / 3600 seconds/hour) ≈ 58.06 mi/h

Speed of John Henry = 1.50 miles / (147 seconds / 3600 seconds/hour) ≈ 58.06 mi/h

To know more about average speeds refer here:

https://brainly.com/question/13318003#

#SPJ11

A grain silo has a cylindrical shape. Its radius is 9.5ft, and its height is 39ft. Answer the parts below. Make sure that you use the correct units in your answers. If necessary, refer to the list of geometry formulas. (a) Find the exact volume of the silo. Write your answer in termis of π
.

Exact volume: (b) Using the ALEKS calculator, approximate the volume of the silo, To do the approximation, use your answer to part (a) and the π button on the calculator. Round your answer to the nearest hundredth.

Answers

a. The exact volume of the silo is 3515.975π cubic feet.

b.  The approximate volume of the silo is 10578.50 cubic feet.

(a) The exact volume of a cylinder can be calculated using the formula:

Volume = π * radius^2 * height

Given that the radius is 9.5 ft and the height is 39 ft, we can substitute these values into the formula:

Volume = π * (9.5 ft)^2 * 39 ft

= π * 90.25 ft^2 * 39 ft

= 90.25π * 39 ft^3

= 3515.975π ft^3

Therefore, the exact volume of the silo is 3515.975π cubic feet.

(b) To approximate the volume of the silo using the ALEKS calculator, we can use the value of π provided by the calculator and round the answer to the nearest hundredth.

Approximate volume = π * (radius)^2 * height

≈ 3.14 * (9.5 ft)^2 * 39 ft

≈ 3.14 * 90.25 ft^2 * 39 ft

≈ 10578.495 ft^3

Rounded to the nearest hundredth, the approximate volume of the silo is 10578.50 cubic feet.

To know more about Volume of Cylinder here.

brainly.com/question/16134180

#SPJ11

Other Questions
the report server was unable to validate the integrity of encrypted data in the database. (True or False) please show work8. A plastic disk of radius 15 cm is spinning at 130 rpm. What is the magnitude of the centripetal acceleration of the outer rim of the disk? Instructions: Use four decimal places for your calculations. Show your answers by rounding the calculation results to two decimal places if answers are in dollars. For example, if your calculation results in $100.1265, show your answer as $100.13. If you need to show your answers as a percent, take four decimal places from your calculation, converting them into a percent. For example, if your calculation results in 0.4567, show 45.67%, not 46%. To set your Texas Instrument BA II PLUS calculator at 4 decimal places, press [2ND] FORMAT 4 [ENTER]. Please follow the instructions for homework assignments on the syllabus. Questions Part I (TVM of lump-sum amounts): Find the following values. (1) The future value of $300 compounded for 10 years at 10% (2) The present value of $300 due in 10 years at a discount rate of 10% Part II (Annuities): Find the following values. (3) The future value of $500 per year for 20 years at 10%. Assume that payments are made at the end of each year. (4) The future value of $500 per year for 20 years at 10%. Assume that payments are made at the beginning of each year. (5) The present value of $500 per year for 20 years at 10%. Assume that payments are made at the end of each year. (6) The present value of $500 per year for 20 years at 10%. Assume that payments are made at the beginning of each year. (7) The future value of $600 each 6 months for 5 years at nominal rate of 8%, compounded semiannually. Assume that payments are made at the end of each semiannual period. (8) The future value of $300 each 3 months for 5 years at nominal rate of 8%, compounded quarterly. Assume that payments are made at the end of each quarter. (9) The present value of $600 each 6 months for 5 years at nominal rate of 8%, compounded semiannually. Assume that payments are made at the end of each semiannual period. Part III (Loan amortization) (10) You are planning to borrow $500,000 on a 5 -year, 10%, annual payment, fully amortized term loan. What fraction (percentage) of the payment made at the end of the second year will represent repayment of principal? The Surface Scattering are accelerated the Verticle field and mobility, The positive and In ionized the Carriers. the due electrons Grate crashing against G real impurities, lattice Vibrations, interface, and roughness. at from other current from the Scattering lowers Limit. To (lin) = It _ I` = 9 w Uz (not T-njt') when electrons the surface by toward component of the electric to that its reduction in are alt Monted the keep bouncing Surface Oxide / silicon ballistic occurs field; They by against the oxide MOSFET, Carriers scatter from and fore The Economist article "What a Giant Stingray Says About the Mekong" discusses the recent discovery of the largest freshwater fish ever captured (and released), which occurred in the Mekong River of Southeast Asia. Although large freshwater fish are common in Southeast Asia, the fact that this giant stingray was discovered in the Mekong River provided some encouraging news regarding conservation efforts on the river. Why? Assuming that I can borrow and lend any amount at 1.25% per year with interest accrued annually in arrears: [10 marks](i) What is the present discounted value (PV) of 20,000 due 5 years from now?(ii) What principal (lump sum) must I invest now to have 20,000 in 10 years time?(iii) How would the answer in part ii) differ if interest accrued daily?You decide you need a new car at a cost of 9,990 and are offered finance terms of 60 equal monthly instalments at 13.9% APR with interest charged on the outstanding debt on a monthly basis.3.[15 marks](i) What is the total amount repaid each month? What is the overall cost of the loan?(ii) What is the capital payment for the first monthly payment? What is the interest payment for thefirst monthly repayment?(iii) What is the total end of loan repayment if the loan was repaid with a single lump sum payment atthe end of the loan period rather than monthly? How much more does this method of repayment cost you relative to part (i)? ANSWER ALL QUESTIONS Q1. 30 marks Two tanks are initially filled with air initially at a temperature To = 300 K and pressure po = 1 bar. Tank 1 has a volume of Vi = 2 m, and the temperature of its contents is maintained at T1 = 300 K; tank 2 has a volume of V2 = 1 m, and the temperature of its contents is maintained at T2 = 300 K. At time t = 0, a compressor is turned on which feeds air at po and To into into tank 1 at a volumetric flow rate of Vin = 0.3 m min-!. Air flows from tank 1 to tank 2 at a molar flow rate given by the difference in pressure between the two tanks Ni = K (PI-pa), where Ki = 1 mols-bar-l. Air also leaves tank 2 to the surroundings at a flow rate N2 = K2(p2 - po), where K2 = 1 mol s-bar-l, and pos = 1 bar. Air can be considered an ideal gas, PV = NRT, where p is pressure, V is volume, N is the number of moles, R = 8.314 J mol-'K' is the gas constant, 7 is the absolute temperature. P Tout of moles of air within tank 2 (8 marks) (b) Clearly state the initial conditions for each of the differential equations derived above. Pick a specific digital technology that you think will bring achange in our lives in the next 5-10 years. Explain how and whywill this technology make a difference in our lives in the next 5years. the header file is also known as the ____________________. 8. _______ produced in the thermocouple due to difference ofjunction temperature.a) E.M.Fb)Currentc)Resistanced)a & b are correcte)c & a are correct if all of the asteroids in the solar system were gathered into a single object, it would make an object Laman bought 100 shares of Blue Sun in 2019 for $5,000. He paid a $50 commission at the time of purchase. in 2020, he received a nondividend distribution of $200. The distribution represented a nontaxable return of capital. There were no other dividend payments or distribubions. Laman sold the stock in 2021. What is his basis at the time of sale? a $45.46 b $47.27 c $48.09 d $50 On July 9, 2021. Wildhorse Enterprises inc discovered it had recorded the 582,000 purchase of land as legal expense on November 8.2020. The company had reported retained earnings of $625.000 at its previous year end, December 31.2020 During 2021, Wildhorse had profit of $210,000 and it deciared and pald cash dividends of $235,000. Wildhorse has a 25% income tax rate. Prepare the journal entry to correct the error. (Credit account tirles are automaticalfy indented when the amount is entered. Do not indent manually. If no entry is reauired, select "No Entry" for the account titles and enter 0 for the amounts.) Assuming the company reports under ASPE, prepare a statement of retained earnings. (List items that increase retained earnings first.) on august 31, the balance sheet of sheridan company showed cash $12,000, accounts Recievable $4,700, supplies $600, equipment $6,000, accounts payable $6,600, common stock $15,700, and retained earnings 1,000. during september, the following transactions occured1. paid 3,350 cash for accounts payable due2. collected $1,350 of accounts recievable3. purchased additional equipment for $1,900, payable $850 in cash and the balance on account4. recognized revenue of $7,600, of which $3,250 is collected in cash and the balance is due in October5. declared and paid a $850 cash dividend6. paid salaries $2,300, rent for september $1,000, and advertising expense $1507. incurred utilities expense for month on account $1808. recieved $13,000 for capital bank on a 6 month note payable let f: R[1,+[infinity]) by f(x)=x 2 +1. This is a surjective but not injective function. So, it has right inverse. but it is nat unique. Provide twas dhfferent. right inverse functians of f. In your own words (prior to starting many details in this class), how would you describe accounting? What do you think you are going to be learning about in this introductory accounting course?Your initial post should be 2-3 paragraphs in length using sentences and proper grammar.You should respond to at least one other student with at least 3 complete sentences.LO1-1. Describe the nature of business and the role of accounting and ethics in business. (CO 6) Grover Inc. has decided to use an R-Chart to monitor the changes in the variability of their 72.00 pound steel handles. The production manager randomly samples 8 steel handles and measures the weight of the sample (in pounds) at 20 successive time periods. Table Control Chart Step 5 of 7: Use the following sample data, taken from the next time period, to determine if the process is "In Control" Or "Out of Control". Observations: 71.97,71.98,71.98,72,71.99,71.95,72.01,71.98 Sample Range: 0.06 3) Price Elasticity: Use the following equation to answer the problem and identify if the answer represents either elastic, inelastic, or unit elastic A) The price of movie tickets increases 8.5% and quantity demanded decreases by 11.5%. Ed= B) The price of pizza decreases by 5% and quantity demanded increased by 3.5%. Ed= C) The price of wheat increases by 4.25% and quantity demanded decreases by 4.25%. Ed= What are the benefits and liabilities of "micromanaging"?Provide some examples. Why do firms need to look at Human Resources in a strategic way,concerning international business?